Port (TCP): Unterschied zwischen den Versionen
Aus Byte-Welt Wiki
Keine Bearbeitungszusammenfassung |
K 1 Versionen |
||
(kein Unterschied)
| |||
Version vom 13. Juni 2007, 18:44 Uhr
Standardisierte Portbelegungen bei TCP, sie werden in 3 Bereiche eingeteilt
- 0-1023 - Allgemein bekannte well-known Ports, diese werden durch die IANA kontrolliert und sind für priviligierte Prozesse vorgesehen
- 1024-49151 - Registrierte Ports für Benutzerprozesse auch sie werden von der IANA gepflegt aber unterliegen nicht ihrer Kontrolle
- 49152-65535 - Dynamische oder Private Ports, die keinerlei Kontrolle unterliegen
| Port | Bezeichnung(Dienst) |
|---|---|
| 0 | Reserved |
| 1 | TCP Port Service Multiplexer(tcpmux) |
| 2 | Management Utility(compressnet) |
| 3 | Compression Process(compressnet) |
| 5 | Remote Job Entry(rje) |
| 7 | Echo(echo) |
| 9 | Discard(discard) |
| 11 | Active Users(systat) |
| 13 | Daytime (RFC 867)(daytime) |
| 17 | Quote of the Day(qotd) |
| 18 | Message Send Protocol(msp) |
| 19 | Character Generator(chargen) |
| 20 | File Transfer [Default Data](ftp-data) |
| 21 | File Transfer [Control](ftp) |
| 22 | SSH Remote Login Protocol(ssh) |
| 23 | Telnet(telnet) |
| 24 | any private mail system |
| 25 | Simple Mail Transfer(smtp) |
| 27 | NSW User System FE(nsw-fe) |
| 29 | MSG ICP(msg-icp) |
| 31 | MSG Authentication(msg-auth) |
| 33 | Display Support Protocol(dsp) |
| 35 | any private printer server |
| 37 | Time(time) |
| 38 | Route Access Protocol(rap) |
| 39 | Resource Location Protocol(rlp) |
| 41 | Graphics(graphics) |
| 42 | Host Name Server(name) |
| 42 | Host Name Server(nameserver) |
| 43 | Who Is(nicname) |
| 44 | MPM FLAGS Protocol(mpm-flags) |
| 45 | Message Processing Module [recv](mpm) |
| 46 | MPM [default send](mpm-snd) |
| 47 | NI FTP(ni-ftp) |
| 48 | Digital Audit Daemon(auditd) |
| 49 | Login Host Protocol (TACACS)(tacacs) |
| 50 | Remote Mail Checking Protocol(re-mail-ck) |
| 51 | IMP Logical Address Maintenance(la-maint) |
| 52 | XNS Time Protocol(xns-time) |
| 53 | Domain Name Server(domain) |
| 54 | XNS Clearinghouse(xns-ch) |
| 55 | ISI Graphics Language(isi-gl) |
| 56 | XNS Authentication(xns-auth) |
| 57 | any private terminal access |
| 58 | XNS Mail(xns-mail) |
| 59 | any private file service |
| 60 | Unassigned |
| 61 | NI MAIL(ni-mail) |
| 62 | ACA Services(acas) |
| 64 | Communications Integrator (CI)(covia) |
| 65 | TACACS-Database Service(tacacs-ds) |
| 67 | Bootstrap Protocol Server(bootps) |
| 68 | Bootstrap Protocol Client(bootpc) |
| 69 | Trivial File Transfer(tftp) |
| 70 | Gopher(gopher) |
| 71 | Remote Job Service(netrjs-1) |
| 72 | Remote Job Service(netrjs-2) |
| 73 | Remote Job Service(netrjs-3) |
| 74 | Remote Job Service(netrjs-4) |
| 75 | any private dial out service |
| 76 | Distributed External Object Store(deos) |
| 77 | any private RJE service |
| 78 | vettcp(vettcp) |
| 79 | Finger(finger) |
| 80 | World Wide Web HTTP (http/www/www-http)(http) |
| 81 | HOSTS2 Name Server(hosts2-ns) |
| 82 | XFER Utility(xfer) |
| 83 | MIT ML Device(mit-ml-dev) |
| 84 | Common Trace Facility(ctf) |
| 85 | MIT ML Device(mit-ml-dev) |
| 86 | Micro Focus Cobol(mfcobol) |
| 87 | any private terminal link |
| 88 | Kerberos(kerberos) |
| 89 | SU/MIT Telnet Gateway(su-mit-tg) |
| 90 | DNSIX Securit Attribute Token Map(dnsix) |
| 91 | MIT Dover Spooler(mit-dov) |
| 92 | Network Printing Protocol(npp) |
| 93 | Device Control Protocol(dcp) |
| 94 | Tivoli Object Dispatcher(objcall) |
| 95 | SUPDUP(supdup) |
| 96 | DIXIE Protocol Specification(dixie) |
| 97 | Swift Remote Virtural File Protocol(swift-rvf) |
| 98 | TAC News(tacnews) |
| 99 | Metagram Relay(metagram) |
| 101 | NIC Host Name Server(hostname) |
| 102 | ISO-TSAP Class 0(iso-tsap) |
| 103 | Genesis Point-to-Point Trans Net(gppitnp) |
| 104 | ACR-NEMA Digital Imag. & Comm. 300(acr-nema) |
| 105 | CCSO name server protocol(cso) |
| 105 | Mailbox Name Nameserver(csnet-ns) |
| 106 | 3COM-TSMUX(3com-tsmux) |
| 107 | Remote Telnet Service(rtelnet) |
| 108 | SNA Gateway Access Server(snagas) |
| 109 | Post Office Protocol - Version 2(pop2) |
| 110 | Post Office Protocol - Version 3(pop3) |
| 111 | SUN Remote Procedure Call(sunrpc) |
| 112 | McIDAS Data Transmission Protocol(mcidas) |
| 113 | (ident) |
| 113 | Authentication Service(auth) |
| 115 | Simple File Transfer Protocol(sftp) |
| 116 | ANSA REX Notify(ansanotify) |
| 117 | UUCP Path Service(uucp-path) |
| 118 | SQL Services(sqlserv) |
| 119 | Network News Transfer Protocol(nntp) |
| 120 | CFDPTKT(cfdptkt) |
| 121 | Encore Expedited Remote Pro.Call(erpc) |
| 122 | SMAKYNET(smakynet) |
| 123 | Network Time Protocol(ntp) |
| 124 | ANSA REX Trader(ansatrader) |
| 125 | Locus PC-Interface Net Map Ser(locus-map) |
| 126 | NXEdit(nxedit) |
| 126 | Unisys Unitary Login(unitary) |
| 127 | Locus PC-Interface Conn Server(locus-con) |
| 128 | GSS X License Verification(gss-xlicen) |
| 129 | Password Generator Protocol(pwdgen) |
| 130 | cisco FNATIVE(cisco-fna) |
| 131 | cisco TNATIVE(cisco-tna) |
| 132 | cisco SYSMAINT(cisco-sys) |
| 133 | Statistics Service(statsrv) |
| 134 | INGRES-NET Service(ingres-net) |
| 135 | DCE endpoint resolution(epmap) |
| 136 | PROFILE Naming System(profile) |
| 137 | NETBIOS Name Service(netbios-ns) |
| 138 | NETBIOS Datagram Service(netbios-dgm) |
| 139 | NETBIOS Session Service(netbios-ssn) |
| 140 | EMFIS Data Service(emfis-data) |
| 141 | EMFIS Control Service(emfis-cntl) |
| 142 | Britton-Lee IDM(bl-idm) |
| 143 | Internet Message Access Protocol(imap) |
| 144 | Universal Management Architecture(uma) |
| 145 | UAAC Protocol(uaac) |
| 146 | ISO-IP0(iso-tp0) |
| 147 | ISO-IP(iso-ip) |
| 148 | Jargon(jargon) |
| 149 | AED 512 Emulation Service(aed-512) |
| 150 | SQL-NET(sql-net) |
| 151 | HEMS(hems) |
| 152 | Background File Transfer Program(bftp) |
| 153 | SGMP(sgmp) |
| 154 | NETSC(netsc-prod) |
| 155 | NETSC(netsc-dev) |
| 156 | SQL Service(sqlsrv) |
| 157 | KNET/VM Command/Message Protocol(knet-cmp) |
| 158 | PCMail Server(pcmail-srv) |
| 159 | NSS-Routing(nss-routing) |
| 160 | SGMP-TRAPS(sgmp-traps) |
| 161 | SNMP(snmp) |
| 162 | SNMPTRAP(snmptrap) |
| 163 | CMIP Manager(cmip-man) |
| 164 | CMIP Agent(cmip-agent) |
| 165 | Xerox(xns-courier) |
| 166 | Sirius Systems(s-net) |
| 167 | NAMP(namp) |
| 168 | RSVD(rsvd) |
| 169 | SEND(send) |
| 170 | Network PostScript(print-srv) |
| 171 | Network Innovations Multiplex(multiplex) |
| 172 | Network Innovations CL/1(cl/1) |
| 173 | Xyplex(xyplex-mux) |
| 174 | MAILQ(mailq) |
| 175 | VMNET(vmnet) |
| 176 | GENRAD-MUX(genrad-mux) |
| 177 | X Display Manager Control Protocol(xdmcp) |
| 178 | NextStep Window Server(nextstep) |
| 179 | Border Gateway Protocol(bgp) |
| 180 | Intergraph(ris) |
| 181 | Unify(unify) |
| 182 | Unisys Audit SITP(audit) |
| 183 | OCBinder(ocbinder) |
| 184 | OCServer(ocserver) |
| 185 | Remote-KIS(remote-kis) |
| 186 | KIS Protocol(kis) |
| 187 | Application Communication Interface(aci) |
| 188 | Plus Five's MUMPS(mumps) |
| 189 | Queued File Transport(qft) |
| 190 | Gateway Access Control Protocol(gacp) |
| 191 | Prospero Directory Service(prospero) |
| 192 | OSU Network Monitoring System(osu-nms) |
| 193 | Spider Remote Monitoring Protocol(srmp) |
| 194 | Internet Relay Chat Protocol(irc) |
| 195 | DNSIX Network Level Module Audit(dn6-nlm-aud) |
| 196 | DNSIX Session Mgt Module Audit Redir(dn6-smm-red) |
| 197 | Directory Location Service(dls) |
| 198 | Directory Location Service Monitor(dls-mon) |
| 199 | SMUX(smux) |
| 200 | IBM System Resource Controller(src) |
| 201 | AppleTalk Routing Maintenance(at-rtmp) |
| 202 | AppleTalk Name Binding(at-nbp) |
| 203 | AppleTalk Unused(at-3) |
| 204 | AppleTalk Echo(at-echo) |
| 205 | AppleTalk Unused(at-5) |
| 206 | AppleTalk Zone Information(at-zis) |
| 207 | AppleTalk Unused(at-7) |
| 208 | AppleTalk Unused(at-8) |
| 209 | The Quick Mail Transfer Protocol(qmtp) |
| 210 | ANSI Z39.50(z39.50) |
| 211 | Texas Instruments 914C/G Terminal(914c/g) |
| 212 | ATEXSSTR(anet) |
| 213 | IPX(ipx) |
| 214 | VM PWSCS(vmpwscs) |
| 215 | Insignia Solutions(softpc) |
| 216 | Computer Associates Int'l License Server(CAIlic) |
| 217 | dBASE Unix(dbase) |
| 218 | Netix Message Posting Protocol(mpp) |
| 219 | Unisys ARPs(uarps) |
| 220 | Interactive Mail Access Protocol v3(imap3) |
| 221 | Berkeley rlogind with SPX auth(fln-spx) |
| 222 | Berkeley rshd with SPX auth(rsh-spx) |
| 223 | Certificate Distribution Center(cdc) |
| 224 | masqdialer(masqdialer) |
| 242 | Direct(direct) |
| 243 | Survey Measurement(sur-meas) |
| 244 | inbusiness(inbusiness) |
| 245 | LINK(link) |
| 246 | Display Systems Protocol(dsp3270) |
| 247 | SUBNTBCST_TFTP(subntbcst_tftp) |
| 248 | bhfhs(bhfhs) |
| 256 | RAP(rap) |
| 257 | Secure Electronic Transaction(set) |
| 259 | Efficient Short Remote Operations(esro-gen) |
| 260 | Openport(openport) |
| 261 | IIOP Name Service over TLS/SSL(nsiiops) |
| 262 | Arcisdms(arcisdms) |
| 263 | HDAP(hdap) |
| 264 | BGMP(bgmp) |
| 265 | X-Bone CTL(x-bone-ctl) |
| 266 | SCSI on ST(sst) |
| 267 | Tobit David Service Layer(td-service) |
| 268 | Tobit David Replica(td-replica) |
| 280 | http-mgmt(http-mgmt) |
| 281 | Personal Link(personal-link) |
| 282 | Cable Port A/X(cableport-ax) |
| 283 | rescap(rescap) |
| 284 | corerjd(corerjd) |
| 286 | FXP Communication(fxp) |
| 287 | K-BLOCK(k-block) |
| 308 | Novastor Backup(novastorbakcup) |
| 309 | EntrustTime(entrusttime) |
| 310 | bhmds(bhmds) |
| 311 | AppleShare IP WebAdmin(asip-webadmin) |
| 312 | VSLMP(vslmp) |
| 313 | Magenta Logic(magenta-logic) |
| 314 | Opalis Robot(opalis-robot) |
| 315 | DPSI(dpsi) |
| 316 | decAuth(decauth) |
| 317 | Zannet(zannet) |
| 318 | PKIX TimeStamp(pkix-timestamp) |
| 319 | PTP Event(ptp-event) |
| 320 | PTP General(ptp-general) |
| 321 | PIP(pip) |
| 322 | RTSPS(rtsps) |
| 333 | Texar Security Port(texar) |
| 344 | Prospero Data Access Protocol(pdap) |
| 345 | Perf Analysis Workbench(pawserv) |
| 346 | Zebra server(zserv) |
| 347 | Fatmen Server(fatserv) |
| 348 | Cabletron Management Protocol(csi-sgwp) |
| 349 | mftp(mftp) |
| 350 | MATIP Type A(matip-type-a) |
| 351 | MATIP Type B(matip-type-b) |
| 351 | bhoetty (added 5/21/97)(bhoetty) |
| 352 | DTAG (assigned long ago)(dtag-ste-sb) |
| 352 | bhoedap4 (added 5/21/97)(bhoedap4) |
| 353 | NDSAUTH(ndsauth) |
| 354 | bh611(bh611) |
| 355 | DATEX-ASN(datex-asn) |
| 356 | Cloanto Net 1(cloanto-net-1) |
| 357 | bhevent(bhevent) |
| 358 | Shrinkwrap(shrinkwrap) |
| 359 | Network Security Risk Management Protocol(nsrmp) |
| 360 | scoi2odialog(scoi2odialog) |
| 361 | Semantix(semantix) |
| 362 | SRS Send(srssend) |
| 363 | RSVP Tunnel(rsvp_tunnel) |
| 364 | Aurora CMGR(aurora-cmgr) |
| 365 | DTK(dtk) |
| 366 | ODMR(odmr) |
| 367 | MortgageWare(mortgageware) |
| 368 | QbikGDP(qbikgdp) |
| 369 | rpc2portmap(rpc2portmap) |
| 370 | codaauth2(codaauth2) |
| 371 | Clearcase(clearcase) |
| 372 | ListProcessor(ulistproc) |
| 373 | Legent Corporation(legent-1) |
| 374 | Legent Corporation(legent-2) |
| 375 | Hassle(hassle) |
| 376 | Amiga Envoy Network Inquiry Proto(nip) |
| 377 | NEC Corporation(tnETOS) |
| 378 | NEC Corporation(dsETOS) |
| 379 | TIA/EIA/IS-99 modem client(is99c) |
| 380 | TIA/EIA/IS-99 modem server(is99s) |
| 381 | hp performance data collector(hp-collector) |
| 382 | hp performance data managed node(hp-managed-node) |
| 383 | hp performance data alarm manager(hp-alarm-mgr) |
| 384 | A Remote Network Server System(arns) |
| 385 | IBM Application(ibm-app) |
| 386 | ASA Message Router Object Def.(asa) |
| 387 | Appletalk Update-Based Routing Pro.(aurp) |
| 388 | Unidata LDM(unidata-ldm) |
| 389 | Lightweight Directory Access Protocol(ldap) |
| 390 | UIS(uis) |
| 391 | SynOptics SNMP Relay Port(synotics-relay) |
| 392 | SynOptics Port Broker Port(synotics-broker) |
| 393 | Meta5(meta5) |
| 394 | EMBL Nucleic Data Transfer(embl-ndt) |
| 395 | NETscout Control Protocol(netcp) |
| 396 | Novell Netware over IP(netware-ip) |
| 397 | Multi Protocol Trans. Net.(mptn) |
| 398 | Kryptolan(kryptolan) |
| 399 | ISO Transport Class 2 Non-Control over TCP(iso-tsap-c2) |
| 400 | Workstation Solutions(work-sol) |
| 401 | Uninterruptible Power Supply(ups) |
| 402 | Genie Protocol(genie) |
| 403 | decap(decap) |
| 404 | nced(nced) |
| 405 | ncld(ncld) |
| 406 | Interactive Mail Support Protocol(imsp) |
| 407 | Timbuktu(timbuktu) |
| 408 | Prospero Resource Manager Sys. Man.(prm-sm) |
| 409 | Prospero Resource Manager Node Man.(prm-nm) |
| 410 | DECLadebug Remote Debug Protocol(decladebug) |
| 411 | Remote MT Protocol(rmt) |
| 412 | Trap Convention Port(synoptics-trap) |
| 413 | Storage Management Services Protocol(smsp) |
| 414 | InfoSeek(infoseek) |
| 415 | BNet(bnet) |
| 416 | Silverplatter(silverplatter) |
| 417 | Onmux(onmux) |
| 418 | Hyper-G(hyper-g) |
| 419 | Ariel 1(ariel1) |
| 420 | SMPTE(smpte) |
| 421 | Ariel 2(ariel2) |
| 422 | Ariel 3(ariel3) |
| 423 | IBM Operations Planning and Control Start(opc-job-start) |
| 424 | IBM Operations Planning and Control Track(opc-job-track) |
| 425 | ICAD(icad-el) |
| 426 | smartsdp(smartsdp) |
| 427 | Server Location(svrloc) |
| 428 | OCS_CMU(ocs_cmu) |
| 429 | OCS_AMU(ocs_amu) |
| 430 | UTMPSD(utmpsd) |
| 431 | UTMPCD(utmpcd) |
| 432 | IASD(iasd) |
| 433 | NNSP(nnsp) |
| 434 | MobileIP-Agent(mobileip-agent) |
| 435 | MobilIP-MN(mobilip-mn) |
| 436 | DNA-CML(dna-cml) |
| 437 | comscm(comscm) |
| 438 | dsfgw(dsfgw) |
| 439 | dasp Thomas Obermair(dasp) |
| 440 | sgcp(sgcp) |
| 441 | decvms-sysmgt(decvms-sysmgt) |
| 442 | cvc_hostd(cvc_hostd) |
| 443 | http protocol over TLS/SSL(https) |
| 444 | Simple Network Paging Protocol(snpp) |
| 445 | Microsoft-DS(microsoft-ds) |
| 446 | DDM-Remote Relational Database Access(ddm-rdb) |
| 447 | DDM-Distributed File Management(ddm-dfm) |
| 448 | DDM-Remote DB Access Using Secure Sockets(ddm-ssl) |
| 449 | AS Server Mapper(as-servermap) |
| 450 | Computer Supported Telecomunication Applications(tserver) |
| 451 | Cray Network Semaphore server(sfs-smp-net) |
| 452 | Cray SFS config server(sfs-config) |
| 453 | CreativeServer(creativeserver) |
| 454 | ContentServer(contentserver) |
| 455 | CreativePartnr(creativepartnr) |
| 456 | macon-tcp(macon-tcp) |
| 457 | scohelp(scohelp) |
| 458 | apple quick time(appleqtc) |
| 459 | ampr-rcmd(ampr-rcmd) |
| 460 | skronk(skronk) |
| 461 | DataRampSrv(datasurfsrv) |
| 462 | DataRampSrvSec(datasurfsrvsec) |
| 463 | alpes(alpes) |
| 464 | kpasswd(kpasswd) |
| 465 | URL Rendesvous Directory for SSM(urd) |
| 466 | digital-vrc(digital-vrc) |
| 467 | mylex-mapd(mylex-mapd) |
| 468 | proturis(photuris) |
| 469 | Radio Control Protocol(rcp) |
| 470 | scx-proxy(scx-proxy) |
| 471 | Mondex(mondex) |
| 472 | ljk-login(ljk-login) |
| 473 | hybrid-pop(hybrid-pop) |
| 474 | tn-tl-w1(tn-tl-w1) |
| 475 | tcpnethaspsrv(tcpnethaspsrv) |
| 476 | tn-tl-fd1(tn-tl-fd1) |
| 477 | ss7ns(ss7ns) |
| 478 | spsc(spsc) |
| 479 | iafserver(iafserver) |
| 480 | iafdbase(iafdbase) |
| 481 | Ph service(ph) |
| 482 | bgs-nsi(bgs-nsi) |
| 483 | ulpnet(ulpnet) |
| 484 | Integra Software Management Environment(integra-sme) |
| 485 | Air Soft Power Burst(powerburst) |
| 486 | avian(avian) |
| 487 | saft Simple Asynchronous File Transfer(saft) |
| 488 | gss-http(gss-http) |
| 489 | nest-protocol(nest-protocol) |
| 490 | micom-pfs(micom-pfs) |
| 491 | go-login(go-login) |
| 492 | Transport Independent Convergence for FNA(ticf-1) |
| 493 | Transport Independent Convergence for FNA(ticf-2) |
| 494 | POV-Ray(pov-ray) |
| 495 | intecourier(intecourier) |
| 496 | PIM-RP-DISC(pim-rp-disc) |
| 497 | dantz(dantz) |
| 498 | siam(siam) |
| 499 | ISO ILL Protocol(iso-ill) |
| 500 | isakmp(isakmp) |
| 501 | STMF(stmf) |
| 502 | asa-appl-proto(asa-appl-proto) |
| 503 | Intrinsa(intrinsa) |
| 504 | citadel(citadel) |
| 505 | mailbox-lm(mailbox-lm) |
| 506 | ohimsrv(ohimsrv) |
| 507 | crs(crs) |
| 508 | xvttp(xvttp) |
| 509 | snare(snare) |
| 510 | FirstClass Protocol(fcp) |
| 511 | PassGo(passgo) |
| 512 | remote process execution;(exec) |
| 513 | remote login a la telnet;(login) |
| 514 | cmd(shell) |
| 515 | spooler(printer) |
| 516 | videotex(videotex) |
| 517 | like tenex link, but across(talk) |
| 518 | (ntalk) |
| 519 | unixtime(utime) |
| 520 | extended file name server(efs) |
| 521 | ripng(ripng) |
| 522 | ULP(ulp) |
| 523 | IBM-DB2(ibm-db2) |
| 524 | NCP(ncp) |
| 525 | timeserver(timed) |
| 526 | newdate(tempo) |
| 527 | Stock IXChange(stx) |
| 528 | Customer IXChange(custix) |
| 529 | IRC-SERV(irc-serv) |
| 530 | rpc(courier) |
| 531 | chat(conference) |
| 532 | readnews(netnews) |
| 533 | for emergency broadcasts(netwall) |
| 534 | windream Admin(windream) |
| 535 | iiop(iiop) |
| 536 | opalis-rdv(opalis-rdv) |
| 537 | Networked Media Streaming Protocol(nmsp) |
| 538 | gdomap(gdomap) |
| 539 | Apertus Technologies Load Determination(apertus-ldp) |
| 540 | uucpd(uucp) |
| 541 | uucp-rlogin(uucp-rlogin) |
| 542 | commerce(commerce) |
| 543 | (klogin) |
| 544 | krcmd(kshell) |
| 545 | appleqtcsrvr(appleqtcsrvr) |
| 546 | DHCPv6 Client(dhcpv6-client) |
| 547 | DHCPv6 Server(dhcpv6-server) |
| 548 | AFP over TCP(afpovertcp) |
| 549 | IDFP(idfp) |
| 550 | new-who(new-rwho) |
| 551 | cybercash(cybercash) |
| 552 | DeviceShare(devshr-nts) |
| 553 | pirp(pirp) |
| 554 | Real Time Stream Control Protocol(rtsp) |
| 555 | (dsf) |
| 556 | rfs server(remotefs) |
| 557 | openvms-sysipc(openvms-sysipc) |
| 558 | SDNSKMP(sdnskmp) |
| 559 | TEEDTAP(teedtap) |
| 560 | rmonitord(rmonitor) |
| 561 | (monitor) |
| 562 | chcmd(chshell) |
| 563 | nntp protocol over TLS/SSL (was snntp)(nntps) |
| 564 | plan 9 file service(9pfs) |
| 565 | whoami(whoami) |
| 566 | streettalk(streettalk) |
| 567 | banyan-rpc(banyan-rpc) |
| 568 | microsoft shuttle(ms-shuttle) |
| 569 | microsoft rome(ms-rome) |
| 570 | demon(meter) |
| 571 | udemon(meter) |
| 572 | sonar(sonar) |
| 573 | banyan-vip(banyan-vip) |
| 574 | FTP Software Agent System(ftp-agent) |
| 575 | VEMMI(vemmi) |
| 576 | ipcd(ipcd) |
| 577 | vnas(vnas) |
| 578 | ipdd(ipdd) |
| 579 | decbsrv(decbsrv) |
| 580 | SNTP HEARTBEAT(sntp-heartbeat) |
| 581 | Bundle Discovery Protocol(bdp) |
| 582 | SCC Security(scc-security) |
| 583 | Philips Video-Conferencing(philips-vc) |
| 584 | Key Server(keyserver) |
| 586 | Password Change(password-chg) |
| 587 | Submission(submission) |
| 588 | CAL(cal) |
| 589 | EyeLink(eyelink) |
| 590 | TNS CML(tns-cml) |
| 591 | FileMaker, Inc. - HTTP Alternate (see Port 80)(http-alt) |
| 592 | Eudora Set(eudora-set) |
| 593 | HTTP RPC Ep Map(http-rpc-epmap) |
| 594 | TPIP(tpip) |
| 595 | CAB Protocol(cab-protocol) |
| 596 | SMSD(smsd) |
| 597 | PTC Name Service(ptcnameservice) |
| 598 | SCO Web Server Manager 3(sco-websrvrmg3) |
| 599 | Aeolon Core Protocol(acp) |
| 600 | Sun IPC server(ipcserver) |
| 601 | Reliable Syslog Service(syslog-conn) |
| 602 | XML-RPC over BEEP(xmlrpc-beep) |
| 603 | IDXP(idxp) |
| 604 | TUNNEL(tunnel) |
| 605 | SOAP over BEEP(soap-beep) |
| 606 | Cray Unified Resource Manager(urm) |
| 607 | nqs(nqs) |
| 608 | Sender-Initiated/Unsolicited File Transfer(sift-uft) |
| 609 | npmp-trap(npmp-trap) |
| 610 | npmp-local(npmp-local) |
| 611 | npmp-gui(npmp-gui) |
| 612 | HMMP Indication(hmmp-ind) |
| 613 | HMMP Operation(hmmp-op) |
| 614 | SSLshell(sshell) |
| 615 | Internet Configuration Manager(sco-inetmgr) |
| 616 | SCO System Administration Server(sco-sysmgr) |
| 617 | SCO Desktop Administration Server(sco-dtmgr) |
| 618 | DEI-ICDA(dei-icda) |
| 619 | Compaq EVM(compaq-evm) |
| 620 | SCO WebServer Manager(sco-websrvrmgr) |
| 621 | ESCP(escp-ip) |
| 622 | Collaborator(collaborator) |
| 623 | ASF Remote Management and Control Protocol(asf-rmcp) |
| 624 | Crypto Admin(cryptoadmin) |
| 625 | DEC DLM(dec_dlm) |
| 626 | ASIA(asia) |
| 627 | PassGo Tivoli(passgo-tivoli) |
| 628 | QMQP(qmqp) |
| 629 | 3Com AMP3(3com-amp3) |
| 630 | RDA(rda) |
| 631 | IPP (Internet Printing Protocol)(ipp) |
| 632 | bmpp(bmpp) |
| 633 | Service Status update (Sterling Software)(servstat) |
| 634 | ginad(ginad) |
| 635 | RLZ DBase(rlzdbase) |
| 636 | ldap protocol over TLS/SSL (was sldap)(ldaps) |
| 637 | lanserver(lanserver) |
| 638 | mcns-sec(mcns-sec) |
| 639 | MSDP(msdp) |
| 640 | entrust-sps(entrust-sps) |
| 641 | repcmd(repcmd) |
| 642 | ESRO-EMSDP V1.3(esro-emsdp) |
| 643 | SANity(sanity) |
| 644 | dwr(dwr) |
| 645 | PSSC(pssc) |
| 646 | LDP(ldp) |
| 647 | DHCP Failover(dhcp-failover) |
| 648 | Registry Registrar Protocol (RRP)(rrp) |
| 649 | Cadview-3d - streaming 3d models over the internet(cadview-3d) |
| 650 | OBEX(obex) |
| 651 | IEEE MMS(ieee-mms) |
| 652 | HELLO_PORT(hello-port) |
| 653 | RepCmd(repscmd) |
| 654 | AODV(aodv) |
| 655 | TINC(tinc) |
| 656 | SPMP(spmp) |
| 657 | RMC(rmc) |
| 658 | TenFold(tenfold) |
| 660 | MacOS Server Admin(mac-srvr-admin) |
| 661 | HAP(hap) |
| 662 | PFTP(pftp) |
| 663 | PureNoise(purenoise) |
| 664 | ASF Secure Remote Management and Control Protocol(asf-secure-rmcp) |
| 665 | Sun DR(sun-dr) |
| 666 | (mdqs) |
| 666 | doom Id Software(doom) |
| 667 | campaign contribution disclosures - SDR Technologies(disclose) |
| 668 | MeComm(mecomm) |
| 669 | MeRegister(meregister) |
| 670 | VACDSM-SWS(vacdsm-sws) |
| 671 | VACDSM-APP(vacdsm-app) |
| 672 | VPPS-QUA(vpps-qua) |
| 673 | CIMPLEX(cimplex) |
| 674 | ACAP(acap) |
| 675 | DCTP(dctp) |
| 676 | VPPS Via(vpps-via) |
| 677 | Virtual Presence Protocol(vpp) |
| 678 | GNU Generation Foundation NCP(ggf-ncp) |
| 679 | MRM(mrm) |
| 680 | entrust-aaas(entrust-aaas) |
| 681 | entrust-aams(entrust-aams) |
| 682 | XFR(xfr) |
| 683 | CORBA IIOP(corba-iiop) |
| 684 | CORBA IIOP SSL(corba-iiop-ssl) |
| 685 | MDC Port Mapper(mdc-portmapper) |
| 686 | Hardware Control Protocol Wismar(hcp-wismar) |
| 687 | asipregistry(asipregistry) |
| 688 | ApplianceWare managment protocol(realm-rusd) |
| 689 | NMAP(nmap) |
| 690 | Velazquez Application Transfer Protocol(vatp) |
| 691 | MS Exchange Routing(msexch-routing) |
| 692 | Hyperwave-ISP(hyperwave-isp) |
| 693 | connendp(connendp) |
| 694 | ha-cluster(ha-cluster) |
| 695 | IEEE-MMS-SSL(ieee-mms-ssl) |
| 696 | RUSHD(rushd) |
| 697 | UUIDGEN(uuidgen) |
| 698 | OLSR(olsr) |
| 699 | Access Network(accessnetwork) |
| 700 | Extensible Provisioning Protocol(epp) |
| 701 | Link Management Protocol (LMP)(lmp) |
| 702 | IRIS over BEEP(iris-beep) |
| 704 | errlog copy/server daemon(elcsd) |
| 705 | AgentX(agentx) |
| 706 | SILC(silc) |
| 707 | Borland DSJ(borland-dsj) |
| 709 | Entrust Key Management Service Handler(entrust-kmsh) |
| 710 | Entrust Administration Service Handler(entrust-ash) |
| 711 | Cisco TDP(cisco-tdp) |
| 712 | TBRPF(tbrpf) |
| 729 | IBM NetView DM/6000 Server/Client(netviewdm1) |
| 730 | IBM NetView DM/6000 send(netviewdm2) |
| 731 | IBM NetView DM/6000 receive(netviewdm3) |
| 741 | netGW(netgw) |
| 742 | Network based Rev. Cont. Sys.(netrcs) |
| 744 | Flexible License Manager(flexlm) |
| 747 | Fujitsu Device Control(fujitsu-dev) |
| 748 | Russell Info Sci Calendar Manager(ris-cm) |
| 749 | kerberos administration(kerberos-adm) |
| 750 | (rfile) |
| 751 | (pump) |
| 752 | (qrh) |
| 753 | (rrh) |
| 754 | send(tell) |
| 758 | (nlogin) |
| 759 | (con) |
| 760 | (ns) |
| 761 | (rxe) |
| 762 | (quotad) |
| 763 | (cycleserv) |
| 764 | (omserv) |
| 765 | (webster) |
| 767 | phone(phonebook) |
| 769 | (vid) |
| 770 | (cadlock) |
| 771 | (rtip) |
| 772 | (cycleserv2) |
| 773 | (submit) |
| 774 | (rpasswd) |
| 775 | (entomb) |
| 776 | (wpages) |
| 777 | Multiling HTTP(multiling-http) |
| 780 | (wpgs) |
| 800 | (mdbs_daemon) |
| 801 | (device) |
| 810 | FCP(fcp-udp) |
| 828 | itm-mcell-s(itm-mcell-s) |
| 829 | PKIX-3 CA/RA(pkix-3-ca-ra) |
| 830 | NETCONF over SSH(netconf-ssh) |
| 831 | NETCONF over BEEP(netconf-beep) |
| 832 | NETCONF for SOAP over HTTPS(netconfsoaphttp) |
| 833 | NETCONF for SOAP over BEEP(netconfsoapbeep) |
| 847 | dhcp-failover 2(dhcp-failover2) |
| 848 | GDOI(gdoi) |
| 860 | iSCSI(iscsi) |
| 861 | OWAMP-Control(owamp-control) |
| 873 | rsync(rsync) |
| 886 | ICL coNETion locate server(iclcnet-locate) |
| 887 | ICL coNETion server info(iclcnet_svinfo) |
| 888 | AccessBuilder(accessbuilder) |
| 888 | CD Database Protocol(cddbp) |
| 900 | OMG Initial Refs(omginitialrefs) |
| 901 | SMPNAMERES(smpnameres) |
| 902 | IDEAFARM-CHAT(ideafarm-chat) |
| 903 | IDEAFARM-CATCH(ideafarm-catch) |
| 910 | Kerberized Internet Negotiation of Keys (KINK)(kink) |
| 911 | xact-backup(xact-backup) |
| 912 | APEX relay-relay service(apex-mesh) |
| 913 | APEX endpoint-relay service(apex-edge) |
| 989 | ftp protocol, data, over TLS/SSL(ftps-data) |
| 990 | ftp protocol, control, over TLS/SSL(ftps) |
| 991 | Netnews Administration System(nas) |
| 992 | telnet protocol over TLS/SSL(telnets) |
| 993 | imap4 protocol over TLS/SSL(imaps) |
| 994 | irc protocol over TLS/SSL(ircs) |
| 995 | pop3 protocol over TLS/SSL (was spop3)(pop3s) |
| 996 | vsinet(vsinet) |
| 997 | (maitrd) |
| 998 | (busboy) |
| 999 | (garcon) |
| 999 | (puprouter) |
| 1000 | (cadlock2) |
| 1010 | surf(surf) |
| 1021 | RFC3692-style Experiment 1 (*) [RFC4727](exp1) |
| 1022 | RFC3692-style Experiment 2 (*) [RFC4727](exp2) |
| 1023 | Reserved |
| 1024 | Reserved |
| 1025 | network blackjack(blackjack) |
| 1026 | Calendar Access Protocol(cap) |
| 1029 | Solid Mux Server(solid-mux) |
| 1030 | BBN IAD(iad1) |
| 1031 | BBN IAD(iad2) |
| 1032 | BBN IAD(iad3) |
| 1033 | local netinfo port(netinfo-local) |
| 1034 | ActiveSync Notifications(activesync) |
| 1035 | MX-XR RPC(mxxrlogin) |
| 1036 | Nebula Secure Segment Transfer Protocol(nsstp) |
| 1037 | AMS(ams) |
| 1038 | Message Tracking Query Protocol(mtqp) |
| 1039 | Streamlined Blackhole(sbl) |
| 1040 | Netarx(netarx) |
| 1041 | AK2 Product(danf-ak2) |
| 1042 | Subnet Roaming(afrog) |
| 1043 | BOINC Client Control(boinc-client) |
| 1044 | Dev Consortium Utility(dcutility) |
| 1045 | Fingerprint Image Transfer Protocol(fpitp) |
| 1046 | WebFilter Remote Monitor(wfremotertm) |
| 1047 | Sun's NEO Object Request Broker(neod1) |
| 1048 | Sun's NEO Object Request Broker(neod2) |
| 1049 | Tobit David Postman VPMN(td-postman) |
| 1050 | CORBA Management Agent(cma) |
| 1051 | Optima VNET(optima-vnet) |
| 1052 | Dynamic DNS Tools(ddt) |
| 1053 | Remote Assistant (RA)(remote-as) |
| 1054 | BRVREAD(brvread) |
| 1055 | ANSYS - License Manager(ansyslmd) |
| 1056 | VFO(vfo) |
| 1057 | STARTRON(startron) |
| 1058 | nim(nim) |
| 1059 | nimreg(nimreg) |
| 1060 | POLESTAR(polestar) |
| 1061 | KIOSK(kiosk) |
| 1062 | Veracity(veracity) |
| 1063 | KyoceraNetDev(kyoceranetdev) |
| 1064 | JSTEL(jstel) |
| 1065 | SYSCOMLAN(syscomlan) |
| 1066 | FPO-FNS(fpo-fns) |
| 1067 | Installation Bootstrap Proto. Serv.(instl_boots) |
| 1068 | Installation Bootstrap Proto. Cli.(instl_bootc) |
| 1069 | COGNEX-INSIGHT(cognex-insight) |
| 1070 | GMRUpdateSERV(gmrupdateserv) |
| 1071 | BSQUARE-VOIP(bsquare-voip) |
| 1072 | CARDAX(cardax) |
| 1073 | Bridge Control(bridgecontrol) |
| 1074 | Warmspot Management Protocol(warmspotMgmt) |
| 1075 | RDRMSHC(rdrmshc) |
| 1076 | DAB STI-C(dab-sti-c) |
| 1077 | IMGames(imgames) |
| 1078 | Avocent Proxy Protocol(avocent-proxy) |
| 1079 | ASPROVATalk(asprovatalk) |
| 1080 | Socks(socks) |
| 1081 | PVUNIWIEN(pvuniwien) |
| 1082 | AMT-ESD-PROT(amt-esd-prot) |
| 1083 | Anasoft License Manager(ansoft-lm-1) |
| 1084 | Anasoft License Manager(ansoft-lm-2) |
| 1085 | Web Objects(webobjects) |
| 1086 | CPL Scrambler Logging(cplscrambler-lg) |
| 1087 | CPL Scrambler Internal(cplscrambler-in) |
| 1088 | CPL Scrambler Alarm Log(cplscrambler-al) |
| 1089 | FF Annunciation(ff-annunc) |
| 1090 | FF Fieldbus Message Specification(ff-fms) |
| 1091 | FF System Management(ff-sm) |
| 1092 | Open Business Reporting Protocol(obrpd) |
| 1093 | PROOFD(proofd) |
| 1094 | ROOTD(rootd) |
| 1095 | NICELink(nicelink) |
| 1096 | Common Name Resolution Protocol(cnrprotocol) |
| 1097 | Sun Cluster Manager(sunclustermgr) |
| 1098 | RMI Activation(rmiactivation) |
| 1099 | RMI Registry(rmiregistry) |
| 1100 | MCTP(mctp) |
| 1101 | PT2-DISCOVER(pt2-discover) |
| 1102 | ADOBE SERVER 1(adobeserver-1) |
| 1103 | ADOBE SERVER 2(adobeserver-2) |
| 1104 | XRL(xrl) |
| 1105 | FTRANHC(ftranhc) |
| 1106 | ISOIPSIGPORT-1(isoipsigport-1) |
| 1107 | ISOIPSIGPORT-2(isoipsigport-2) |
| 1108 | ratio-adp(ratio-adp) |
| 1110 | Start web admin server(webadmstart) |
| 1111 | LM Social Server(lmsocialserver) |
| 1112 | Intelligent Communication Protocol(icp) |
| 1113 | Licklider Transmission Pr(ltp-deepspace) |
| 1114 | Mini SQL(mini-sql) |
| 1115 | ARDUS Transfer(ardus-trns) |
| 1116 | ARDUS Control(ardus-cntl) |
| 1117 | ARDUS Multicast Transfer(ardus-mtrns) |
| 1118 | SACRED(sacred) |
| 1119 | Battle.net Chat/Game Protocol(bnetgame) |
| 1120 | Battle.net File Transfer Protocol(bnetfile) |
| 1121 | Datalode RMPP(rmpp) |
| 1122 | availant-mgr(availant-mgr) |
| 1123 | Murray(murray) |
| 1124 | HP VMM Control(hpvmmcontrol) |
| 1125 | HP VMM Agent(hpvmmagent) |
| 1126 | HP VMM Agent(hpvmmdata) |
| 1127 | KWDB Remote Communication(kwdb-commn) |
| 1128 | SAPHostControl over SOAP/HTTP(saphostctrl) |
| 1129 | SAPHostControl over SOAP/HTTPS(saphostctrls) |
| 1130 | CAC App Service Protocol(casp) |
| 1131 | CAC App Service Protocol Encripted(caspssl) |
| 1132 | KVM-via-IP Management Service(kvm-via-ip) |
| 1133 | Data Flow Network(dfn) |
| 1134 | MicroAPL APLX(aplx) |
| 1135 | OmniVision Communication Service(omnivision) |
| 1136 | HHB Gateway Control(hhb-gateway) |
| 1137 | TRIM Workgroup Service(trim) |
| 1138 | encrypted admin requests(encrypted_admin) |
| 1140 | AutoNOC Network Operations Protocol(autonoc) |
| 1141 | User Message Service(mxomss) |
| 1142 | User Discovery Service(edtools) |
| 1143 | Infomatryx Exchange(imyx) |
| 1144 | Fusion Script(fuscript) |
| 1145 | X9 iCue Show Control(x9-icue) |
| 1146 | audit transfer(audit-transfer) |
| 1147 | CAPIoverLAN(capioverlan) |
| 1148 | Elfiq Replication Service(elfiq-repl) |
| 1149 | BVT Sonar Service(bvtsonar) |
| 1150 | Blaze File Server(blaze) |
| 1151 | Unizensus Login Server(unizensus) |
| 1152 | Winpopup LAN Messenger(winpoplanmess) |
| 1153 | ANSI C12.22 Port(c1222-acse) |
| 1154 | Community Service(resacommunity) |
| 1155 | Network File Access(nfa) |
| 1156 | iasControl OMS(iascontrol-oms) |
| 1157 | Oracle iASControl(iascontrol) |
| 1158 | dbControl OMS(dbcontrol-oms) |
| 1159 | Oracle OMS(oracle-oms) |
| 1160 | DB Lite Mult-User Server(olsv) |
| 1161 | Health Polling(health-polling) |
| 1162 | Health Trap(health-trap) |
| 1163 | SmartDialer Data Protocol(sddp) |
| 1164 | QSM Proxy Service(qsm-proxy) |
| 1165 | QSM GUI Service(qsm-gui) |
| 1166 | QSM RemoteExec(qsm-remote) |
| 1167 | Cisco IP SLAs Control Protocol(cisco-ipsla) |
| 1167 | /sctp Cisco IP SLAs Control Protocol(cisco-ipsla) |
| 1168 | VChat Conference Service(vchat) |
| 1169 | TRIPWIRE(tripwire) |
| 1170 | AT+C License Manager(atc-lm) |
| 1171 | AT+C FmiApplicationServer(atc-appserver) |
| 1172 | DNA Protocol(dnap) |
| 1173 | D-Cinema Request-Response(d-cinema-rrp) |
| 1174 | FlashNet Remote Admin(fnet-remote-ui) |
| 1175 | Dossier Server(dossier) |
| 1176 | Indigo Home Server(indigo-server) |
| 1177 | DKMessenger Protocol(dkmessenger) |
| 1178 | SGI Storage Manager(sgi-storman) |
| 1179 | Backup To Neighbor(b2n) |
| 1180 | Millicent Client Proxy(mc-client) |
| 1181 | 3Com Net Management(3comnetman) |
| 1182 | AcceleNet Control(accelenet) |
| 1183 | LL Surfup HTTP(llsurfup-http) |
| 1184 | LL Surfup HTTPS(llsurfup-https) |
| 1185 | Catchpole port(catchpole) |
| 1186 | MySQL Cluster Manager(mysql-cluster) |
| 1187 | Alias Service(alias) |
| 1188 | HP Web Admin(hp-webadmin) |
| 1189 | Unet Connection(unet) |
| 1190 | CommLinx GPS / AVL System(commlinx-avl) |
| 1191 | General Parallel File System(gpfs) |
| 1192 | caids sensors channel(caids-sensor) |
| 1193 | Five Across Server(fiveacross) |
| 1194 | OpenVPN(openvpn) |
| 1195 | RSF-1 clustering(rsf-1) |
| 1196 | Network Magic(netmagic) |
| 1197 | Carrius Remote Access(carrius-rshell) |
| 1198 | cajo reference discovery(cajo-discovery) |
| 1199 | DMIDI(dmidi) |
| 1200 | SCOL(scol) |
| 1201 | Nucleus Sand Database Server(nucleus-sand) |
| 1202 | caiccipc(caiccipc) |
| 1203 | License Validation(ssslic-mgr) |
| 1204 | Log Request Listener(ssslog-mgr) |
| 1205 | Accord-MGC(accord-mgc) |
| 1206 | Anthony Data(anthony-data) |
| 1207 | MetaSage(metasage) |
| 1208 | SEAGULL AIS(seagull-ais) |
| 1209 | IPCD3(ipcd3) |
| 1210 | EOSS(eoss) |
| 1211 | Groove DPP(groove-dpp) |
| 1212 | lupa(lupa) |
| 1213 | MPC LIFENET(mpc-lifenet) |
| 1214 | KAZAA(kazaa) |
| 1215 | scanSTAT 1.0(scanstat-1) |
| 1216 | ETEBAC 5(etebac5) |
| 1217 | HPSS NonDCE Gateway(hpss-ndapi) |
| 1218 | AeroFlight-ADs(aeroflight-ads) |
| 1219 | AeroFlight-Ret(aeroflight-ret) |
| 1220 | QT SERVER ADMIN(qt-serveradmin) |
| 1221 | SweetWARE Apps(sweetware-apps) |
| 1222 | SNI R&D network(nerv) |
| 1223 | TGP(tgp) |
| 1224 | VPNz(vpnz) |
| 1225 | SLINKYSEARCH(slinkysearch) |
| 1226 | STGXFWS(stgxfws) |
| 1227 | DNS2Go(dns2go) |
| 1228 | FLORENCE(florence) |
| 1229 | ZENworks Tiered Electronic Distribution(zented) |
| 1230 | Periscope(periscope) |
| 1231 | menandmice-lpm(menandmice-lpm) |
| 1233 | Universal App Server(univ-appserver) |
| 1234 | Infoseek Search Agent(search-agent) |
| 1235 | mosaicsyssvc1(mosaicsyssvc1) |
| 1236 | bvcontrol(bvcontrol) |
| 1237 | tsdos390(tsdos390) |
| 1238 | hacl-qs(hacl-qs) |
| 1239 | NMSD(nmsd) |
| 1240 | Instantia(instantia) |
| 1241 | nessus(nessus) |
| 1242 | NMAS over IP(nmasoverip) |
| 1243 | SerialGateway(serialgateway) |
| 1244 | isbconference1(isbconference1) |
| 1245 | isbconference2(isbconference2) |
| 1246 | payrouter(payrouter) |
| 1247 | VisionPyramid(visionpyramid) |
| 1248 | hermes(hermes) |
| 1249 | Mesa Vista Co(mesavistaco) |
| 1250 | swldy-sias(swldy-sias) |
| 1251 | servergraph(servergraph) |
| 1252 | bspne-pcc(bspne-pcc) |
| 1253 | q55-pcc(q55-pcc) |
| 1254 | de-noc(de-noc) |
| 1255 | de-cache-query(de-cache-query) |
| 1256 | de-server(de-server) |
| 1257 | Shockwave 2(shockwave2) |
| 1258 | Open Network Library(opennl) |
| 1259 | Open Network Library Voice(opennl-voice) |
| 1260 | ibm-ssd(ibm-ssd) |
| 1261 | mpshrsv(mpshrsv) |
| 1262 | QNTS-ORB(qnts-orb) |
| 1263 | dka(dka) |
| 1264 | PRAT(prat) |
| 1265 | DSSIAPI(dssiapi) |
| 1266 | DELLPWRAPPKS(dellpwrappks) |
| 1267 | eTrust Policy Compliance(epc) |
| 1268 | PROPEL-MSGSYS(propel-msgsys) |
| 1269 | WATiLaPP(watilapp) |
| 1270 | Microsoft Operations Manager(opsmgr) |
| 1271 | eXcW(excw) |
| 1272 | CSPMLockMgr(cspmlockmgr) |
| 1273 | EMC-Gateway(emc-gateway) |
| 1274 | t1distproc(t1distproc) |
| 1275 | ivcollector(ivcollector) |
| 1276 | ivmanager(ivmanager) |
| 1277 | mqs(miva-mqs) |
| 1278 | Dell Web Admin 1(dellwebadmin-1) |
| 1279 | Dell Web Admin 2(dellwebadmin-2) |
| 1280 | Pictrography(pictrography) |
| 1281 | healthd(healthd) |
| 1282 | Emperion(emperion) |
| 1283 | ProductInfo(productinfo) |
| 1284 | IEE-QFX(iee-qfx) |
| 1285 | neoiface(neoiface) |
| 1286 | netuitive(netuitive) |
| 1287 | RouteMatch Com(routematch) |
| 1288 | NavBuddy(navbuddy) |
| 1289 | JWalkServer(jwalkserver) |
| 1290 | WinJaServer(winjaserver) |
| 1291 | SEAGULLLMS(seagulllms) |
| 1292 | dsdn(dsdn) |
| 1293 | PKT-KRB-IPSec(pkt-krb-ipsec) |
| 1294 | CMMdriver(cmmdriver) |
| 1295 | End-by-Hop Transmission Protocol(ehtp) |
| 1296 | dproxy(dproxy) |
| 1297 | sdproxy(sdproxy) |
| 1298 | lpcp(lpcp) |
| 1299 | hp-sci(hp-sci) |
| 1300 | H323 Host Call Secure(h323hostcallsc) |
| 1301 | CI3-Software-1(ci3-software-1) |
| 1302 | CI3-Software-2(ci3-software-2) |
| 1303 | sftsrv(sftsrv) |
| 1304 | Boomerang(boomerang) |
| 1305 | pe-mike(pe-mike) |
| 1306 | RE-Conn-Proto(re-conn-proto) |
| 1307 | Pacmand(pacmand) |
| 1308 | Optical Domain Service Interconnect (ODSI)(odsi) |
| 1309 | JTAG server(jtag-server) |
| 1310 | Husky(husky) |
| 1311 | RxMon(rxmon) |
| 1312 | STI Envision(sti-envision) |
| 1313 | BMC_PATROLDB(bmc_patroldb) |
| 1314 | Photoscript Distributed Printing System(pdps) |
| 1315 | E.L.S., Event Listener Service(els) |
| 1316 | Exbit-ESCP(exbit-escp) |
| 1317 | vrts-ipcserver(vrts-ipcserver) |
| 1318 | krb5gatekeeper(krb5gatekeeper) |
| 1319 | Panja-ICSP(panja-icsp) |
| 1320 | Panja-AXBNET(panja-axbnet) |
| 1321 | PIP(pip) |
| 1322 | Novation(novation) |
| 1323 | brcd(brcd) |
| 1324 | delta-mcp(delta-mcp) |
| 1325 | DX-Instrument(dx-instrument) |
| 1326 | WIMSIC(wimsic) |
| 1327 | Ultrex(ultrex) |
| 1328 | EWALL(ewall) |
| 1329 | netdb-export(netdb-export) |
| 1330 | StreetPerfect(streetperfect) |
| 1331 | intersan(intersan) |
| 1332 | PCIA RXP-B(pcia-rxp-b) |
| 1333 | Password Policy(passwrd-policy) |
| 1334 | writesrv(writesrv) |
| 1335 | Digital Notary Protocol(digital-notary) |
| 1336 | Instant Service Chat(ischat) |
| 1337 | menandmice DNS(menandmice-dns) |
| 1338 | WMC-log-svr(wmc-log-svc) |
| 1339 | kjtsiteserver(kjtsiteserver) |
| 1340 | NAAP(naap) |
| 1341 | QuBES(qubes) |
| 1342 | ESBroker(esbroker) |
| 1343 | re101(re101) |
| 1344 | ICAP(icap) |
| 1345 | VPJP(vpjp) |
| 1346 | Alta Analytics License Manager(alta-ana-lm) |
| 1347 | multi media conferencing(bbn-mmc) |
| 1348 | multi media conferencing(bbn-mmx) |
| 1349 | Registration Network Protocol(sbook) |
| 1350 | Registration Network Protocol(editbench) |
| 1351 | Digital Tool Works (MIT)(equationbuilder) |
| 1352 | Lotus Note(lotusnote) |
| 1353 | Relief Consulting(relief) |
| 1354 | Five Across XSIP Network(XSIP-network) |
| 1355 | Intuitive Edge(intuitive-edge) |
| 1356 | CuillaMartin Company(cuillamartin) |
| 1357 | Electronic PegBoard(pegboard) |
| 1358 | CONNLCLI(connlcli) |
| 1359 | FTSRV(ftsrv) |
| 1360 | MIMER(mimer) |
| 1361 | LinX(linx) |
| 1362 | TimeFlies(timeflies) |
| 1363 | Network DataMover Requester(ndm-requester) |
| 1364 | Network DataMover Server(ndm-server) |
| 1365 | Network Software Associates(adapt-sna) |
| 1366 | Novell NetWare Comm Service Platform(netware-csp) |
| 1367 | DCS(dcs) |
| 1368 | ScreenCast(screencast) |
| 1369 | GlobalView to Unix Shell(gv-us) |
| 1370 | Unix Shell to GlobalView(us-gv) |
| 1371 | Fujitsu Config Protocol(fc-cli) |
| 1372 | Fujitsu Config Protocol(fc-ser) |
| 1373 | Chromagrafx(chromagrafx) |
| 1374 | EPI Software Systems(molly) |
| 1375 | Bytex(bytex) |
| 1376 | IBM Person to Person Software(ibm-pps) |
| 1377 | Cichlid License Manager(cichlid) |
| 1378 | Elan License Manager(elan) |
| 1379 | Integrity Solutions(dbreporter) |
| 1380 | Telesis Network License Manager(telesis-licman) |
| 1381 | Apple Network License Manager(apple-licman) |
| 1382 | udt_os(udt_os) |
| 1383 | GW Hannaway Network License Manager(gwha) |
| 1384 | Objective Solutions License Manager(os-licman) |
| 1385 | Atex Publishing License Manager(atex_elmd) |
| 1386 | CheckSum License Manager(checksum) |
| 1387 | Computer Aided Design Software Inc LM(cadsi-lm) |
| 1388 | Objective Solutions DataBase Cache(objective-dbc) |
| 1389 | Document Manager(iclpv-dm) |
| 1390 | Storage Controller(iclpv-sc) |
| 1391 | Storage Access Server(iclpv-sas) |
| 1392 | Print Manager(iclpv-pm) |
| 1393 | Network Log Server(iclpv-nls) |
| 1394 | Network Log Client(iclpv-nlc) |
| 1395 | PC Workstation Manager software(iclpv-wsm) |
| 1396 | DVL Active Mail(dvl-activemail) |
| 1397 | Audio Active Mail(audio-activmail) |
| 1398 | Video Active Mail(video-activmail) |
| 1399 | Cadkey License Manager(cadkey-licman) |
| 1400 | Cadkey Tablet Daemon(cadkey-tablet) |
| 1401 | Goldleaf License Manager(goldleaf-licman) |
| 1402 | Prospero Resource Manager(prm-sm-np) |
| 1403 | Prospero Resource Manager(prm-nm-np) |
| 1404 | Infinite Graphics License Manager(igi-lm) |
| 1405 | IBM Remote Execution Starter(ibm-res) |
| 1406 | NetLabs License Manager(netlabs-lm) |
| 1407 | DBSA License Manager(dbsa-lm) |
| 1408 | Sophia License Manager(sophia-lm) |
| 1409 | Here License Manager(here-lm) |
| 1410 | HiQ License Manager(hiq) |
| 1411 | AudioFile(af) |
| 1412 | InnoSys(innosys) |
| 1413 | Innosys-ACL(innosys-acl) |
| 1414 | IBM MQSeries(ibm-mqseries) |
| 1415 | DBStar(dbstar) |
| 1416 | Novell LU6.2(novell-lu6.2) |
| 1417 | Timbuktu Service 1 Port(timbuktu-srv1) |
| 1418 | Timbuktu Service 2 Port(timbuktu-srv2) |
| 1419 | Timbuktu Service 3 Port(timbuktu-srv3) |
| 1420 | Timbuktu Service 4 Port(timbuktu-srv4) |
| 1421 | Gandalf License Manager(gandalf-lm) |
| 1422 | Autodesk License Manager(autodesk-lm) |
| 1423 | Essbase Arbor Software(essbase) |
| 1424 | Hybrid Encryption Protocol(hybrid) |
| 1425 | Zion Software License Manager(zion-lm) |
| 1426 | Satellite-data Acquisition System 1(sais) |
| 1427 | mloadd monitoring tool(mloadd) |
| 1428 | Informatik License Manager(informatik-lm) |
| 1429 | Hypercom NMS(nms) |
| 1430 | Hypercom TPDU(tpdu) |
| 1431 | Reverse Gossip Transport(rgtp) |
| 1432 | Blueberry Software License Manager(blueberry-lm) |
| 1433 | Microsoft-SQL-Server(ms-sql-s) |
| 1434 | Microsoft-SQL-Monitor(ms-sql-m) |
| 1435 | IBM CICS(ibm-cics) |
| 1436 | Satellite-data Acquisition System 2(saism) |
| 1437 | Tabula(tabula) |
| 1438 | Eicon Security Agent/Server(eicon-server) |
| 1439 | Eicon X25/SNA Gateway(eicon-x25) |
| 1440 | Eicon Service Location Protocol(eicon-slp) |
| 1441 | Cadis License Management(cadis-1) |
| 1442 | Cadis License Management(cadis-2) |
| 1443 | Integrated Engineering Software(ies-lm) |
| 1444 | Marcam License Management(marcam-lm) |
| 1445 | Proxima License Manager(proxima-lm) |
| 1446 | Optical Research Associates License Manager(ora-lm) |
| 1447 | Applied Parallel Research LM(apri-lm) |
| 1448 | OpenConnect License Manager(oc-lm) |
| 1449 | PEport(peport) |
| 1450 | Tandem Distributed Workbench Facility(dwf) |
| 1451 | IBM Information Management(infoman) |
| 1452 | GTE Government Systems License Man(gtegsc-lm) |
| 1453 | Genie License Manager(genie-lm) |
| 1454 | interHDL License Manager(interhdl_elmd) |
| 1455 | ESL License Manager(esl-lm) |
| 1456 | DCA(dca) |
| 1457 | Valisys License Manager(valisys-lm) |
| 1458 | Nichols Research Corp.(nrcabq-lm) |
| 1459 | Proshare Notebook Application(proshare1) |
| 1460 | Proshare Notebook Application(proshare2) |
| 1461 | IBM Wireless LAN(ibm_wrless_lan) |
| 1462 | World License Manager(world-lm) |
| 1463 | Nucleus(nucleus) |
| 1464 | MSL License Manager(msl_lmd) |
| 1465 | Pipes Platform(pipes) |
| 1466 | Ocean Software License Manager(oceansoft-lm) |
| 1467 | CSDMBASE(csdmbase) |
| 1468 | CSDM(csdm) |
| 1469 | Active Analysis Limited License Manager(aal-lm) |
| 1470 | Universal Analytics(uaiact) |
| 1471 | csdmbase(csdmbase) |
| 1472 | csdm(csdm) |
| 1473 | OpenMath(openmath) |
| 1474 | Telefinder(telefinder) |
| 1475 | Taligent License Manager(taligent-lm) |
| 1476 | clvm-cfg(clvm-cfg) |
| 1477 | ms-sna-server(ms-sna-server) |
| 1478 | ms-sna-base(ms-sna-base) |
| 1479 | dberegister(dberegister) |
| 1480 | PacerForum(pacerforum) |
| 1481 | AIRS(airs) |
| 1482 | Miteksys License Manager(miteksys-lm) |
| 1483 | AFS License Manager(afs) |
| 1484 | Confluent License Manager(confluent) |
| 1485 | LANSource(lansource) |
| 1486 | nms_topo_serv(nms_topo_serv) |
| 1487 | LocalInfoSrvr(localinfosrvr) |
| 1488 | DocStor(docstor) |
| 1489 | dmdocbroker(dmdocbroker) |
| 1490 | insitu-conf(insitu-conf) |
| 1491 | anynetgateway(anynetgateway) |
| 1492 | stone-design-1(stone-design-1) |
| 1493 | netmap_lm(netmap_lm) |
| 1494 | ica(ica) |
| 1495 | cvc(cvc) |
| 1496 | liberty-lm(liberty-lm) |
| 1497 | rfx-lm(rfx-lm) |
| 1498 | Sybase SQL Any(sybase-sqlany) |
| 1499 | Federico Heinz Consultora(fhc) |
| 1500 | VLSI License Manager(vlsi-lm) |
| 1501 | Satellite-data Acquisition System 3(saiscm) |
| 1502 | Shiva(shivadiscovery) |
| 1503 | Databeam(imtc-mcs) |
| 1504 | EVB Software Engineering License Manager(evb-elm) |
| 1505 | Funk Software, Inc.(funkproxy) |
| 1506 | Universal Time daemon (utcd)(utcd) |
| 1507 | symplex(symplex) |
| 1508 | diagmond(diagmond) |
| 1509 | Robcad, Ltd. License Manager(robcad-lm) |
| 1510 | Midland Valley Exploration Ltd. Lic. Man.(mvx-lm) |
| 1511 | 3l-l1(3l-l1) |
| 1512 | Microsoft's Windows Internet Name Service(wins) |
| 1513 | Fujitsu Systems Business of America, Inc(fujitsu-dtc) |
| 1514 | Fujitsu Systems Business of America, Inc(fujitsu-dtcns) |
| 1515 | ifor-protocol(ifor-protocol) |
| 1516 | Virtual Places Audio data(vpad) |
| 1517 | Virtual Places Audio control(vpac) |
| 1518 | Virtual Places Video data(vpvd) |
| 1519 | Virtual Places Video control(vpvc) |
| 1520 | atm zip office(atm-zip-office) |
| 1521 | nCube License Manager(ncube-lm) |
| 1522 | Ricardo North America License Manager(ricardo-lm) |
| 1523 | cichild(cichild-lm) |
| 1524 | ingres(ingreslock) |
| 1525 | oracle(orasrv) |
| 1525 | Prospero Directory Service non-priv(prospero-np) |
| 1526 | Prospero Data Access Prot non-priv(pdap-np) |
| 1527 | oracle(tlisrv) |
| 1528 | micautoreg(mciautoreg) |
| 1529 | oracle(coauthor) |
| 1530 | rap-service(rap-service) |
| 1531 | rap-listen(rap-listen) |
| 1532 | miroconnect(miroconnect) |
| 1533 | Virtual Places Software(virtual-places) |
| 1534 | micromuse-lm(micromuse-lm) |
| 1535 | ampr-info(ampr-info) |
| 1536 | ampr-inter(ampr-inter) |
| 1537 | isi-lm(sdsc-lm) |
| 1538 | 3ds-lm(3ds-lm) |
| 1539 | Intellistor License Manager(intellistor-lm) |
| 1540 | rds(rds) |
| 1541 | rds2(rds2) |
| 1542 | gridgen-elmd(gridgen-elmd) |
| 1543 | simba-cs(simba-cs) |
| 1544 | aspeclmd(aspeclmd) |
| 1545 | vistium-share(vistium-share) |
| 1546 | abbaccuray(abbaccuray) |
| 1547 | laplink(laplink) |
| 1548 | Axon License Manager(axon-lm) |
| 1549 | Shiva Hose(shivahose) |
| 1550 | Image Storage license manager 3M Company(3m-image-lm) |
| 1551 | HECMTL-DB(hecmtl-db) |
| 1552 | pciarray(pciarray) |
| 1553 | sna-cs(sna-cs) |
| 1554 | CACI Products Company License Manager(caci-lm) |
| 1555 | livelan(livelan) |
| 1556 | VERITAS Private Branch Exchange(veritas_pbx) |
| 1557 | ArborText License Manager(arbortext-lm) |
| 1558 | xingmpeg(xingmpeg) |
| 1559 | web2host(web2host) |
| 1560 | ASCI-RemoteSHADOW(asci-val) |
| 1561 | facilityview(facilityview) |
| 1562 | pconnectmgr(pconnectmgr) |
| 1563 | Cadabra License Manager(cadabra-lm) |
| 1564 | Pay-Per-View(pay-per-view) |
| 1565 | WinDD(winddlb) |
| 1566 | CORELVIDEO(corelvideo) |
| 1567 | jlicelmd(jlicelmd) |
| 1568 | tsspmap(tsspmap) |
| 1569 | ets(ets) |
| 1570 | orbixd(orbixd) |
| 1571 | Oracle Remote Data Base(rdb-dbs-disp) |
| 1572 | Chipcom License Manager(chip-lm) |
| 1573 | itscomm-ns(itscomm-ns) |
| 1574 | mvel-lm(mvel-lm) |
| 1575 | oraclenames(oraclenames) |
| 1576 | Moldflow License Manager(moldflow-lm) |
| 1577 | hypercube-lm(hypercube-lm) |
| 1578 | Jacobus License Manager(jacobus-lm) |
| 1579 | ioc-sea-lm(ioc-sea-lm) |
| 1580 | tn-tl-r1(tn-tl-r1) |
| 1581 | MIL-2045-47001(mil-2045-47001) |
| 1582 | MSIMS(msims) |
| 1583 | simbaexpress(simbaexpress) |
| 1584 | tn-tl-fd2(tn-tl-fd2) |
| 1585 | intv(intv) |
| 1586 | ibm-abtact(ibm-abtact) |
| 1587 | pra_elmd(pra_elmd) |
| 1588 | triquest-lm(triquest-lm) |
| 1589 | VQP(vqp) |
| 1590 | gemini-lm(gemini-lm) |
| 1591 | ncpm-pm(ncpm-pm) |
| 1592 | commonspace(commonspace) |
| 1593 | mainsoft-lm(mainsoft-lm) |
| 1594 | sixtrak(sixtrak) |
| 1595 | radio(radio) |
| 1596 | radio-sm(radio-sm) |
| 1597 | orbplus-iiop(orbplus-iiop) |
| 1598 | picknfs(picknfs) |
| 1599 | simbaservices(simbaservices) |
| 1600 | issd(issd) |
| 1601 | aas(aas) |
| 1602 | inspect(inspect) |
| 1603 | pickodbc(picodbc) |
| 1604 | icabrowser(icabrowser) |
| 1605 | Salutation Manager (Salutation Protocol)(slp) |
| 1606 | Salutation Manager (SLM-API)(slm-api) |
| 1607 | stt(stt) |
| 1608 | Smart Corp. License Manager(smart-lm) |
| 1609 | isysg-lm(isysg-lm) |
| 1610 | taurus-wh(taurus-wh) |
| 1611 | Inter Library Loan(ill) |
| 1612 | NetBill Transaction Server(netbill-trans) |
| 1613 | NetBill Key Repository(netbill-keyrep) |
| 1614 | NetBill Credential Server(netbill-cred) |
| 1615 | NetBill Authorization Server(netbill-auth) |
| 1616 | NetBill Product Server(netbill-prod) |
| 1617 | Nimrod Inter-Agent Communication(nimrod-agent) |
| 1618 | skytelnet(skytelnet) |
| 1619 | xs-openstorage(xs-openstorage) |
| 1620 | faxportwinport(faxportwinport) |
| 1621 | softdataphone(softdataphone) |
| 1622 | ontime(ontime) |
| 1623 | jaleosnd(jaleosnd) |
| 1624 | udp-sr-port(udp-sr-port) |
| 1625 | svs-omagent(svs-omagent) |
| 1626 | Shockwave(shockwave) |
| 1627 | T.128 Gateway(t128-gateway) |
| 1628 | LonTalk normal(lontalk-norm) |
| 1629 | LonTalk urgent(lontalk-urgnt) |
| 1630 | Oracle Net8 Cman(oraclenet8cman) |
| 1631 | Visit view(visitview) |
| 1632 | PAMMRATC(pammratc) |
| 1633 | PAMMRPC(pammrpc) |
| 1634 | Log On America Probe(loaprobe) |
| 1635 | EDB Server 1(edb-server1) |
| 1636 | ISP shared public data control(isdc) |
| 1637 | ISP shared local data control(islc) |
| 1638 | ISP shared management control(ismc) |
| 1639 | cert-initiator(cert-initiator) |
| 1640 | cert-responder(cert-responder) |
| 1641 | InVision(invision) |
| 1642 | isis-am(isis-am) |
| 1643 | isis-ambc(isis-ambc) |
| 1644 | Satellite-data Acquisition System 4(saiseh) |
| 1645 | SightLine(sightline) |
| 1646 | sa-msg-port(sa-msg-port) |
| 1647 | rsap(rsap) |
| 1648 | concurrent-lm(concurrent-lm) |
| 1649 | kermit(kermit) |
| 1650 | nkdn(nkd) |
| 1651 | shiva_confsrvr(shiva_confsrvr) |
| 1652 | xnmp(xnmp) |
| 1653 | alphatech-lm(alphatech-lm) |
| 1654 | stargatealerts(stargatealerts) |
| 1655 | dec-mbadmin(dec-mbadmin) |
| 1656 | dec-mbadmin-h(dec-mbadmin-h) |
| 1657 | fujitsu-mmpdc(fujitsu-mmpdc) |
| 1658 | sixnetudr(sixnetudr) |
| 1659 | Silicon Grail License Manager(sg-lm) |
| 1660 | skip-mc-gikreq(skip-mc-gikreq) |
| 1661 | netview-aix-1(netview-aix-1) |
| 1662 | netview-aix-2(netview-aix-2) |
| 1663 | netview-aix-3(netview-aix-3) |
| 1664 | netview-aix-4(netview-aix-4) |
| 1665 | netview-aix-5(netview-aix-5) |
| 1666 | netview-aix-6(netview-aix-6) |
| 1667 | netview-aix-7(netview-aix-7) |
| 1668 | netview-aix-8(netview-aix-8) |
| 1669 | netview-aix-9(netview-aix-9) |
| 1670 | netview-aix-10(netview-aix-10) |
| 1671 | netview-aix-11(netview-aix-11) |
| 1672 | netview-aix-12(netview-aix-12) |
| 1673 | Intel Proshare Multicast(proshare-mc-1) |
| 1674 | Intel Proshare Multicast(proshare-mc-2) |
| 1675 | Pacific Data Products(pdp) |
| 1676 | netcomm1(netcomm1) |
| 1677 | groupwise(groupwise) |
| 1678 | prolink(prolink) |
| 1679 | darcorp-lm(darcorp-lm) |
| 1680 | microcom-sbp(microcom-sbp) |
| 1681 | sd-elmd(sd-elmd) |
| 1682 | lanyon-lantern(lanyon-lantern) |
| 1683 | ncpm-hip(ncpm-hip) |
| 1684 | SnareSecure(snaresecure) |
| 1685 | n2nremote(n2nremote) |
| 1686 | cvmon(cvmon) |
| 1687 | nsjtp-ctrl(nsjtp-ctrl) |
| 1688 | nsjtp-data(nsjtp-data) |
| 1689 | firefox(firefox) |
| 1690 | ng-umds(ng-umds) |
| 1691 | empire-empuma(empire-empuma) |
| 1692 | sstsys-lm(sstsys-lm) |
| 1693 | rrirtr(rrirtr) |
| 1694 | rrimwm(rrimwm) |
| 1695 | rrilwm(rrilwm) |
| 1696 | rrifmm(rrifmm) |
| 1697 | rrisat(rrisat) |
| 1698 | RSVP-ENCAPSULATION-1(rsvp-encap-1) |
| 1699 | RSVP-ENCAPSULATION-2(rsvp-encap-2) |
| 1700 | mps-raft(mps-raft) |
| 1701 | l2f(l2f) |
| 1701 | l2tp(l2tp) |
| 1702 | deskshare(deskshare) |
| 1703 | hb-engine(hb-engine) |
| 1704 | bcs-broker(bcs-broker) |
| 1705 | slingshot(slingshot) |
| 1706 | jetform(jetform) |
| 1707 | vdmplay(vdmplay) |
| 1708 | gat-lmd(gat-lmd) |
| 1709 | centra(centra) |
| 1710 | impera(impera) |
| 1711 | pptconference(pptconference) |
| 1712 | resource monitoring service(registrar) |
| 1713 | ConferenceTalk(conferencetalk) |
| 1714 | sesi-lm(sesi-lm) |
| 1715 | houdini-lm(houdini-lm) |
| 1716 | xmsg(xmsg) |
| 1717 | fj-hdnet(fj-hdnet) |
| 1718 | h323gatedisc(h323gatedisc) |
| 1719 | h323gatestat(h323gatestat) |
| 1720 | h323hostcall(h323hostcall) |
| 1721 | caicci(caicci) |
| 1722 | HKS License Manager(hks-lm) |
| 1723 | pptp(pptp) |
| 1724 | csbphonemaster(csbphonemaster) |
| 1725 | iden-ralp(iden-ralp) |
| 1726 | IBERIAGAMES(iberiagames) |
| 1727 | winddx(winddx) |
| 1728 | TELINDUS(telindus) |
| 1729 | CityNL License Management(citynl) |
| 1730 | roketz(roketz) |
| 1731 | MSICCP(msiccp) |
| 1732 | proxim(proxim) |
| 1733 | SIMS - SIIPAT Protocol for Alarm Transmission(siipat) |
| 1734 | Camber Corporation License Management(cambertx-lm) |
| 1735 | PrivateChat(privatechat) |
| 1736 | street-stream(street-stream) |
| 1737 | ultimad(ultimad) |
| 1738 | GameGen1(gamegen1) |
| 1739 | webaccess(webaccess) |
| 1740 | encore(encore) |
| 1741 | cisco-net-mgmt(cisco-net-mgmt) |
| 1742 | 3Com-nsd(3Com-nsd) |
| 1743 | Cinema Graphics License Manager(cinegrfx-lm) |
| 1744 | ncpm-ft(ncpm-ft) |
| 1745 | remote-winsock(remote-winsock) |
| 1746 | ftrapid-1(ftrapid-1) |
| 1747 | ftrapid-2(ftrapid-2) |
| 1748 | oracle-em1(oracle-em1) |
| 1749 | aspen-services(aspen-services) |
| 1750 | Simple Socket Library's PortMaster(sslp) |
| 1751 | SwiftNet(swiftnet) |
| 1752 | Leap of Faith Research License Manager(lofr-lm) |
| 1754 | oracle-em2(oracle-em2) |
| 1755 | ms-streaming(ms-streaming) |
| 1756 | capfast-lmd(capfast-lmd) |
| 1757 | cnhrp(cnhrp) |
| 1758 | tftp-mcast(tftp-mcast) |
| 1759 | SPSS License Manager(spss-lm) |
| 1760 | www-ldap-gw(www-ldap-gw) |
| 1761 | cft-0(cft-0) |
| 1762 | cft-1(cft-1) |
| 1763 | cft-2(cft-2) |
| 1764 | cft-3(cft-3) |
| 1765 | cft-4(cft-4) |
| 1766 | cft-5(cft-5) |
| 1767 | cft-6(cft-6) |
| 1768 | cft-7(cft-7) |
| 1769 | bmc-net-adm(bmc-net-adm) |
| 1770 | bmc-net-svc(bmc-net-svc) |
| 1771 | vaultbase(vaultbase) |
| 1772 | EssWeb Gateway(essweb-gw) |
| 1773 | KMSControl(kmscontrol) |
| 1774 | global-dtserv(global-dtserv) |
| 1776 | Federal Emergency Management Information System(femis) |
| 1777 | powerguardian(powerguardian) |
| 1778 | prodigy-internet(prodigy-intrnet) |
| 1779 | pharmasoft(pharmasoft) |
| 1780 | dpkeyserv(dpkeyserv) |
| 1781 | answersoft-lm(answersoft-lm) |
| 1782 | hp-hcip(hp-hcip) |
| 1784 | Finle License Manager(finle-lm) |
| 1785 | Wind River Systems License Manager(windlm) |
| 1786 | funk-logger(funk-logger) |
| 1787 | funk-license(funk-license) |
| 1788 | psmond(psmond) |
| 1789 | hello(hello) |
| 1790 | Narrative Media Streaming Protocol(nmsp) |
| 1791 | EA1(ea1) |
| 1792 | ibm-dt-2(ibm-dt-2) |
| 1793 | rsc-robot(rsc-robot) |
| 1794 | cera-bcm(cera-bcm) |
| 1795 | dpi-proxy(dpi-proxy) |
| 1796 | Vocaltec Server Administration(vocaltec-admin) |
| 1797 | UMA(uma) |
| 1798 | Event Transfer Protocol(etp) |
| 1799 | NETRISK(netrisk) |
| 1800 | ANSYS-License manager(ansys-lm) |
| 1801 | Microsoft Message Que(msmq) |
| 1802 | ConComp1(concomp1) |
| 1803 | HP-HCIP-GWY(hp-hcip-gwy) |
| 1804 | ENL(enl) |
| 1805 | ENL-Name(enl-name) |
| 1806 | Musiconline(musiconline) |
| 1807 | Fujitsu Hot Standby Protocol(fhsp) |
| 1808 | Oracle-VP2(oracle-vp2) |
| 1809 | Oracle-VP1(oracle-vp1) |
| 1810 | Jerand License Manager(jerand-lm) |
| 1811 | Scientia-SDB(scientia-sdb) |
| 1812 | RADIUS(radius) |
| 1813 | RADIUS Accounting(radius-acct) |
| 1814 | TDP Suite(tdp-suite) |
| 1815 | MMPFT(mmpft) |
| 1816 | HARP(harp) |
| 1817 | RKB-OSCS(rkb-oscs) |
| 1818 | Enhanced Trivial File Transfer Protocol(etftp) |
| 1819 | Plato License Manager(plato-lm) |
| 1820 | mcagent(mcagent) |
| 1821 | donnyworld(donnyworld) |
| 1822 | es-elmd(es-elmd) |
| 1823 | Unisys Natural Language License Manager(unisys-lm) |
| 1824 | metrics-pas(metrics-pas) |
| 1825 | DirecPC Video(direcpc-video) |
| 1826 | ARDT(ardt) |
| 1827 | ASI(asi) |
| 1828 | itm-mcell-u(itm-mcell-u) |
| 1829 | Optika eMedia(optika-emedia) |
| 1830 | Oracle Net8 CMan Admin(net8-cman) |
| 1831 | Myrtle(myrtle) |
| 1832 | ThoughtTreasure(tht-treasure) |
| 1833 | udpradio(udpradio) |
| 1834 | ARDUS Unicast(ardusuni) |
| 1835 | ARDUS Multicast(ardusmul) |
| 1836 | ste-smsc(ste-smsc) |
| 1837 | csoft1(csoft1) |
| 1838 | TALNET(talnet) |
| 1839 | netopia-vo1(netopia-vo1) |
| 1840 | netopia-vo2(netopia-vo2) |
| 1841 | netopia-vo3(netopia-vo3) |
| 1842 | netopia-vo4(netopia-vo4) |
| 1843 | netopia-vo5(netopia-vo5) |
| 1844 | DirecPC-DLL(direcpc-dll) |
| 1845 | altalink(altalink) |
| 1846 | Tunstall PNC(tunstall-pnc) |
| 1847 | SLP Notification(slp-notify) |
| 1848 | fjdocdist(fjdocdist) |
| 1849 | ALPHA-SMS(alpha-sms) |
| 1850 | GSI(gsi) |
| 1851 | ctcd(ctcd) |
| 1852 | Virtual Time(virtual-time) |
| 1853 | VIDS-AVTP(vids-avtp) |
| 1854 | Buddy Draw(buddy-draw) |
| 1855 | Fiorano RtrSvc(fiorano-rtrsvc) |
| 1856 | Fiorano MsgSvc(fiorano-msgsvc) |
| 1857 | DataCaptor(datacaptor) |
| 1858 | PrivateArk(privateark) |
| 1859 | Gamma Fetcher Server(gammafetchsvr) |
| 1860 | SunSCALAR Services(sunscalar-svc) |
| 1861 | LeCroy VICP(lecroy-vicp) |
| 1862 | techra-server(techra-server) |
| 1863 | MSNP(msnp) |
| 1864 | Paradym 31 Port(paradym-31port) |
| 1865 | ENTP(entp) |
| 1866 | swrmi(swrmi) |
| 1867 | UDRIVE(udrive) |
| 1868 | VizibleBrowser(viziblebrowser) |
| 1869 | TransAct(transact) |
| 1870 | SunSCALAR DNS Service(sunscalar-dns) |
| 1871 | Cano Central 0(canocentral0) |
| 1872 | Cano Central 1(canocentral1) |
| 1873 | Fjmpjps(fjmpjps) |
| 1874 | Fjswapsnp(fjswapsnp) |
| 1875 | westell stats(westell-stats) |
| 1876 | ewcappsrv(ewcappsrv) |
| 1877 | hp-webqosdb(hp-webqosdb) |
| 1878 | drmsmc(drmsmc) |
| 1879 | NettGain NMS(nettgain-nms) |
| 1880 | Gilat VSAT Control(vsat-control) |
| 1881 | IBM WebSphere MQ Everyplace(ibm-mqseries2) |
| 1882 | CA eTrust Common Services(ecsqdmn) |
| 1883 | IBM MQSeries SCADA(ibm-mqisdp) |
| 1884 | Internet Distance Map Svc(idmaps) |
| 1885 | Veritas Trap Server(vrtstrapserver) |
| 1886 | Leonardo over IP(leoip) |
| 1887 | FileX Listening Port(filex-lport) |
| 1888 | NC Config Port(ncconfig) |
| 1889 | Unify Web Adapter Service(unify-adapter) |
| 1890 | wilkenListener(wilkenlistener) |
| 1891 | ChildKey Notification(childkey-notif) |
| 1892 | ChildKey Control(childkey-ctrl) |
| 1893 | ELAD Protocol(elad) |
| 1894 | O2Server Port(o2server-port) |
| 1896 | b-novative license server(b-novative-ls) |
| 1897 | MetaAgent(metaagent) |
| 1898 | Cymtec secure management(cymtec-port) |
| 1899 | MC2Studios(mc2studios) |
| 1900 | SSDP(ssdp) |
| 1901 | Fujitsu ICL Terminal Emulator Program A(fjicl-tep-a) |
| 1902 | Fujitsu ICL Terminal Emulator Program B(fjicl-tep-b) |
| 1903 | Local Link Name Resolution(linkname) |
| 1904 | Fujitsu ICL Terminal Emulator Program C(fjicl-tep-c) |
| 1905 | Secure UP.Link Gateway Protocol(sugp) |
| 1906 | TPortMapperReq(tpmd) |
| 1907 | IntraSTAR(intrastar) |
| 1908 | Dawn(dawn) |
| 1909 | Global World Link(global-wlink) |
| 1910 | UltraBac Software communications port(ultrabac) |
| 1911 | Starlight Networks Multimedia Transport Protocol(mtp) |
| 1912 | rhp-iibp(rhp-iibp) |
| 1913 | armadp(armadp) |
| 1914 | Elm-Momentum(elm-momentum) |
| 1915 | FACELINK(facelink) |
| 1916 | Persoft Persona(persona) |
| 1917 | nOAgent(noagent) |
| 1918 | IBM Tivole Directory Service - NDS(can-nds) |
| 1919 | IBM Tivoli Directory Service - DCH(can-dch) |
| 1920 | IBM Tivoli Directory Service - FERRET(can-ferret) |
| 1921 | NoAdmin(noadmin) |
| 1922 | Tapestry(tapestry) |
| 1923 | SPICE(spice) |
| 1924 | XIIP(xiip) |
| 1925 | Surrogate Discovery Port(discovery-port) |
| 1926 | Evolution Game Server(egs) |
| 1927 | Videte CIPC Port(videte-cipc) |
| 1928 | Expnd Maui Srvr Dscovr(emsd-port) |
| 1929 | Bandwiz System - Server(bandwiz-system) |
| 1930 | Drive AppServer(driveappserver) |
| 1931 | AMD SCHED(amdsched) |
| 1932 | CTT Broker(ctt-broker) |
| 1933 | IBM LM MT Agent(xmapi) |
| 1934 | IBM LM Appl Agent(xaapi) |
| 1935 | Macromedia Flash Communications Server MX(macromedia-fcs) |
| 1936 | JetCmeServer Server Port(jetcmeserver) |
| 1937 | JetVWay Server Port(jwserver) |
| 1938 | JetVWay Client Port(jwclient) |
| 1939 | JetVision Server Port(jvserver) |
| 1940 | JetVision Client Port(jvclient) |
| 1941 | DIC-Aida(dic-aida) |
| 1942 | Real Enterprise Service(res) |
| 1943 | Beeyond Media(beeyond-media) |
| 1944 | close-combat(close-combat) |
| 1945 | dialogic-elmd(dialogic-elmd) |
| 1946 | tekpls(tekpls) |
| 1947 | hlserver(hlserver) |
| 1948 | eye2eye(eye2eye) |
| 1949 | ISMA Easdaq Live(ismaeasdaqlive) |
| 1950 | ISMA Easdaq Test(ismaeasdaqtest) |
| 1951 | bcs-lmserver(bcs-lmserver) |
| 1952 | mpnjsc(mpnjsc) |
| 1953 | Rapid Base(rapidbase) |
| 1954 | ABR-API (diskbridge)(abr-api) |
| 1955 | ABR-Secure Data (diskbridge)(abr-secure) |
| 1956 | Vertel VMF DS(vrtl-vmf-ds) |
| 1957 | unix-status(unix-status) |
| 1958 | CA Administration Daemon(dxadmind) |
| 1959 | SIMP Channel(simp-all) |
| 1960 | Merit DAC NASmanager(nasmanager) |
| 1961 | BTS APPSERVER(bts-appserver) |
| 1962 | BIAP-MP(biap-mp) |
| 1963 | WebMachine(webmachine) |
| 1964 | SOLID E ENGINE(solid-e-engine) |
| 1965 | Tivoli NPM(tivoli-npm) |
| 1966 | Slush(slush) |
| 1967 | SNS Quote(sns-quote) |
| 1968 | LIPSinc(lipsinc) |
| 1969 | LIPSinc 1(lipsinc1) |
| 1970 | NetOp Remote Control(netop-rc) |
| 1971 | NetOp School(netop-school) |
| 1972 | Cache(intersys-cache) |
| 1973 | Data Link Switching Remote Access Protocol(dlsrap) |
| 1974 | DRP(drp) |
| 1975 | TCO Flash Agent(tcoflashagent) |
| 1976 | TCO Reg Agent(tcoregagent) |
| 1977 | TCO Address Book(tcoaddressbook) |
| 1978 | UniSQL(unisql) |
| 1979 | UniSQL Java(unisql-java) |
| 1980 | PearlDoc XACT(pearldoc-xact) |
| 1981 | p2pQ(p2pq) |
| 1982 | Evidentiary Timestamp(estamp) |
| 1983 | Loophole Test Protocol(lhtp) |
| 1984 | BB(bb) |
| 1985 | Hot Standby Router Protocol(hsrp) |
| 1986 | cisco license management(licensedaemon) |
| 1987 | cisco RSRB Priority 1 port(tr-rsrb-p1) |
| 1988 | cisco RSRB Priority 2 port(tr-rsrb-p2) |
| 1989 | cisco RSRB Priority 3 port(tr-rsrb-p3) |
| 1989 | MHSnet system(mshnet) |
| 1990 | cisco STUN Priority 1 port(stun-p1) |
| 1991 | cisco STUN Priority 2 port(stun-p2) |
| 1992 | cisco STUN Priority 3 port(stun-p3) |
| 1992 | IPsendmsg(ipsendmsg) |
| 1993 | cisco SNMP TCP port(snmp-tcp-port) |
| 1994 | cisco serial tunnel port(stun-port) |
| 1995 | cisco perf port(perf-port) |
| 1996 | cisco Remote SRB port(tr-rsrb-port) |
| 1997 | cisco Gateway Discovery Protocol(gdp-port) |
| 1998 | cisco X.25 service (XOT)(x25-svc-port) |
| 1999 | cisco identification port(tcp-id-port) |
| 2000 | Cisco SCCP(cisco-sccp) |
| 2001 | (dc) |
| 2002 | (globe) |
| 2004 | (mailbox) |
| 2005 | (berknet) |
| 2006 | (invokator) |
| 2007 | (dectalk) |
| 2008 | (conf) |
| 2009 | (news) |
| 2010 | (search) |
| 2011 | raid(raid-cc) |
| 2012 | (ttyinfo) |
| 2013 | (raid-am) |
| 2014 | (troff) |
| 2015 | (cypress) |
| 2016 | (bootserver) |
| 2017 | (cypress-stat) |
| 2018 | (terminaldb) |
| 2019 | (whosockami) |
| 2020 | (xinupageserver) |
| 2021 | (servexec) |
| 2022 | (down) |
| 2023 | (xinuexpansion3) |
| 2024 | (xinuexpansion4) |
| 2025 | (ellpack) |
| 2026 | (scrabble) |
| 2027 | (shadowserver) |
| 2028 | (submitserver) |
| 2029 | Hot Standby Router Protocol IPv6(hsrpv6) |
| 2030 | (device2) |
| 2031 | mobrien-chat(mobrien-chat) |
| 2032 | (blackboard) |
| 2033 | (glogger) |
| 2034 | (scoremgr) |
| 2035 | (imsldoc) |
| 2036 | Ethernet WS DP network(e-dpnet) |
| 2037 | P2plus Application Server(p2plus) |
| 2038 | (objectmanager) |
| 2039 | Prizma Monitoring Service(prizma) |
| 2040 | (lam) |
| 2041 | (interbase) |
| 2042 | isis(isis) |
| 2043 | isis-bcast(isis-bcast) |
| 2044 | (rimsl) |
| 2045 | (cdfunc) |
| 2046 | (sdfunc) |
| 2047 | (dls) |
| 2048 | (dls-monitor) |
| 2049 | (shilp) |
| 2049 | Network File System - Sun Microsystems(nfs) |
| 2050 | Avaya EMB Config Port(av-emb-config) |
| 2051 | EPNSDP(epnsdp) |
| 2052 | clearVisn Services Port(clearvisn) |
| 2053 | Lot105 DSuper Updates(lot105-ds-upd) |
| 2054 | Weblogin Port(weblogin) |
| 2055 | Iliad-Odyssey Protocol(iop) |
| 2056 | OmniSky Port(omnisky) |
| 2057 | Rich Content Protocol(rich-cp) |
| 2058 | NewWaveSearchables RMI(newwavesearch) |
| 2059 | BMC Messaging Service(bmc-messaging) |
| 2060 | Telenium Daemon IF(teleniumdaemon) |
| 2061 | NetMount(netmount) |
| 2062 | ICG SWP Port(icg-swp) |
| 2063 | ICG Bridge Port(icg-bridge) |
| 2064 | ICG IP Relay Port(icg-iprelay) |
| 2065 | Data Link Switch Read Port Number(dlsrpn) |
| 2066 | AVM USB Remote Architecture(aura) |
| 2067 | Data Link Switch Write Port Number(dlswpn) |
| 2068 | Avocent AuthSrv Protocol(avauthsrvprtcl) |
| 2069 | HTTP Event Port(event-port) |
| 2070 | AH and ESP Encapsulated in UDP packet(ah-esp-encap) |
| 2071 | Axon Control Protocol(acp-port) |
| 2072 | GlobeCast mSync(msync) |
| 2073 | DataReel Database Socket(gxs-data-port) |
| 2074 | Vertel VMF SA(vrtl-vmf-sa) |
| 2075 | Newlix ServerWare Engine(newlixengine) |
| 2076 | Newlix JSPConfig(newlixconfig) |
| 2077 | Old Tivoli Storage Manager(tsrmagt) |
| 2078 | IBM Total Productivity Center Server(tpcsrvr) |
| 2079 | IDWARE Router Port(idware-router) |
| 2080 | Autodesk NLM (FLEXlm)(autodesk-nlm) |
| 2081 | KME PRINTER TRAP PORT(kme-trap-port) |
| 2082 | Infowave Mobility Server(infowave) |
| 2083 | Secure Radius Service(radsec) |
| 2084 | SunCluster Geographic(sunclustergeo) |
| 2085 | ADA Control(ada-cip) |
| 2086 | GNUnet(gnunet) |
| 2087 | ELI - Event Logging Integration(eli) |
| 2088 | IP Busy Lamp Field(ip-blf) |
| 2089 | Security Encapsulation Protocol - SEP(sep) |
| 2090 | Load Report Protocol(lrp) |
| 2091 | PRP(prp) |
| 2092 | Descent 3(descent3) |
| 2093 | NBX CC(nbx-cc) |
| 2094 | NBX AU(nbx-au) |
| 2095 | NBX SER(nbx-ser) |
| 2096 | NBX DIR(nbx-dir) |
| 2097 | Jet Form Preview(jetformpreview) |
| 2098 | Dialog Port(dialog-port) |
| 2099 | H.225.0 Annex G(h2250-annex-g) |
| 2100 | Amiga Network Filesystem(amiganetfs) |
| 2101 | rtcm-sc104(rtcm-sc104) |
| 2102 | Zephyr server(zephyr-srv) |
| 2103 | Zephyr serv-hm connection(zephyr-clt) |
| 2104 | Zephyr hostmanager(zephyr-hm) |
| 2105 | MiniPay(minipay) |
| 2106 | MZAP(mzap) |
| 2107 | BinTec Admin(bintec-admin) |
| 2108 | Comcam(comcam) |
| 2109 | Ergolight(ergolight) |
| 2110 | UMSP(umsp) |
| 2111 | DSATP(dsatp) |
| 2112 | Idonix MetaNet(idonix-metanet) |
| 2113 | HSL StoRM(hsl-storm) |
| 2114 | NEWHEIGHTS(newheights) |
| 2115 | Key Distribution Manager(kdm) |
| 2116 | CCOWCMR(ccowcmr) |
| 2117 | MENTACLIENT(mentaclient) |
| 2118 | MENTASERVER(mentaserver) |
| 2119 | GSIGATEKEEPER(gsigatekeeper) |
| 2120 | Quick Eagle Networks CP(qencp) |
| 2121 | SCIENTIA-SSDB(scientia-ssdb) |
| 2122 | CauPC Remote Control(caupc-remote) |
| 2123 | GTP-Control Plane (3GPP)(gtp-control) |
| 2124 | ELATELINK(elatelink) |
| 2125 | LOCKSTEP(lockstep) |
| 2126 | PktCable-COPS(pktcable-cops) |
| 2127 | INDEX-PC-WB(index-pc-wb) |
| 2128 | Net Steward Control(net-steward) |
| 2129 | cs-live.com(cs-live) |
| 2130 | XDS(xds) |
| 2131 | Avantageb2b(avantageb2b) |
| 2132 | SoleraTec End Point Map(solera-epmap) |
| 2133 | ZYMED-ZPP(zymed-zpp) |
| 2134 | AVENUE(avenue) |
| 2135 | Grid Resource Information Server(gris) |
| 2136 | APPWORXSRV(appworxsrv) |
| 2137 | CONNECT(connect) |
| 2138 | UNBIND-CLUSTER(unbind-cluster) |
| 2139 | IAS-AUTH(ias-auth) |
| 2140 | IAS-REG(ias-reg) |
| 2141 | IAS-ADMIND(ias-admind) |
| 2142 | TDM OVER IP(tdmoip) |
| 2143 | Live Vault Job Control(lv-jc) |
| 2144 | Live Vault Fast Object Transfer(lv-ffx) |
| 2145 | Live Vault Remote Diagnostic Console Support(lv-pici) |
| 2146 | Live Vault Admin Event Notification(lv-not) |
| 2147 | Live Vault Authentication(lv-auth) |
| 2148 | VERITAS UNIVERSAL COMMUNICATION LAYER(veritas-ucl) |
| 2149 | ACPTSYS(acptsys) |
| 2150 | DYNAMIC3D(dynamic3d) |
| 2151 | DOCENT(docent) |
| 2152 | GTP-User Plane (3GPP)(gtp-user) |
| 2159 | GDB Remote Debug Port(gdbremote) |
| 2160 | APC 2160(apc-2160) |
| 2161 | APC 2161(apc-2161) |
| 2162 | Navisphere(navisphere) |
| 2163 | Navisphere Secure(navisphere-sec) |
| 2164 | Dynamic DNS Version 3(ddns-v3) |
| 2165 | X-Bone API(x-bone-api) |
| 2166 | iwserver(iwserver) |
| 2167 | Raw Async Serial Link(raw-serial) |
| 2168 | easy-soft Multiplexer(easy-soft-mux) |
| 2169 | Backbone for Academic Information Notification (BRAIN)(brain) |
| 2170 | EyeTV Server Port(eyetv) |
| 2171 | MS Firewall Storage(msfw-storage) |
| 2172 | MS Firewall SecureStorage(msfw-s-storage) |
| 2173 | MS Firewall Replication(msfw-replica) |
| 2174 | MS Firewall Intra Array(msfw-array) |
| 2175 | Microsoft Desktop AirSync Protocol(airsync) |
| 2176 | Microsoft ActiveSync Remote API(rapi) |
| 2177 | qWAVE Bandwidth Estimate(qwave) |
| 2178 | Peer Services for BITS(bitspeer) |
| 2180 | Millicent Vendor Gateway Server(mc-gt-srv) |
| 2181 | eforward(eforward) |
| 2182 | CGN status(cgn-stat) |
| 2183 | Code Green configuration(cgn-config) |
| 2184 | NVD User(nvd) |
| 2185 | OnBase Distributed Disk Services(onbase-dds) |
| 2190 | TiVoConnect Beacon(tivoconnect) |
| 2191 | TvBus Messaging(tvbus) |
| 2192 | ASDIS software management(asdis) |
| 2197 | MNP data exchange(mnp-exchange) |
| 2198 | OneHome Remote Access(onehome-remote) |
| 2199 | OneHome Service Port(onehome-help) |
| 2200 | ICI(ici) |
| 2201 | Advanced Training System Program(ats) |
| 2202 | Int. Multimedia Teleconferencing Cosortium(imtc-map) |
| 2203 | b2 Runtime Protocol(b2-runtime) |
| 2204 | b2 License Server(b2-license) |
| 2205 | Java Presentation Server(jps) |
| 2206 | HP OpenCall bus(hpocbus) |
| 2207 | HP Status and Services(hpssd) |
| 2208 | HP I/O Backend(hpiod) |
| 2213 | Kali(kali) |
| 2214 | RDQ Protocol Interface(rpi) |
| 2215 | IPCore.co.za GPRS(ipcore) |
| 2216 | VTU data service(vtu-comms) |
| 2217 | GoToDevice Device Management(gotodevice) |
| 2218 | Bounzza IRC Proxy(bounzza) |
| 2219 | NetIQ NCAP Protocol(netiq-ncap) |
| 2220 | NetIQ End2End(netiq) |
| 2221 | Rockwell CSP1(rockwell-csp1) |
| 2222 | Rockwell CSP2(rockwell-csp2) |
| 2223 | Rockwell CSP3(rockwell-csp3) |
| 2224 | Easy Flexible Internet/Multiplayer Games(efi-mg) |
| 2225 | Resource Connection Initiation Protocol(rcip-itu) |
| 2225 | /sctp Resource Connection Initiation Protocol(rcip-itu) |
| 2226 | Digital Instinct DRM(di-drm) |
| 2227 | DI Messaging Service(di-msg) |
| 2228 | eHome Message Server(ehome-ms) |
| 2229 | DataLens Service(datalens) |
| 2230 | MetaSoft Job Queue Administration Service(queueadm) |
| 2231 | WiMAX ASN Control Plane Protocol(wimaxasncp) |
| 2232 | IVS Video default(ivs-video) |
| 2233 | INFOCRYPT(infocrypt) |
| 2234 | DirectPlay(directplay) |
| 2235 | Sercomm-WLink(sercomm-wlink) |
| 2236 | Nani(nani) |
| 2237 | Optech Port1 License Manager(optech-port1-lm) |
| 2238 | AVIVA SNA SERVER(aviva-sna) |
| 2239 | Image Query(imagequery) |
| 2240 | RECIPe(recipe) |
| 2241 | IVS Daemon(ivsd) |
| 2242 | Folio Remote Server(foliocorp) |
| 2243 | Magicom Protocol(magicom) |
| 2244 | NMS Server(nmsserver) |
| 2245 | HaO(hao) |
| 2246 | PacketCable MTA Addr Map(pc-mta-addrmap) |
| 2247 | Antidote Deployment Manager Service(antidotemgrsvr) |
| 2248 | User Management Service(ums) |
| 2249 | RISO File Manager Protocol(rfmp) |
| 2250 | remote-collab(remote-collab) |
| 2251 | Distributed Framework Port(dif-port) |
| 2252 | NJENET using SSL(njenet-ssl) |
| 2253 | DTV Channel Request(dtv-chan-req) |
| 2254 | Seismic P.O.C. Port(seispoc) |
| 2255 | VRTP - ViRtue Transfer Protocol(vrtp) |
| 2256 | PCC MFP(pcc-mfp) |
| 2257 | simple text/file transfer(simple-tx-rx) |
| 2258 | Rotorcraft Communications Test System(rcts) |
| 2259 | Accedian Performance Measurement(acd-pm) |
| 2260 | APC 2260(apc-2260) |
| 2261 | CoMotion Master Server(comotionmaster) |
| 2262 | CoMotion Backup Server(comotionback) |
| 2263 | ECweb Configuration Service(ecwcfg) |
| 2264 | Audio Precision Apx500 API Port 1(apx500api-1) |
| 2265 | Audio Precision Apx500 API Port 2(apx500api-2) |
| 2266 | M-Files Server(mfserver) |
| 2267 | OntoBroker(ontobroker) |
| 2268 | AMT(amt) |
| 2269 | MIKEY(mikey) |
| 2270 | starSchool(starschool) |
| 2271 | Secure Meeting Maker Scheduling(mmcals) |
| 2272 | Meeting Maker Scheduling(mmcal) |
| 2273 | MySQL Instance Manager(mysql-im) |
| 2274 | PCTTunneller(pcttunnell) |
| 2275 | iBridge Conferencing(ibridge-data) |
| 2276 | iBridge Management(ibridge-mgmt) |
| 2277 | Bt device control proxy(bluectrlproxy) |
| 2278 | Simple Stacked Sequences Database(s3db) |
| 2279 | xmquery(xmquery) |
| 2280 | LNVPOLLER(lnvpoller) |
| 2281 | LNVCONSOLE(lnvconsole) |
| 2282 | LNVALARM(lnvalarm) |
| 2283 | LNVSTATUS(lnvstatus) |
| 2284 | LNVMAPS(lnvmaps) |
| 2285 | LNVMAILMON(lnvmailmon) |
| 2286 | NAS-Metering(nas-metering) |
| 2287 | DNA(dna) |
| 2288 | NETML(netml) |
| 2289 | Lookup dict server(dict-lookup) |
| 2290 | Sonus Logging Services(sonus-logging) |
| 2291 | EPSON Advanced Printer Share Protocol(eapsp) |
| 2292 | Sonus Element Management Services(mib-streaming) |
| 2293 | Network Platform Debug Manager(npdbgmngr) |
| 2294 | Konshus License Manager (FLEX)(konshus-lm) |
| 2295 | Advant License Manager(advant-lm) |
| 2296 | Theta License Manager (Rainbow)(theta-lm) |
| 2297 | D2K DataMover 1(d2k-datamover1) |
| 2298 | D2K DataMover 2(d2k-datamover2) |
| 2299 | PC Telecommute(pc-telecommute) |
| 2300 | CVMMON(cvmmon) |
| 2301 | Compaq HTTP(cpq-wbem) |
| 2302 | Bindery Support(binderysupport) |
| 2303 | Proxy Gateway(proxy-gateway) |
| 2304 | Attachmate UTS(attachmate-uts) |
| 2305 | MT ScaleServer(mt-scaleserver) |
| 2306 | TAPPI BoxNet(tappi-boxnet) |
| 2307 | pehelp(pehelp) |
| 2308 | sdhelp(sdhelp) |
| 2309 | SD Server(sdserver) |
| 2310 | SD Client(sdclient) |
| 2311 | Message Service(messageservice) |
| 2312 | WANScaler Communication Service(wanscaler) |
| 2313 | IAPP (Inter Access Point Protocol)(iapp) |
| 2314 | CR WebSystems(cr-websystems) |
| 2315 | Precise Sft.(precise-sft) |
| 2316 | SENT License Manager(sent-lm) |
| 2317 | Attachmate G32(attachmate-g32) |
| 2318 | Cadence Control(cadencecontrol) |
| 2319 | InfoLibria(infolibria) |
| 2320 | Siebel NS(siebel-ns) |
| 2321 | RDLAP(rdlap) |
| 2322 | ofsd(ofsd) |
| 2323 | 3d-nfsd(3d-nfsd) |
| 2324 | Cosmocall(cosmocall) |
| 2325 | Design Space License Management(designspace-lm) |
| 2326 | IDCP(idcp) |
| 2327 | xingcsm(xingcsm) |
| 2328 | Netrix SFTM(netrix-sftm) |
| 2329 | NVD(nvd) |
| 2330 | TSCCHAT(tscchat) |
| 2331 | AGENTVIEW(agentview) |
| 2332 | RCC Host(rcc-host) |
| 2333 | SNAPP(snapp) |
| 2334 | ACE Client Auth(ace-client) |
| 2335 | ACE Proxy(ace-proxy) |
| 2336 | Apple UG Control(appleugcontrol) |
| 2337 | ideesrv(ideesrv) |
| 2338 | Norton Lambert(norton-lambert) |
| 2339 | 3Com WebView(3com-webview) |
| 2340 | WRS Registry(wrs_registry) |
| 2341 | XIO Status(xiostatus) |
| 2342 | Seagate Manage Exec(manage-exec) |
| 2343 | nati logos(nati-logos) |
| 2344 | fcmsys(fcmsys) |
| 2345 | dbm(dbm) |
| 2346 | Game Connection Port(redstorm_join) |
| 2347 | Game Announcement and Location(redstorm_find) |
| 2348 | Information to query for game status(redstorm_info) |
| 2349 | Diagnostics Port(redstorm_diag) |
| 2350 | psbserver(psbserver) |
| 2351 | psrserver(psrserver) |
| 2352 | pslserver(pslserver) |
| 2353 | pspserver(pspserver) |
| 2354 | psprserver(psprserver) |
| 2355 | psdbserver(psdbserver) |
| 2356 | GXT License Managemant(gxtelmd) |
| 2357 | UniHub Server(unihub-server) |
| 2358 | Futrix(futrix) |
| 2359 | FlukeServer(flukeserver) |
| 2360 | NexstorIndLtd(nexstorindltd) |
| 2361 | TL1(tl1) |
| 2362 | digiman(digiman) |
| 2363 | Media Central NFSD(mediacntrlnfsd) |
| 2364 | OI-2000(oi-2000) |
| 2365 | dbref(dbref) |
| 2366 | qip-login(qip-login) |
| 2367 | Service Control(service-ctrl) |
| 2368 | OpenTable(opentable) |
| 2370 | L3-HBMon(l3-hbmon) |
| 2371 | Compaq WorldWire Port(worldwire) |
| 2381 | Compaq HTTPS(compaq-https) |
| 2382 | Microsoft OLAP(ms-olap3) |
| 2383 | Microsoft OLAP(ms-olap4) |
| 2384 | SD-REQUEST(sd-request) |
| 2385 | SD-DATA(sd-data) |
| 2386 | Virtual Tape(virtualtape) |
| 2387 | VSAM Redirector(vsamredirector) |
| 2388 | MYNAH AutoStart(mynahautostart) |
| 2389 | OpenView Session Mgr(ovsessionmgr) |
| 2390 | RSMTP(rsmtp) |
| 2391 | 3COM Net Management(3com-net-mgmt) |
| 2392 | Tactical Auth(tacticalauth) |
| 2393 | MS OLAP 1(ms-olap1) |
| 2394 | MS OLAP 2(ms-olap2) |
| 2395 | LAN900 Remote(lan900_remote) |
| 2396 | Wusage(wusage) |
| 2397 | NCL(ncl) |
| 2398 | Orbiter(orbiter) |
| 2399 | FileMaker, Inc. - Data Access Layer(fmpro-fdal) |
| 2400 | OpEquus Server(opequus-server) |
| 2401 | cvspserver(cvspserver) |
| 2402 | TaskMaster 2000 Server(taskmaster2000) |
| 2403 | TaskMaster 2000 Web(taskmaster2000) |
| 2404 | IEC 60870-5-104 process control over IP(iec-104) |
| 2405 | TRC Netpoll(trc-netpoll) |
| 2406 | JediServer(jediserver) |
| 2407 | Orion(orion) |
| 2408 | OptimaNet(optimanet) |
| 2409 | SNS Protocol(sns-protocol) |
| 2410 | VRTS Registry(vrts-registry) |
| 2411 | Netwave AP Management(netwave-ap-mgmt) |
| 2412 | CDN(cdn) |
| 2413 | orion-rmi-reg(orion-rmi-reg) |
| 2414 | Beeyond(beeyond) |
| 2415 | Codima Remote Transaction Protocol(codima-rtp) |
| 2416 | RMT Server(rmtserver) |
| 2417 | Composit Server(composit-server) |
| 2418 | cas(cas) |
| 2419 | Attachmate S2S(attachmate-s2s) |
| 2420 | DSL Remote Management(dslremote-mgmt) |
| 2421 | G-Talk(g-talk) |
| 2422 | CRMSBITS(crmsbits) |
| 2423 | RNRP(rnrp) |
| 2424 | KOFAX-SVR(kofax-svr) |
| 2425 | Fujitsu App Manager(fjitsuappmgr) |
| 2427 | Media Gateway Control Protocol Gateway(mgcp-gateway) |
| 2428 | One Way Trip Time(ott) |
| 2429 | FT-ROLE(ft-role) |
| 2430 | venus(venus) |
| 2431 | venus-se(venus-se) |
| 2432 | codasrv(codasrv) |
| 2433 | codasrv-se(codasrv-se) |
| 2434 | pxc-epmap(pxc-epmap) |
| 2435 | OptiLogic(optilogic) |
| 2436 | TOP/X(topx) |
| 2437 | UniControl(unicontrol) |
| 2438 | MSP(msp) |
| 2439 | SybaseDBSynch(sybasedbsynch) |
| 2440 | Spearway Lockers(spearway) |
| 2441 | Pervasive I*net Data Server(pvsw-inet) |
| 2442 | Netangel(netangel) |
| 2443 | PowerClient Central Storage Facility(powerclientcsf) |
| 2444 | BT PP2 Sectrans(btpp2sectrans) |
| 2445 | DTN1(dtn1) |
| 2446 | bues_service(bues_service) |
| 2447 | OpenView NNM daemon(ovwdb) |
| 2448 | hpppsvr(hpppssvr) |
| 2449 | RATL(ratl) |
| 2450 | netadmin(netadmin) |
| 2451 | netchat(netchat) |
| 2452 | SnifferClient(snifferclient) |
| 2453 | madge ltd(madge-ltd) |
| 2454 | IndX-DDS(indx-dds) |
| 2455 | WAGO-IO-SYSTEM(wago-io-system) |
| 2456 | altav-remmgt(altav-remmgt) |
| 2457 | Rapido_IP(rapido-ip) |
| 2458 | griffin(griffin) |
| 2459 | Community(community) |
| 2460 | ms-theater(ms-theater) |
| 2461 | qadmifoper(qadmifoper) |
| 2462 | qadmifevent(qadmifevent) |
| 2463 | Symbios Raid(symbios-raid) |
| 2464 | DirecPC SI(direcpc-si) |
| 2465 | Load Balance Management(lbm) |
| 2466 | Load Balance Forwarding(lbf) |
| 2467 | High Criteria(high-criteria) |
| 2468 | qip_msgd(qip-msgd) |
| 2469 | MTI-TCS-COMM(mti-tcs-comm) |
| 2470 | taskman port(taskman-port) |
| 2471 | SeaODBC(seaodbc) |
| 2472 | C3(c3) |
| 2473 | Aker-cdp(aker-cdp) |
| 2474 | Vital Analysis(vitalanalysis) |
| 2475 | ACE Server(ace-server) |
| 2476 | ACE Server Propagation(ace-svr-prop) |
| 2477 | SecurSight Certificate Valifation Service(ssm-cvs) |
| 2478 | SecurSight Authentication Server (SSL)(ssm-cssps) |
| 2479 | SecurSight Event Logging Server (SSL)(ssm-els) |
| 2480 | Informatica PowerExchange Listener(powerexchange) |
| 2481 | Oracle GIOP(giop) |
| 2482 | Oracle GIOP SSL(giop-ssl) |
| 2483 | Oracle TTC(ttc) |
| 2484 | Oracle TTC SSL(ttc-ssl) |
| 2485 | Net Objects1(netobjects1) |
| 2486 | Net Objects2(netobjects2) |
| 2487 | Policy Notice Service(pns) |
| 2488 | Moy Corporation(moy-corp) |
| 2489 | TSILB(tsilb) |
| 2490 | qip_qdhcp(qip-qdhcp) |
| 2491 | Conclave CPP(conclave-cpp) |
| 2492 | GROOVE(groove) |
| 2493 | Talarian MQS(talarian-mqs) |
| 2494 | BMC AR(bmc-ar) |
| 2495 | Fast Remote Services(fast-rem-serv) |
| 2496 | DIRGIS(dirgis) |
| 2497 | Quad DB(quaddb) |
| 2498 | ODN-CasTraq(odn-castraq) |
| 2499 | UniControl(unicontrol) |
| 2500 | Resource Tracking system server(rtsserv) |
| 2501 | Resource Tracking system client(rtsclient) |
| 2502 | Kentrox Protocol(kentrox-prot) |
| 2503 | NMS-DPNSS(nms-dpnss) |
| 2504 | WLBS(wlbs) |
| 2505 | PowerPlay Control(ppcontrol) |
| 2506 | jbroker(jbroker) |
| 2507 | spock(spock) |
| 2508 | JDataStore(jdatastore) |
| 2509 | fjmpss(fjmpss) |
| 2510 | fjappmgrbulk(fjappmgrbulk) |
| 2511 | Metastorm(metastorm) |
| 2512 | Citrix IMA(citrixima) |
| 2513 | Citrix ADMIN(citrixadmin) |
| 2514 | Facsys NTP(facsys-ntp) |
| 2515 | Facsys Router(facsys-router) |
| 2516 | Main Control(maincontrol) |
| 2517 | H.323 Annex E call signaling transport(call-sig-trans) |
| 2518 | Willy(willy) |
| 2519 | globmsgsvc(globmsgsvc) |
| 2520 | Pervasive Listener(pvsw) |
| 2521 | Adaptec Manager(adaptecmgr) |
| 2522 | WinDb(windb) |
| 2523 | Qke LLC V.3(qke-llc-v3) |
| 2524 | Optiwave License Management(optiwave-lm) |
| 2525 | MS V-Worlds(ms-v-worlds) |
| 2526 | EMA License Manager(ema-sent-lm) |
| 2527 | IQ Server(iqserver) |
| 2528 | NCR CCL(ncr_ccl) |
| 2529 | UTS FTP(utsftp) |
| 2530 | VR Commerce(vrcommerce) |
| 2531 | ITO-E GUI(ito-e-gui) |
| 2532 | OVTOPMD(ovtopmd) |
| 2533 | SnifferServer(snifferserver) |
| 2534 | Combox Web Access(combox-web-acc) |
| 2535 | MADCAP(madcap) |
| 2536 | btpp2audctr1(btpp2audctr1) |
| 2537 | Upgrade Protocol(upgrade) |
| 2538 | vnwk-prapi(vnwk-prapi) |
| 2539 | VSI Admin(vsiadmin) |
| 2540 | LonWorks(lonworks) |
| 2541 | LonWorks2(lonworks2) |
| 2542 | uDraw(Graph)(udrawgraph) |
| 2543 | REFTEK(reftek) |
| 2544 | Management Daemon Refresh(novell-zen) |
| 2545 | sis-emt(sis-emt) |
| 2546 | vytalvaultbrtp(vytalvaultbrtp) |
| 2547 | vytalvaultvsmp(vytalvaultvsmp) |
| 2548 | vytalvaultpipe(vytalvaultpipe) |
| 2549 | IPASS(ipass) |
| 2550 | ADS(ads) |
| 2551 | ISG UDA Server(isg-uda-server) |
| 2552 | Call Logging(call-logging) |
| 2553 | efidiningport(efidiningport) |
| 2554 | VCnet-Link v10(vcnet-link-v10) |
| 2555 | Compaq WCP(compaq-wcp) |
| 2556 | nicetec-nmsvc(nicetec-nmsvc) |
| 2557 | nicetec-mgmt(nicetec-mgmt) |
| 2558 | PCLE Multi Media(pclemultimedia) |
| 2559 | LSTP(lstp) |
| 2560 | labrat(labrat) |
| 2561 | MosaixCC(mosaixcc) |
| 2562 | Delibo(delibo) |
| 2563 | CTI Redwood(cti-redwood) |
| 2564 | HP 3000 NS/VT block mode telnet(hp-3000-telnet) |
| 2565 | Coordinator Server(coord-svr) |
| 2566 | pcs-pcw(pcs-pcw) |
| 2567 | Cisco Line Protocol(clp) |
| 2568 | SPAM TRAP(spamtrap) |
| 2569 | Sonus Call Signal(sonuscallsig) |
| 2570 | HS Port(hs-port) |
| 2571 | CECSVC(cecsvc) |
| 2572 | IBP(ibp) |
| 2573 | Trust Establish(trustestablish) |
| 2574 | Blockade BPSP(blockade-bpsp) |
| 2575 | HL7(hl7) |
| 2576 | TCL Pro Debugger(tclprodebugger) |
| 2577 | Scriptics Lsrvr(scipticslsrvr) |
| 2578 | RVS ISDN DCP(rvs-isdn-dcp) |
| 2579 | mpfoncl(mpfoncl) |
| 2580 | Tributary(tributary) |
| 2581 | ARGIS TE(argis-te) |
| 2582 | ARGIS DS(argis-ds) |
| 2583 | MON(mon) |
| 2584 | cyaserv(cyaserv) |
| 2585 | NETX Server(netx-server) |
| 2586 | NETX Agent(netx-agent) |
| 2587 | MASC(masc) |
| 2588 | Privilege(privilege) |
| 2589 | quartus tcl(quartus-tcl) |
| 2590 | idotdist(idotdist) |
| 2591 | Maytag Shuffle(maytagshuffle) |
| 2592 | netrek(netrek) |
| 2593 | MNS Mail Notice Service(mns-mail) |
| 2594 | Data Base Server(dts) |
| 2595 | World Fusion 1(worldfusion1) |
| 2596 | World Fusion 2(worldfusion2) |
| 2597 | Homestead Glory(homesteadglory) |
| 2598 | Citrix MA Client(citriximaclient) |
| 2599 | Snap Discovery(snapd) |
| 2600 | HPSTGMGR(hpstgmgr) |
| 2601 | discp client(discp-client) |
| 2602 | discp server(discp-server) |
| 2603 | Service Meter(servicemeter) |
| 2604 | NSC CCS(nsc-ccs) |
| 2605 | NSC POSA(nsc-posa) |
| 2606 | Dell Netmon(netmon) |
| 2607 | Dell Connection(connection) |
| 2608 | Wag Service(wag-service) |
| 2609 | System Monitor(system-monitor) |
| 2610 | VersaTek(versa-tek) |
| 2611 | LIONHEAD(lionhead) |
| 2612 | Qpasa Agent(qpasa-agent) |
| 2613 | SMNTUBootstrap(smntubootstrap) |
| 2614 | Never Offline(neveroffline) |
| 2615 | firepower(firepower) |
| 2616 | appswitch-emp(appswitch-emp) |
| 2617 | Clinical Context Managers(cmadmin) |
| 2618 | Priority E-Com(priority-e-com) |
| 2619 | bruce(bruce) |
| 2620 | LPSRecommender(lpsrecommender) |
| 2621 | Miles Apart Jukebox Server(miles-apart) |
| 2622 | MetricaDBC(metricadbc) |
| 2623 | LMDP(lmdp) |
| 2624 | Aria(aria) |
| 2625 | Blwnkl Port(blwnkl-port) |
| 2626 | gbjd816(gbjd816) |
| 2627 | Moshe Beeri(moshebeeri) |
| 2628 | DICT(dict) |
| 2629 | Sitara Server(sitaraserver) |
| 2630 | Sitara Management(sitaramgmt) |
| 2631 | Sitara Dir(sitaradir) |
| 2632 | IRdg Post(irdg-post) |
| 2633 | InterIntelli(interintelli) |
| 2634 | PK Electronics(pk-electronics) |
| 2635 | Back Burner(backburner) |
| 2636 | Solve(solve) |
| 2637 | Import Document Service(imdocsvc) |
| 2638 | Sybase Anywhere(sybaseanywhere) |
| 2639 | AMInet(aminet) |
| 2640 | Sabbagh Associates Licence Manager(sai_sentlm) |
| 2641 | HDL Server(hdl-srv) |
| 2642 | Tragic(tragic) |
| 2643 | GTE-SAMP(gte-samp) |
| 2644 | Travsoft IPX Tunnel(travsoft-ipx-t) |
| 2645 | Novell IPX CMD(novell-ipx-cmd) |
| 2646 | AND License Manager(and-lm) |
| 2647 | SyncServer(syncserver) |
| 2648 | Upsnotifyprot(upsnotifyprot) |
| 2649 | VPSIPPORT(vpsipport) |
| 2650 | eristwoguns(eristwoguns) |
| 2651 | EBInSite(ebinsite) |
| 2652 | InterPathPanel(interpathpanel) |
| 2653 | Sonus(sonus) |
| 2654 | Corel VNC Admin(corel_vncadmin) |
| 2655 | UNIX Nt Glue(unglue) |
| 2656 | Kana(kana) |
| 2657 | SNS Dispatcher(sns-dispatcher) |
| 2658 | SNS Admin(sns-admin) |
| 2659 | SNS Query(sns-query) |
| 2660 | GC Monitor(gcmonitor) |
| 2661 | OLHOST(olhost) |
| 2662 | BinTec-CAPI(bintec-capi) |
| 2663 | BinTec-TAPI(bintec-tapi) |
| 2664 | Patrol for MQ GM(patrol-mq-gm) |
| 2665 | Patrol for MQ NM(patrol-mq-nm) |
| 2666 | extensis(extensis) |
| 2667 | Alarm Clock Server(alarm-clock-s) |
| 2668 | Alarm Clock Client(alarm-clock-c) |
| 2669 | TOAD(toad) |
| 2670 | TVE Announce(tve-announce) |
| 2671 | newlixreg(newlixreg) |
| 2672 | nhserver(nhserver) |
| 2673 | First Call 42(firstcall42) |
| 2674 | ewnn(ewnn) |
| 2675 | TTC ETAP(ttc-etap) |
| 2676 | SIMSLink(simslink) |
| 2677 | Gadget Gate 1 Way(gadgetgate1way) |
| 2678 | Gadget Gate 2 Way(gadgetgate2way) |
| 2679 | Sync Server SSL(syncserverssl) |
| 2680 | pxc-sapxom(pxc-sapxom) |
| 2681 | mpnjsomb(mpnjsomb) |
| 2683 | NCDLoadBalance(ncdloadbalance) |
| 2684 | mpnjsosv(mpnjsosv) |
| 2685 | mpnjsocl(mpnjsocl) |
| 2686 | mpnjsomg(mpnjsomg) |
| 2687 | pq-lic-mgmt(pq-lic-mgmt) |
| 2688 | md-cf-http(md-cg-http) |
| 2689 | FastLynx(fastlynx) |
| 2690 | HP NNM Embedded Database(hp-nnm-data) |
| 2691 | ITInternet ISM Server(itinternet) |
| 2692 | Admins LMS(admins-lms) |
| 2694 | pwrsevent(pwrsevent) |
| 2695 | VSPREAD(vspread) |
| 2696 | Unify Admin(unifyadmin) |
| 2697 | Oce SNMP Trap Port(oce-snmp-trap) |
| 2698 | MCK-IVPIP(mck-ivpip) |
| 2699 | Csoft Plus Client(csoft-plusclnt) |
| 2700 | tqdata(tqdata) |
| 2701 | SMS RCINFO(sms-rcinfo) |
| 2702 | SMS XFER(sms-xfer) |
| 2703 | SMS CHAT(sms-chat) |
| 2704 | SMS REMCTRL(sms-remctrl) |
| 2705 | SDS Admin(sds-admin) |
| 2706 | NCD Mirroring(ncdmirroring) |
| 2707 | EMCSYMAPIPORT(emcsymapiport) |
| 2708 | Banyan-Net(banyan-net) |
| 2709 | Supermon(supermon) |
| 2710 | SSO Service(sso-service) |
| 2711 | SSO Control(sso-control) |
| 2712 | Axapta Object Communication Protocol(aocp) |
| 2713 | Raven1(raven1) |
| 2714 | Raven2(raven2) |
| 2715 | HPSTGMGR2(hpstgmgr2) |
| 2716 | Inova IP Disco(inova-ip-disco) |
| 2717 | PN REQUESTER(pn-requester) |
| 2718 | PN REQUESTER 2(pn-requester2) |
| 2719 | Scan & Change(scan-change) |
| 2720 | wkars(wkars) |
| 2721 | Smart Diagnose(smart-diagnose) |
| 2722 | Proactive Server(proactivesrvr) |
| 2723 | WatchDog NT(watchdognt) |
| 2724 | qotps(qotps) |
| 2725 | MSOLAP PTP2(msolap-ptp2) |
| 2726 | TAMS(tams) |
| 2727 | Media Gateway Control Protocol Call Agent(mgcp-callagent) |
| 2728 | SQDR(sqdr) |
| 2729 | TCIM Control(tcim-control) |
| 2730 | NEC RaidPlus(nec-raidplus) |
| 2731 | Fyre Messanger(fyre-messanger) |
| 2732 | G5M(g5m) |
| 2733 | Signet CTF(signet-ctf) |
| 2734 | CCS Software(ccs-software) |
| 2735 | NetIQ Monitor Console(netiq-mc) |
| 2736 | RADWIZ NMS SRV(radwiz-nms-srv) |
| 2737 | SRP Feedback(srp-feedback) |
| 2738 | NDL TCP-OSI Gateway(ndl-tcp-ois-gw) |
| 2739 | TN Timing(tn-timing) |
| 2740 | Alarm(alarm) |
| 2741 | TSB(tsb) |
| 2742 | TSB2(tsb2) |
| 2743 | murx(murx) |
| 2744 | honyaku(honyaku) |
| 2745 | URBISNET(urbisnet) |
| 2746 | CPUDPENCAP(cpudpencap) |
| 2747 | (fjippol-swrly) |
| 2748 | (fjippol-polsvr) |
| 2749 | (fjippol-cnsl) |
| 2750 | (fjippol-port1) |
| 2751 | (fjippol-port2) |
| 2752 | RSISYS ACCESS(rsisysaccess) |
| 2753 | de-spot(de-spot) |
| 2754 | APOLLO CC(apollo-cc) |
| 2755 | Express Pay(expresspay) |
| 2756 | simplement-tie(simplement-tie) |
| 2757 | CNRP(cnrp) |
| 2758 | APOLLO Status(apollo-status) |
| 2759 | APOLLO GMS(apollo-gms) |
| 2760 | Saba MS(sabams) |
| 2761 | DICOM ISCL(dicom-iscl) |
| 2762 | DICOM TLS(dicom-tls) |
| 2763 | Desktop DNA(desktop-dna) |
| 2764 | Data Insurance(data-insurance) |
| 2765 | qip-audup(qip-audup) |
| 2766 | Compaq SCP(compaq-scp) |
| 2767 | UADTC(uadtc) |
| 2768 | UACS(uacs) |
| 2769 | eXcE(exce) |
| 2770 | Veronica(veronica) |
| 2771 | Vergence CM(vergencecm) |
| 2772 | auris(auris) |
| 2773 | RBackup Remote Backup(rbakcup1) |
| 2774 | RBackup Remote Backup(rbakcup2) |
| 2775 | SMPP(smpp) |
| 2776 | Ridgeway Systems & Software(ridgeway1) |
| 2777 | Ridgeway Systems & Software(ridgeway2) |
| 2778 | Gwen-Sonya(gwen-sonya) |
| 2779 | LBC Sync(lbc-sync) |
| 2780 | LBC Control(lbc-control) |
| 2781 | whosells(whosells) |
| 2782 | everydayrc(everydayrc) |
| 2783 | AISES(aises) |
| 2784 | world wide web - development(www-dev) |
| 2785 | aic-np(aic-np) |
| 2786 | aic-oncrpc - Destiny MCD database(aic-oncrpc) |
| 2787 | piccolo - Cornerstone Software(piccolo) |
| 2788 | NetWare Loadable Module - Seagate Software(fryeserv) |
| 2789 | Media Agent(media-agent) |
| 2790 | PLG Proxy(plgproxy) |
| 2791 | MT Port Registrator(mtport-regist) |
| 2792 | f5-globalsite(f5-globalsite) |
| 2793 | initlsmsad(initlsmsad) |
| 2795 | LiveStats(livestats) |
| 2796 | ac-tech(ac-tech) |
| 2797 | esp-encap(esp-encap) |
| 2798 | TMESIS-UPShot(tmesis-upshot) |
| 2799 | ICON Discover(icon-discover) |
| 2800 | ACC RAID(acc-raid) |
| 2801 | IGCP(igcp) |
| 2802 | Veritas TCP1(veritas-tcp1) |
| 2803 | btprjctrl(btprjctrl) |
| 2804 | March Networks Digital Video Recorders and Enterprise Service Manager products(dvr-esm) |
| 2805 | WTA WSP-S(wta-wsp-s) |
| 2806 | cspuni(cspuni) |
| 2807 | cspmulti(cspmulti) |
| 2808 | J-LAN-P(j-lan-p) |
| 2809 | CORBA LOC(corbaloc) |
| 2810 | Active Net Steward(netsteward) |
| 2811 | GSI FTP(gsiftp) |
| 2812 | atmtcp(atmtcp) |
| 2813 | llm-pass(llm-pass) |
| 2814 | llm-csv(llm-csv) |
| 2815 | LBC Measurement(lbc-measure) |
| 2816 | LBC Watchdog(lbc-watchdog) |
| 2817 | NMSig Port(nmsigport) |
| 2818 | rmlnk(rmlnk) |
| 2819 | FC Fault Notification(fc-faultnotify) |
| 2820 | UniVision(univision) |
| 2821 | VERITAS Authentication Service(vrts-at-port) |
| 2822 | ka0wuc(ka0wuc) |
| 2823 | CQG Net/LAN(cqg-netlan) |
| 2824 | CQG Net/LAN 1(cqg-netlan-1) |
| 2826 | slc systemlog(slc-systemlog) |
| 2827 | slc ctrlrloops(slc-ctrlrloops) |
| 2828 | ITM License Manager(itm-lm) |
| 2829 | silkp1(silkp1) |
| 2830 | silkp2(silkp2) |
| 2831 | silkp3(silkp3) |
| 2832 | silkp4(silkp4) |
| 2833 | glishd(glishd) |
| 2834 | EVTP(evtp) |
| 2835 | EVTP-DATA(evtp-data) |
| 2836 | catalyst(catalyst) |
| 2837 | Repliweb(repliweb) |
| 2838 | Starbot(starbot) |
| 2839 | NMSigPort(nmsigport) |
| 2840 | l3-exprt(l3-exprt) |
| 2841 | l3-ranger(l3-ranger) |
| 2842 | l3-hawk(l3-hawk) |
| 2843 | PDnet(pdnet) |
| 2844 | BPCP POLL(bpcp-poll) |
| 2845 | BPCP TRAP(bpcp-trap) |
| 2846 | AIMPP Hello(aimpp-hello) |
| 2847 | AIMPP Port Req(aimpp-port-req) |
| 2848 | AMT-BLC-PORT(amt-blc-port) |
| 2849 | FXP(fxp) |
| 2850 | MetaConsole(metaconsole) |
| 2851 | webemshttp(webemshttp) |
| 2852 | bears-01(bears-01) |
| 2853 | ISPipes(ispipes) |
| 2854 | InfoMover(infomover) |
| 2856 | cesdinv(cesdinv) |
| 2857 | SimCtIP(simctlp) |
| 2858 | ECNP(ecnp) |
| 2859 | Active Memory(activememory) |
| 2860 | Dialpad Voice 1(dialpad-voice1) |
| 2861 | Dialpad Voice 2(dialpad-voice2) |
| 2862 | TTG Protocol(ttg-protocol) |
| 2863 | Sonar Data(sonardata) |
| 2864 | main 5001 cmd(astromed-main) |
| 2865 | pit-vpn(pit-vpn) |
| 2866 | iwlistener(iwlistener) |
| 2867 | esps-portal(esps-portal) |
| 2868 | NPEP Messaging(npep-messaging) |
| 2869 | ICSLAP(icslap) |
| 2870 | daishi(daishi) |
| 2871 | MSI Select Play(msi-selectplay) |
| 2872 | RADIX(radix) |
| 2874 | dxmessagebase1(dxmessagebase1) |
| 2875 | dxmessagebase2(dxmessagebase2) |
| 2876 | SPS Tunnel(sps-tunnel) |
| 2877 | BLUELANCE(bluelance) |
| 2878 | AAP(aap) |
| 2879 | ucentric-ds(ucentric-ds) |
| 2880 | Synapse Transport(synapse) |
| 2881 | NDSP(ndsp) |
| 2882 | NDTP(ndtp) |
| 2883 | NDNP(ndnp) |
| 2884 | Flash Msg(flashmsg) |
| 2885 | TopFlow(topflow) |
| 2886 | RESPONSELOGIC(responselogic) |
| 2887 | aironet(aironetddp) |
| 2888 | SPCSDLOBBY(spcsdlobby) |
| 2889 | RSOM(rsom) |
| 2890 | CSPCLMULTI(cspclmulti) |
| 2891 | CINEGRFX-ELMD License Manager(cinegrfx-elmd) |
| 2892 | SNIFFERDATA(snifferdata) |
| 2893 | VSECONNECTOR(vseconnector) |
| 2894 | ABACUS-REMOTE(abacus-remote) |
| 2895 | NATUS LINK(natuslink) |
| 2896 | ECOVISIONG6-1(ecovisiong6-1) |
| 2897 | Citrix RTMP(citrix-rtmp) |
| 2898 | APPLIANCE-CFG(appliance-cfg) |
| 2899 | POWERGEMPLUS(powergemplus) |
| 2900 | QUICKSUITE(quicksuite) |
| 2901 | ALLSTORCNS(allstorcns) |
| 2902 | NET ASPI(netaspi) |
| 2903 | SUITCASE(suitcase) |
| 2904 | M2UA(m2ua) |
| 2904 | /sctp M2UA(m2ua) |
| 2905 | M3UA(m3ua) |
| 2905 | /sctp M3UA(m3ua) |
| 2906 | CALLER9(caller9) |
| 2907 | WEBMETHODS B2B(webmethods-b2b) |
| 2908 | mao(mao) |
| 2909 | Funk Dialout(funk-dialout) |
| 2910 | TDAccess(tdaccess) |
| 2911 | Blockade(blockade) |
| 2912 | Epicon(epicon) |
| 2913 | Booster Ware(boosterware) |
| 2914 | Game Lobby(gamelobby) |
| 2915 | TK Socket(tksocket) |
| 2916 | Elvin Server(elvin_server) |
| 2917 | Elvin Client(elvin_client) |
| 2918 | Kasten Chase Pad(kastenchasepad) |
| 2919 | roboER(roboer) |
| 2920 | roboEDA(roboeda) |
| 2921 | CESD Contents Delivery Management(cesdcdman) |
| 2922 | CESD Contents Delivery Data Transfer(cesdcdtrn) |
| 2923 | WTA-WSP-WTP-S(wta-wsp-wtp-s) |
| 2924 | PRECISE-VIP(precise-vip) |
| 2926 | MOBILE-FILE-DL(mobile-file-dl) |
| 2927 | UNIMOBILECTRL(unimobilectrl) |
| 2928 | REDSTONE-CPSS(redstone-cpss) |
| 2929 | AMX-WEBADMIN(amx-webadmin) |
| 2930 | AMX-WEBLINX(amx-weblinx) |
| 2931 | Circle-X(circle-x) |
| 2932 | INCP(incp) |
| 2933 | 4-TIER OPM GW(4-tieropmgw) |
| 2934 | 4-TIER OPM CLI(4-tieropmcli) |
| 2935 | QTP(qtp) |
| 2936 | OTPatch(otpatch) |
| 2937 | PNACONSULT-LM(pnaconsult-lm) |
| 2938 | SM-PAS-1(sm-pas-1) |
| 2939 | SM-PAS-2(sm-pas-2) |
| 2940 | SM-PAS-3(sm-pas-3) |
| 2941 | SM-PAS-4(sm-pas-4) |
| 2942 | SM-PAS-5(sm-pas-5) |
| 2943 | TTNRepository(ttnrepository) |
| 2944 | Megaco H-248(megaco-h248) |
| 2944 | /sctp Megaco-H.248 text(megaco-h248) |
| 2945 | H248 Binary(h248-binary) |
| 2945 | /sctp Megaco/H.248 binary(h248-binary) |
| 2946 | FJSVmpor(fjsvmpor) |
| 2947 | GPSD(gpsd) |
| 2948 | WAP PUSH(wap-push) |
| 2949 | WAP PUSH SECURE(wap-pushsecure) |
| 2950 | ESIP(esip) |
| 2951 | OTTP(ottp) |
| 2952 | MPFWSAS(mpfwsas) |
| 2953 | OVALARMSRV(ovalarmsrv) |
| 2954 | OVALARMSRV-CMD(ovalarmsrv-cmd) |
| 2955 | CSNOTIFY(csnotify) |
| 2956 | OVRIMOSDBMAN(ovrimosdbman) |
| 2957 | JAMCT5(jmact5) |
| 2958 | JAMCT6(jmact6) |
| 2959 | RMOPAGT(rmopagt) |
| 2960 | DFOXSERVER(dfoxserver) |
| 2961 | BOLDSOFT-LM(boldsoft-lm) |
| 2962 | IPH-POLICY-CLI(iph-policy-cli) |
| 2963 | IPH-POLICY-ADM(iph-policy-adm) |
| 2964 | BULLANT SRAP(bullant-srap) |
| 2965 | BULLANT RAP(bullant-rap) |
| 2966 | IDP-INFOTRIEVE(idp-infotrieve) |
| 2967 | SSC-AGENT(ssc-agent) |
| 2968 | ENPP(enpp) |
| 2969 | ESSP(essp) |
| 2970 | INDEX-NET(index-net) |
| 2971 | NetClip clipboard daemon(netclip) |
| 2972 | PMSM Webrctl(pmsm-webrctl) |
| 2973 | SV Networks(svnetworks) |
| 2974 | Signal(signal) |
| 2975 | Fujitsu Configuration Management Service(fjmpcm) |
| 2976 | CNS Server Port(cns-srv-port) |
| 2977 | TTCs Enterprise Test Access Protocol - NS(ttc-etap-ns) |
| 2978 | TTCs Enterprise Test Access Protocol - DS(ttc-etap-ds) |
| 2979 | H.263 Video Streaming(h263-video) |
| 2980 | Instant Messaging Service(wimd) |
| 2981 | MYLXAMPORT(mylxamport) |
| 2982 | IWB-WHITEBOARD(iwb-whiteboard) |
| 2983 | NETPLAN(netplan) |
| 2984 | HPIDSADMIN(hpidsadmin) |
| 2985 | HPIDSAGENT(hpidsagent) |
| 2986 | STONEFALLS(stonefalls) |
| 2987 | identify(identify) |
| 2988 | HIPPA Reporting Protocol(hippad) |
| 2989 | ZARKOV Intelligent Agent Communication(zarkov) |
| 2990 | BOSCAP(boscap) |
| 2991 | WKSTN-MON(wkstn-mon) |
| 2992 | ITB301(itb301) |
| 2993 | VERITAS VIS1(veritas-vis1) |
| 2994 | VERITAS VIS2(veritas-vis2) |
| 2995 | IDRS(idrs) |
| 2996 | vsixml(vsixml) |
| 2997 | REBOL(rebol) |
| 2998 | Real Secure(realsecure) |
| 2999 | RemoteWare Unassigned(remoteware-un) |
| 3000 | HBCI(hbci) |
| 3000 | RemoteWare Client(remoteware-cl) |
| 3002 | EXLM Agent(exlm-agent) |
| 3002 | RemoteWare Server(remoteware-srv) |
| 3003 | CGMS(cgms) |
| 3004 | Csoft Agent(csoftragent) |
| 3005 | Genius License Manager(geniuslm) |
| 3006 | Instant Internet Admin(ii-admin) |
| 3007 | Lotus Mail Tracking Agent Protocol(lotusmtap) |
| 3008 | Midnight Technologies(midnight-tech) |
| 3009 | PXC-NTFY(pxc-ntfy) |
| 3010 | Telerate Workstation(gw) |
| 3011 | Trusted Web(trusted-web) |
| 3012 | Trusted Web Client(twsdss) |
| 3013 | Gilat Sky Surfer(gilatskysurfer) |
| 3014 | Broker Service(broker_service) |
| 3015 | NATI DSTP(nati-dstp) |
| 3016 | Notify Server(notify_srvr) |
| 3017 | Event Listener(event_listener) |
| 3018 | Service Registry(srvc_registry) |
| 3019 | Resource Manager(resource_mgr) |
| 3020 | CIFS(cifs) |
| 3021 | AGRI Server(agriserver) |
| 3022 | CSREGAGENT(csregagent) |
| 3023 | magicnotes(magicnotes) |
| 3024 | NDS_SSO(nds_sso) |
| 3025 | Arepa Raft(arepa-raft) |
| 3026 | AGRI Gateway(agri-gateway) |
| 3027 | LiebDevMgmt_C(LiebDevMgmt_C) |
| 3028 | LiebDevMgmt_DM(LiebDevMgmt_DM) |
| 3029 | LiebDevMgmt_A(LiebDevMgmt_A) |
| 3030 | Arepa Cas(arepa-cas) |
| 3031 | Remote AppleEvents/PPC Toolbox(eppc) |
| 3032 | Redwood Chat(redwood-chat) |
| 3033 | PDB(pdb) |
| 3034 | Osmosis / Helix (R) AEEA Port(osmosis-aeea) |
| 3035 | FJSV gssagt(fjsv-gssagt) |
| 3036 | Hagel DUMP(hagel-dump) |
| 3037 | HP SAN Mgmt(hp-san-mgmt) |
| 3038 | Santak UPS(santak-ups) |
| 3039 | Cogitate, Inc.(cogitate) |
| 3040 | Tomato Springs(tomato-springs) |
| 3041 | di-traceware(di-traceware) |
| 3042 | journee(journee) |
| 3043 | Broadcast Routing Protocol(brp) |
| 3044 | EndPoint Protocol(epp) |
| 3045 | ResponseNet(responsenet) |
| 3046 | di-ase(di-ase) |
| 3047 | Fast Security HL Server(hlserver) |
| 3048 | Sierra Net PC Trader(pctrader) |
| 3049 | NSWS(nsws) |
| 3050 | gds_db(gds_db) |
| 3051 | Galaxy Server(galaxy-server) |
| 3052 | APC 3052(apc-3052) |
| 3053 | dsom-server(dsom-server) |
| 3054 | AMT CNF PROT(amt-cnf-prot) |
| 3055 | Policy Server(policyserver) |
| 3056 | CDL Server(cdl-server) |
| 3057 | GoAhead FldUp(goahead-fldup) |
| 3058 | videobeans(videobeans) |
| 3059 | qsoft(qsoft) |
| 3060 | interserver(interserver) |
| 3061 | cautcpd(cautcpd) |
| 3062 | ncacn-ip-tcp(ncacn-ip-tcp) |
| 3063 | ncadg-ip-udp(ncadg-ip-udp) |
| 3064 | Remote Port Redirector(rprt) |
| 3065 | slinterbase(slinterbase) |
| 3066 | NETATTACHSDMP(netattachsdmp) |
| 3067 | FJHPJP(fjhpjp) |
| 3068 | ls3 Broadcast(ls3bcast) |
| 3069 | ls3(ls3) |
| 3070 | MGXSWITCH(mgxswitch) |
| 3071 | ContinuStor Manager Port(csd-mgmt-port) |
| 3072 | ContinuStor Monitor Port(csd-monitor) |
| 3073 | Very simple chatroom prot(vcrp) |
| 3074 | Xbox game port(xbox) |
| 3075 | Orbix 2000 Locator(orbix-locator) |
| 3076 | Orbix 2000 Config(orbix-config) |
| 3077 | Orbix 2000 Locator SSL(orbix-loc-ssl) |
| 3078 | Orbix 2000 Locator SSL(orbix-cfg-ssl) |
| 3079 | LV Front Panel(lv-frontpanel) |
| 3080 | stm_pproc(stm_pproc) |
| 3081 | TL1-LV(tl1-lv) |
| 3082 | TL1-RAW(tl1-raw) |
| 3083 | TL1-TELNET(tl1-telnet) |
| 3084 | ITM-MCCS(itm-mccs) |
| 3085 | PCIHReq(pcihreq) |
| 3086 | JDL-DBKitchen(jdl-dbkitchen) |
| 3087 | Asoki SMA(asoki-sma) |
| 3088 | eXtensible Data Transfer Protocol(xdtp) |
| 3089 | ParaTek Agent Linking(ptk-alink) |
| 3090 | Senforce Session Services(stss) |
| 3091 | 1Ci Server Management(1ci-smcs) |
| 3092 | Netware sync services(njfss) |
| 3093 | Jiiva RapidMQ Center(rapidmq-center) |
| 3094 | Jiiva RapidMQ Registry(rapidmq-reg) |
| 3095 | Panasas rendevous port(panasas) |
| 3096 | Active Print Server Port(ndl-aps) |
| 3097 | /sctp ITU-T Q.1902.1/Q.2150.3(itu-bicc-stc) |
| 3098 | Universal Message Manager(umm-port) |
| 3099 | CHIPSY Machine Daemon(chmd) |
| 3100 | OpCon/xps(opcon-xps) |
| 3101 | HP PolicyXpert PIB Server(hp-pxpib) |
| 3102 | SoftlinK Slave Mon Port(slslavemon) |
| 3103 | Autocue SMI Protocol(autocuesmi) |
| 3104 | Autocue Logger Protocol(autocuelog) |
| 3105 | Cardbox(cardbox) |
| 3106 | Cardbox HTTP(cardbox-http) |
| 3107 | Business protocol(business) |
| 3108 | Geolocate protocol(geolocate) |
| 3109 | Personnel protocol(personnel) |
| 3110 | simulator control port(sim-control) |
| 3111 | Web Synchronous Services(wsynch) |
| 3112 | KDE System Guard(ksysguard) |
| 3113 | CS-Authenticate Svr Port(cs-auth-svr) |
| 3114 | CCM AutoDiscover(ccmad) |
| 3115 | MCTET Master(mctet-master) |
| 3116 | MCTET Gateway(mctet-gateway) |
| 3117 | MCTET Jserv(mctet-jserv) |
| 3118 | PKAgent(pkagent) |
| 3119 | D2000 Kernel Port(d2000kernel) |
| 3120 | D2000 Webserver Port(d2000webserver) |
| 3122 | MTI VTR Emulator port(vtr-emulator) |
| 3123 | EDI Translation Protocol(edix) |
| 3124 | Beacon Port(beacon-port) |
| 3125 | A13-AN Interface(a13-an) |
| 3126 | Microsoft .NETster Port(ms-dotnetster) |
| 3127 | CTX Bridge Port(ctx-bridge) |
| 3128 | Active API Server Port(ndl-aas) |
| 3129 | NetPort Discovery Port(netport-id) |
| 3130 | ICPv2(icpv2) |
| 3131 | Net Book Mark(netbookmark) |
| 3132 | Microsoft Business Rule Engine Update Service(ms-rule-engine) |
| 3133 | Prism Deploy User Port(prism-deploy) |
| 3134 | Extensible Code Protocol(ecp) |
| 3135 | PeerBook Port(peerbook-port) |
| 3136 | Grub Server Port(grubd) |
| 3137 | rtnt-1 data packets(rtnt-1) |
| 3138 | rtnt-2 data packets(rtnt-2) |
| 3139 | Incognito Rendez-Vous(incognitorv) |
| 3140 | Arilia Multiplexor(ariliamulti) |
| 3141 | VMODEM(vmodem) |
| 3142 | RDC WH EOS(rdc-wh-eos) |
| 3143 | Sea View(seaview) |
| 3144 | Tarantella(tarantella) |
| 3145 | CSI-LFAP(csi-lfap) |
| 3146 | bears-02(bears-02) |
| 3147 | RFIO(rfio) |
| 3148 | NetMike Game Administrator(nm-game-admin) |
| 3149 | NetMike Game Server(nm-game-server) |
| 3150 | NetMike Assessor Administrator(nm-asses-admin) |
| 3151 | NetMike Assessor(nm-assessor) |
| 3152 | FeiTian Port(feitianrockey) |
| 3153 | S8Cargo Client Port(s8-client-port) |
| 3154 | ON RMI Registry(ccmrmi) |
| 3155 | JpegMpeg Port(jpegmpeg) |
| 3156 | Indura Collector(indura) |
| 3157 | CCC Listener Port(e3consultants) |
| 3158 | SmashTV Protocol(stvp) |
| 3159 | NavegaWeb Tarification(navegaweb-port) |
| 3160 | TIP Application Server(tip-app-server) |
| 3161 | DOC1 License Manager(doc1lm) |
| 3162 | SFLM(sflm) |
| 3163 | RES-SAP(res-sap) |
| 3164 | IMPRS(imprs) |
| 3165 | Newgenpay Engine Service(newgenpay) |
| 3166 | Quest Repository(qrepos) |
| 3167 | Now Contact Public Server(nowcontact) |
| 3168 | Now Up-to-Date Public Server(poweronnud) |
| 3169 | SERVERVIEW-AS(serverview-as) |
| 3170 | SERVERVIEW-ASN(serverview-asn) |
| 3171 | SERVERVIEW-GF(serverview-gf) |
| 3172 | SERVERVIEW-RM(serverview-rm) |
| 3173 | SERVERVIEW-ICC(serverview-icc) |
| 3174 | ARMI Server(armi-server) |
| 3175 | T1_E1_Over_IP(t1-e1-over-ip) |
| 3176 | ARS Master(ars-master) |
| 3177 | Phonex Protocol(phonex-port) |
| 3178 | Radiance UltraEdge Port(radclientport) |
| 3179 | H2GF W.2m Handover prot.(h2gf-w-2m) |
| 3180 | Millicent Broker Server(mc-brk-srv) |
| 3181 | BMC Patrol Agent(bmcpatrolagent) |
| 3182 | BMC Patrol Rendezvous(bmcpatrolrnvu) |
| 3183 | COPS/TLS(cops-tls) |
| 3184 | ApogeeX Port(apogeex-port) |
| 3185 | SuSE Meta PPPD(smpppd) |
| 3186 | IIW Monitor User Port(iiw-port) |
| 3187 | Open Design Listen Port(odi-port) |
| 3188 | Broadcom Port(brcm-comm-port) |
| 3189 | Pinnacle Sys InfEx Port(pcle-infex) |
| 3190 | ConServR Proxy(csvr-proxy) |
| 3191 | ConServR SSL Proxy(csvr-sslproxy) |
| 3192 | FireMon Revision Control(firemonrcc) |
| 3193 | SpanDataPort(spandataport) |
| 3194 | Rockstorm MAG protocol(magbind) |
| 3195 | Network Control Unit(ncu-1) |
| 3196 | Network Control Unit(ncu-2) |
| 3197 | Embrace Device Protocol Server(embrace-dp-s) |
| 3198 | Embrace Device Protocol Client(embrace-dp-c) |
| 3199 | DMOD WorkSpace(dmod-workspace) |
| 3200 | Press-sense Tick Port(tick-port) |
| 3201 | CPQ-TaskSmart(cpq-tasksmart) |
| 3202 | IntraIntra(intraintra) |
| 3203 | Network Watcher Monitor(netwatcher-mon) |
| 3204 | Network Watcher DB Access(netwatcher-db) |
| 3205 | iSNS Server Port(isns) |
| 3206 | IronMail POP Proxy(ironmail) |
| 3207 | Veritas Authentication Port(vx-auth-port) |
| 3208 | PFU PR Callback(pfu-prcallback) |
| 3209 | HP OpenView Network Path Engine Server(netwkpathengine) |
| 3210 | Flamenco Networks Proxy(flamenco-proxy) |
| 3211 | Avocent Secure Management(avsecuremgmt) |
| 3212 | Survey Instrument(surveyinst) |
| 3213 | NEON 24X7 Mission Control(neon24x7) |
| 3214 | JMQ Daemon Port 1(jmq-daemon-1) |
| 3215 | JMQ Daemon Port 2(jmq-daemon-2) |
| 3216 | Ferrari electronic FOAM(ferrari-foam) |
| 3217 | Unified IP & Telecomm Env(unite) |
| 3218 | EMC SmartPackets(smartpackets) |
| 3219 | WMS Messenger(wms-messenger) |
| 3220 | XML NM over SSL(xnm-ssl) |
| 3221 | XML NM over TCP(xnm-clear-text) |
| 3222 | Gateway Load Balancing Pr(glbp) |
| 3223 | DIGIVOTE (R) Vote-Server(digivote) |
| 3224 | AES Discovery Port(aes-discovery) |
| 3225 | FCIP(fcip-port) |
| 3226 | ISI Industry Software IRP(isi-irp) |
| 3227 | DiamondWave NMS Server(dwnmshttp) |
| 3228 | DiamondWave MSG Server(dwmsgserver) |
| 3229 | Global CD Port(global-cd-port) |
| 3230 | Software Distributor Port(sftdst-port) |
| 3231 | Delta Solutions Direct(dsnl) |
| 3232 | MDT port(mdtp) |
| 3233 | WhiskerControl main port(whisker) |
| 3234 | Alchemy Server(alchemy) |
| 3235 | MDAP port(mdap-port) |
| 3236 | appareNet Test Server(apparenet-ts) |
| 3237 | appareNet Test Packet Sequencer(apparenet-tps) |
| 3238 | appareNet Analysis Server(apparenet-as) |
| 3239 | appareNet User Interface(apparenet-ui) |
| 3240 | Trio Motion Control Port(triomotion) |
| 3241 | SysOrb Monitoring Server(sysorb) |
| 3242 | Session Description ID(sdp-id-port) |
| 3243 | Timelot Port(timelot) |
| 3244 | OneSAF(onesaf) |
| 3245 | VIEO Fabric Executive(vieo-fe) |
| 3246 | DVT SYSTEM PORT(dvt-system) |
| 3247 | DVT DATA LINK(dvt-data) |
| 3248 | PROCOS LM(procos-lm) |
| 3249 | State Sync Protocol(ssp) |
| 3250 | HMS hicp port(hicp) |
| 3251 | Sys Scanner(sysscanner) |
| 3252 | DHE port(dhe) |
| 3253 | PDA Data(pda-data) |
| 3254 | PDA System(pda-sys) |
| 3255 | Semaphore Connection Port(semaphore) |
| 3256 | Compaq RPM Agent Port(cpqrpm-agent) |
| 3257 | Compaq RPM Server Port(cpqrpm-server) |
| 3258 | Ivecon Server Port(ivecon-port) |
| 3259 | Epson Network Common Devi(epncdp2) |
| 3260 | iSCSI port(iscsi-target) |
| 3261 | winShadow(winshadow) |
| 3262 | NECP(necp) |
| 3263 | E-Color Enterprise Imager(ecolor-imager) |
| 3264 | cc:mail/lotus(ccmail) |
| 3265 | Altav Tunnel(altav-tunnel) |
| 3266 | NS CFG Server(ns-cfg-server) |
| 3267 | IBM Dial Out(ibm-dial-out) |
| 3268 | Microsoft Global Catalog(msft-gc) |
| 3269 | Microsoft Global Catalog with LDAP/SSL(msft-gc-ssl) |
| 3270 | Verismart(verismart) |
| 3271 | CSoft Prev Port(csoft-prev) |
| 3272 | Fujitsu User Manager(user-manager) |
| 3273 | Simple Extensible Multiplexed Protocol(sxmp) |
| 3274 | Ordinox Server(ordinox-server) |
| 3275 | SAMD(samd) |
| 3276 | Maxim ASICs(maxim-asics) |
| 3277 | AWG Proxy(awg-proxy) |
| 3278 | LKCM Server(lkcmserver) |
| 3279 | admind(admind) |
| 3280 | VS Server(vs-server) |
| 3281 | SYSOPT(sysopt) |
| 3282 | Datusorb(datusorb) |
| 3283 | Net Assistant(net-assistant) |
| 3284 | 4Talk(4talk) |
| 3285 | Plato(plato) |
| 3286 | E-Net(e-net) |
| 3287 | DIRECTVDATA(directvdata) |
| 3288 | COPS(cops) |
| 3289 | ENPC(enpc) |
| 3290 | CAPS LOGISTICS TOOLKIT - LM(caps-lm) |
| 3291 | S A Holditch & Associates - LM(sah-lm) |
| 3292 | Cart O Rama(cart-o-rama) |
| 3293 | fg-fps(fg-fps) |
| 3294 | fg-gip(fg-gip) |
| 3295 | Dynamic IP Lookup(dyniplookup) |
| 3296 | Rib License Manager(rib-slm) |
| 3297 | Cytel License Manager(cytel-lm) |
| 3298 | DeskView(deskview) |
| 3299 | pdrncs(pdrncs) |
| 3302 | MCS Fastmail(mcs-fastmail) |
| 3303 | OP Session Client(opsession-clnt) |
| 3304 | OP Session Server(opsession-srvr) |
| 3305 | ODETTE-FTP(odette-ftp) |
| 3306 | MySQL(mysql) |
| 3307 | OP Session Proxy(opsession-prxy) |
| 3308 | TNS Server(tns-server) |
| 3309 | TNS ADV(tns-adv) |
| 3310 | Dyna Access(dyna-access) |
| 3311 | MCNS Tel Ret(mcns-tel-ret) |
| 3312 | Application Management Server(appman-server) |
| 3313 | Unify Object Broker(uorb) |
| 3314 | Unify Object Host(uohost) |
| 3315 | CDID(cdid) |
| 3316 | AICC/CMI(aicc-cmi) |
| 3317 | VSAI PORT(vsaiport) |
| 3318 | Swith to Swith Routing Information Protocol(ssrip) |
| 3319 | SDT License Manager(sdt-lmd) |
| 3320 | Office Link 2000(officelink2000) |
| 3321 | VNSSTR(vnsstr) |
| 3322 | |
| 3326 | SFTU(sftu) |
| 3327 | BBARS(bbars) |
| 3328 | Eaglepoint License Manager(egptlm) |
| 3329 | HP Device Disc(hp-device-disc) |
| 3330 | MCS Calypso ICF(mcs-calypsoicf) |
| 3331 | MCS Messaging(mcs-messaging) |
| 3332 | MCS Mail Server(mcs-mailsvr) |
| 3333 | DEC Notes(dec-notes) |
| 3334 | Direct TV Webcasting(directv-web) |
| 3335 | Direct TV Software Updates(directv-soft) |
| 3336 | Direct TV Tickers(directv-tick) |
| 3337 | Direct TV Data Catalog(directv-catlg) |
| 3338 | OMF data b(anet-b) |
| 3339 | OMF data l(anet-l) |
| 3340 | OMF data m(anet-m) |
| 3341 | OMF data h(anet-h) |
| 3342 | WebTIE(webtie) |
| 3343 | MS Cluster Net(ms-cluster-net) |
| 3344 | BNT Manager(bnt-manager) |
| 3345 | Influence(influence) |
| 3346 | Trnsprnt Proxy(trnsprntproxy) |
| 3347 | Phoenix RPC(phoenix-rpc) |
| 3348 | Pangolin Laser(pangolin-laser) |
| 3349 | Chevin Services(chevinservices) |
| 3350 | FINDVIATV(findviatv) |
| 3351 | Btrieve port(btrieve) |
| 3352 | Scalable SQL(ssql) |
| 3353 | FATPIPE(fatpipe) |
| 3354 | SUITJD(suitjd) |
| 3355 | Ordinox Dbase(ordinox-dbase) |
| 3356 | UPNOTIFYPS(upnotifyps) |
| 3357 | Adtech Test IP(adtech-test) |
| 3358 | Mp Sys Rmsvr(mpsysrmsvr) |
| 3359 | WG NetForce(wg-netforce) |
| 3360 | KV Server(kv-server) |
| 3361 | KV Agent(kv-agent) |
| 3362 | DJ ILM(dj-ilm) |
| 3363 | NATI Vi Server(nati-vi-server) |
| 3364 | Creative Server(creativeserver) |
| 3365 | Content Server(contentserver) |
| 3366 | Creative Partner(creativepartnr) |
| 3367 | |
| 3372 | TIP 2(tip2) |
| 3373 | Lavenir License Manager(lavenir-lm) |
| 3374 | Cluster Disc(cluster-disc) |
| 3375 | VSNM Agent(vsnm-agent) |
| 3376 | CD Broker(cdbroker) |
| 3377 | Cogsys Network License Manager(cogsys-lm) |
| 3378 | WSICOPY(wsicopy) |
| 3379 | SOCORFS(socorfs) |
| 3380 | SNS Channels(sns-channels) |
| 3381 | Geneous(geneous) |
| 3382 | Fujitsu Network Enhanced Antitheft function(fujitsu-neat) |
| 3383 | Enterprise Software Products License Manager(esp-lm) |
| 3384 | Cluster Management Services(hp-clic) |
| 3385 | qnxnetman(qnxnetman) |
| 3386 | GPRS Data(gprs-data) |
| 3387 | Back Room Net(backroomnet) |
| 3388 | CB Server(cbserver) |
| 3389 | MS WBT Server(ms-wbt-server) |
| 3390 | Distributed Service Coordinator(dsc) |
| 3391 | SAVANT(savant) |
| 3392 | EFI License Management(efi-lm) |
| 3393 | D2K Tapestry Client to Server(d2k-tapestry1) |
| 3394 | D2K Tapestry Server to Server(d2k-tapestry2) |
| 3395 | Dyna License Manager (Elam)(dyna-lm) |
| 3396 | Printer Agent(printer_agent) |
| 3397 | Cloanto License Manager(cloanto-lm) |
| 3398 | Mercantile(mercantile) |
| 3399 | CSMS(csms) |
| 3400 | CSMS2(csms2) |
| 3401 | filecast(filecast) |
| 3402 | FXa Engine Network Port(fxaengine-net) |
| 3405 | Nokia Announcement ch 1(nokia-ann-ch1) |
| 3406 | Nokia Announcement ch 2(nokia-ann-ch2) |
| 3407 | LDAP admin server port(ldap-admin) |
| 3408 | POWERpack API Port(issapi) |
| 3409 | NetworkLens Event Port(networklens) |
| 3410 | NetworkLens SSL Event(networklenss) |
| 3411 | BioLink Authenteon server(biolink-auth) |
| 3412 | xmlBlaster(xmlblaster) |
| 3413 | SpecView Networking(svnet) |
| 3414 | BroadCloud WIP Port(wip-port) |
| 3415 | BCI Name Service(bcinameservice) |
| 3416 | AirMobile IS Command Port(commandport) |
| 3417 | ConServR file translation(csvr) |
| 3418 | Remote nmap(rnmap) |
| 3419 | Isogon SoftAudit(softaudit) |
| 3420 | iFCP User Port(ifcp-port) |
| 3421 | Bull Apprise portmapper(bmap) |
| 3422 | Remote USB System Port(rusb-sys-port) |
| 3423 | xTrade Reliable Messaging(xtrm) |
| 3424 | xTrade over TLS/SSL(xtrms) |
| 3425 | AGPS Access Port(agps-port) |
| 3426 | Arkivio Storage Protocol(arkivio) |
| 3427 | WebSphere SNMP(websphere-snmp) |
| 3428 | 2Wire CSS(twcss) |
| 3429 | GCSP user port(gcsp) |
| 3430 | Scott Studios Dispatch(ssdispatch) |
| 3431 | Active License Server Port(ndl-als) |
| 3432 | Secure Device Protocol(osdcp) |
| 3433 | Altaworks Service Management Platform(alta-smp) |
| 3434 | OpenCM Server(opencm) |
| 3435 | Pacom Security User Port(pacom) |
| 3436 | GuardControl Exchange Protocol(gc-config) |
| 3437 | Autocue Directory Service(autocueds) |
| 3438 | Spiralcraft Admin(spiral-admin) |
| 3439 | HRI Interface Port(hri-port) |
| 3440 | Net Steward Mgmt Console(ans-console) |
| 3441 | OC Connect Client(connect-client) |
| 3442 | OC Connect Server(connect-server) |
| 3443 | OpenView Network Node Manager WEB Server(ov-nnm-websrv) |
| 3444 | Denali Server(denali-server) |
| 3445 | Media Object Network(monp) |
| 3446 | 3Com FAX RPC port(3comfaxrpc) |
| 3447 | DirectNet IM System(directnet) |
| 3448 | Discovery and Net Config(dnc-port) |
| 3449 | HotU Chat(hotu-chat) |
| 3450 | CAStorProxy(castorproxy) |
| 3451 | ASAM Services(asam) |
| 3452 | SABP-Signalling Protocol(sabp-signal) |
| 3453 | PSC Update Port(pscupd) |
| 3454 | Apple Remote Access Protocol(mira) |
| 3455 | RSVP Port(prsvp) |
| 3456 | VAT default data(vat) |
| 3457 | VAT default control(vat-control) |
| 3458 | D3WinOSFI(d3winosfi) |
| 3459 | TIP Integral(integral) |
| 3460 | EDM Manger(edm-manager) |
| 3461 | EDM Stager(edm-stager) |
| 3462 | EDM STD Notify(edm-std-notify) |
| 3463 | EDM ADM Notify(edm-adm-notify) |
| 3464 | EDM MGR Sync(edm-mgr-sync) |
| 3465 | EDM MGR Cntrl(edm-mgr-cntrl) |
| 3466 | WORKFLOW(workflow) |
| 3467 | RCST(rcst) |
| 3468 | TTCM Remote Controll(ttcmremotectrl) |
| 3469 | Pluribus(pluribus) |
| 3470 | jt400(jt400) |
| 3471 | jt400-ssl(jt400-ssl) |
| 3472 | JAUGS N-G Remotec 1(jaugsremotec-1) |
| 3473 | JAUGS N-G Remotec 2(jaugsremotec-2) |
| 3474 | TSP Automation(ttntspauto) |
| 3475 | Genisar Comm Port(genisar-port) |
| 3476 | NVIDIA Mgmt Protocol(nppmp) |
| 3477 | eComm link port(ecomm) |
| 3478 | Simple Traversal of UDP Through NAT (STUN) port(nat-stun-port) |
| 3479 | 2Wire RPC(twrpc) |
| 3480 | Secure Virtual Workspace(plethora) |
| 3481 | CleanerLive remote ctrl(cleanerliverc) |
| 3482 | Vulture Monitoring System(vulture) |
| 3483 | Slim Devices Protocol(slim-devices) |
| 3484 | GBS SnapTalk Protocol(gbs-stp) |
| 3485 | CelaTalk(celatalk) |
| 3486 | IFSF Heartbeat Port(ifsf-hb-port) |
| 3487 | LISA TCP Transfer Channel(ltctcp) |
| 3488 | FS Remote Host Server(fs-rh-srv) |
| 3489 | DTP/DIA(dtp-dia) |
| 3490 | Colubris Management Port(colubris) |
| 3491 | SWR Port(swr-port) |
| 3492 | TVDUM Tray Port(tvdumtray-port) |
| 3493 | Network UPS Tools(nut) |
| 3494 | IBM 3494(ibm3494) |
| 3495 | securitylayer over tcp(seclayer-tcp) |
| 3496 | securitylayer over tls(seclayer-tls) |
| 3497 | ipEther232Port(ipether232port) |
| 3498 | DASHPAS user port(dashpas-port) |
| 3499 | SccIP Media(sccip-media) |
| 3500 | RTMP Port(rtmp-port) |
| 3501 | iSoft-P2P(isoft-p2p) |
| 3502 | Avocent Install Discovery(avinstalldisc) |
| 3503 | MPLS LSP-echo Port(lsp-ping) |
| 3504 | IronStorm game server(ironstorm) |
| 3505 | CCM communications port(ccmcomm) |
| 3506 | APC 3506(apc-3506) |
| 3507 | Nesh Broker Port(nesh-broker) |
| 3508 | Interaction Web(interactionweb) |
| 3509 | Virtual Token SSL Port(vt-ssl) |
| 3510 | XSS Port(xss-port) |
| 3511 | WebMail/2(webmail-2) |
| 3512 | Aztec Distribution Port(aztec) |
| 3513 | Adaptec Remote Protocol(arcpd) |
| 3514 | MUST Peer to Peer(must-p2p) |
| 3515 | MUST Backplane(must-backplane) |
| 3516 | Smartcard Port(smartcard-port) |
| 3517 | IEEE 802.11 WLANs WG IAPP(802-11-iapp) |
| 3518 | Artifact Message Server(artifact-msg) |
| 3519 | Netvion Messenger Port(nvmsgd) |
| 3520 | Netvion Galileo Log Port(galileolog) |
| 3521 | Telequip Labs MC3SS(mc3ss) |
| 3522 | DO over NSSocketPort(nssocketport) |
| 3523 | Odeum Serverlink(odeumservlink) |
| 3524 | ECM Server port(ecmport) |
| 3525 | EIS Server port(eisport) |
| 3526 | starQuiz Port(starquiz-port) |
| 3527 | VERITAS Backup Exec Server(beserver-msg-q) |
| 3528 | JBoss IIOP(jboss-iiop) |
| 3529 | JBoss IIOP/SSL(jboss-iiop-ssl) |
| 3530 | Grid Friendly(gf) |
| 3531 | Joltid(joltid) |
| 3532 | Raven Remote Management Control(raven-rmp) |
| 3533 | Raven Remote Management Data(raven-rdp) |
| 3534 | URL Daemon Port(urld-port) |
| 3535 | MS-LA(ms-la) |
| 3536 | SNAC(snac) |
| 3537 | Remote NI-VISA port(ni-visa-remote) |
| 3538 | IBM Directory Server(ibm-diradm) |
| 3539 | IBM Directory Server SSL(ibm-diradm-ssl) |
| 3540 | PNRP User Port(pnrp-port) |
| 3541 | VoiSpeed Port(voispeed-port) |
| 3542 | HA cluster monitor(hacl-monitor) |
| 3543 | qftest Lookup Port(qftest-lookup) |
| 3544 | Teredo Port(teredo) |
| 3545 | CAMAC equipment(camac) |
| 3547 | Symantec SIM(symantec-sim) |
| 3548 | Interworld(interworld) |
| 3549 | Tellumat MDR NMS(tellumat-nms) |
| 3550 | Secure SMPP(ssmpp) |
| 3551 | Apcupsd Information Port(apcupsd) |
| 3552 | TeamAgenda Server Port(taserver) |
| 3553 | Red Box Recorder ADP(rbr-discovery) |
| 3554 | Quest Notification Server(questnotify) |
| 3555 | Vipul's Razor(razor) |
| 3556 | Sky Transport Protocol(sky-transport) |
| 3557 | PersonalOS Comm Port(personalos-001) |
| 3558 | MCP user port(mcp-port) |
| 3559 | CCTV control port(cctv-port) |
| 3560 | INIServe port(iniserve-port) |
| 3561 | BMC-OneKey(bmc-onekey) |
| 3562 | SDBProxy(sdbproxy) |
| 3563 | Watcom Debug(watcomdebug) |
| 3564 | Electromed SIM port(esimport) |
| 3565 | M2PA(m2pa) |
| 3565 | /sctp M2PA(m2pa) |
| 3566 | Quest Agent Manager(quest-launcher) |
| 3567 | Object Access Protocol(oap) |
| 3568 | Object Access Protocol over SSL(oap-s) |
| 3569 | Meinberg Control Service(mbg-ctrl) |
| 3570 | MCC Web Server Port(mccwebsvr-port) |
| 3571 | MegaRAID Server Port(megardsvr-port) |
| 3572 | Registration Server Port(megaregsvrport) |
| 3573 | Advantage Group UPS Suite(tag-ups-1) |
| 3574 | DMAF Server(dmaf-server) |
| 3575 | Coalsere CCM Port(ccm-port) |
| 3576 | Coalsere CMC Port(cmc-port) |
| 3577 | Configuration Port(config-port) |
| 3578 | Data Port(data-port) |
| 3579 | Tarantella Load Balancing(ttat3lb) |
| 3580 | NATI-ServiceLocator(nati-svrloc) |
| 3581 | Ascent Capture Licensing(kfxaclicensing) |
| 3582 | PEG PRESS Server(press) |
| 3583 | CANEX Watch System(canex-watch) |
| 3584 | U-DBase Access Protocol(u-dbap) |
| 3585 | Emprise License Server(emprise-lls) |
| 3586 | License Server Console(emprise-lsc) |
| 3587 | Peer to Peer Grouping(p2pgroup) |
| 3588 | Sentinel Server(sentinel) |
| 3589 | isomair(isomair) |
| 3590 | WV CSP SMS Binding(wv-csp-sms) |
| 3591 | LOCANIS G-TRACK Server(gtrack-server) |
| 3592 | LOCANIS G-TRACK NE Port(gtrack-ne) |
| 3593 | BP Model Debugger(bpmd) |
| 3594 | MediaSpace(mediaspace) |
| 3595 | ShareApp(shareapp) |
| 3596 | Illusion Wireless MMOG(iw-mmogame) |
| 3597 | A14 (AN-to-SC/MM)(a14) |
| 3598 | A15 (AN-to-AN)(a15) |
| 3599 | Quasar Accounting Server(quasar-server) |
| 3600 | text relay-answer(trap-daemon) |
| 3601 | Visinet Gui(visinet-gui) |
| 3602 | InfiniSwitch Mgr Client(infiniswitchcl) |
| 3603 | Integrated Rcvr Control(int-rcv-cntrl) |
| 3604 | BMC JMX Port(bmc-jmx-port) |
| 3605 | ComCam IO Port(comcam-io) |
| 3606 | Splitlock Server(splitlock) |
| 3607 | Precise I3(precise-i3) |
| 3608 | Trendchip control protocol(trendchip-dcp) |
| 3609 | CPDI PIDAS Connection Mon(cpdi-pidas-cm) |
| 3610 | ECHONET(echonet) |
| 3611 | Six Degrees Port(six-degrees) |
| 3612 | HP Data Protector(hp-dataprotect) |
| 3613 | Alaris Device Discovery(alaris-disc) |
| 3614 | Invensys Sigma Port(sigma-port) |
| 3615 | Start Messaging Network(start-network) |
| 3616 | cd3o Control Protocol(cd3o-protocol) |
| 3617 | ATI SHARP Logic Engine(sharp-server) |
| 3618 | AAIR-Network 1(aairnet-1) |
| 3619 | AAIR-Network 2(aairnet-2) |
| 3620 | EPSON Projector Control Port(ep-pcp) |
| 3621 | EPSON Network Screen Port(ep-nsp) |
| 3622 | FF LAN Redundancy Port(ff-lr-port) |
| 3623 | HAIPIS Dynamic Discovery(haipe-discover) |
| 3624 | Distributed Upgrade Port(dist-upgrade) |
| 3625 | Volley(volley) |
| 3626 | bvControl Daemon(bvcdaemon-port) |
| 3627 | Jam Server Port(jamserverport) |
| 3628 | EPT Machine Interface(ept-machine) |
| 3629 | ESC/VP.net(escvpnet) |
| 3630 | C&S Remote Database Port(cs-remote-db) |
| 3631 | C&S Web Services Port(cs-services) |
| 3632 | distributed compiler(distcc) |
| 3633 | Wyrnix AIS port(wacp) |
| 3634 | hNTSP Library Manager(hlibmgr) |
| 3635 | Simple Distributed Objects(sdo) |
| 3636 | SerVistaITSM(servistaitsm) |
| 3637 | Customer Service Port(scservp) |
| 3638 | EHP Backup Protocol(ehp-backup) |
| 3639 | Extensible Automation(xap-ha) |
| 3640 | Netplay Port 1(netplay-port1) |
| 3641 | Netplay Port 2(netplay-port2) |
| 3642 | Juxml Replication port(juxml-port) |
| 3643 | AudioJuggler(audiojuggler) |
| 3644 | ssowatch(ssowatch) |
| 3645 | Cyc(cyc) |
| 3646 | XSS Server Port(xss-srv-port) |
| 3647 | Splitlock Gateway(splitlock-gw) |
| 3648 | Fujitsu Cooperation Port(fjcp) |
| 3649 | Nishioka Miyuki Msg Protocol(nmmp) |
| 3650 | PRISMIQ VOD plug-in(prismiq-plugin) |
| 3651 | XRPC Registry(xrpc-registry) |
| 3652 | VxCR NBU Default Port(vxcrnbuport) |
| 3653 | Tunnel Setup Protocol(tsp) |
| 3654 | VAP RealTime Messenger(vaprtm) |
| 3655 | ActiveBatch Exec Agent(abatemgr) |
| 3656 | ActiveBatch Job Scheduler(abatjss) |
| 3657 | ImmediaNet Beacon(immedianet-bcn) |
| 3658 | PlayStation AMS (Secure)(ps-ams) |
| 3659 | Apple SASL(apple-sasl) |
| 3660 | IBM Tivoli Directory Service using SSL(can-nds-ssl) |
| 3661 | IBM Tivoli Directory Service using SSL(can-ferret-ssl) |
| 3662 | pserver(pserver) |
| 3663 | DIRECWAY Tunnel Protocol(dtp) |
| 3664 | UPS Engine Port(ups-engine) |
| 3665 | Enterprise Engine Port(ent-engine) |
| 3666 | IBM eServer PAP(eserver-pap) |
| 3667 | IBM Information Exchange(infoexch) |
| 3668 | Dell Remote Management(dell-rm-port) |
| 3669 | CA SAN Switch Management(casanswmgmt) |
| 3670 | SMILE TCP/UDP Interface(smile) |
| 3671 | e Field Control (EIBnet)(efcp) |
| 3672 | LispWorks ORB(lispworks-orb) |
| 3673 | Openview Media Vault GUI(mediavault-gui) |
| 3674 | WinINSTALL IPC Port(wininstall-ipc) |
| 3675 | CallTrax Data Port(calltrax) |
| 3676 | VisualAge Pacbase server(va-pacbase) |
| 3677 | RoverLog IPC(roverlog) |
| 3678 | DataGuardianLT(ipr-dglt) |
| 3679 | Newton Dock(newton-dock) |
| 3680 | NPDS Tracker(npds-tracker) |
| 3681 | BTS X73 Port(bts-x73) |
| 3682 | EMC SmartPackets-MAPI(cas-mapi) |
| 3683 | BMC EDV/EA(bmc-ea) |
| 3684 | FAXstfX(faxstfx-port) |
| 3685 | DS Expert Agent(dsx-agent) |
| 3686 | Trivial Network Management(tnmpv2) |
| 3687 | simple-push(simple-push) |
| 3688 | simple-push Secure(simple-push-s) |
| 3689 | Digital Audio Access Protocol(daap) |
| 3690 | Subversion(svn) |
| 3691 | Magaya Network Port(magaya-network) |
| 3692 | Brimstone IntelSync(intelsync) |
| 3693 | GTTP(gttp) |
| 3694 | VPN Token Propagation Protocol(vpntpp) |
| 3695 | BMC Data Collection(bmc-data-coll) |
| 3696 | Telnet Com Port Control(telnetcpcd) |
| 3697 | NavisWorks License System(nw-license) |
| 3698 | SAGECTLPANEL(sagectlpanel) |
| 3699 | Internet Call Waiting(kpn-icw) |
| 3700 | LRS NetPage(lrs-paging) |
| 3701 | NetCelera(netcelera) |
| 3702 | Web Service Discovery(ws-discovery) |
| 3703 | Adobe Server 3(adobeserver-3) |
| 3704 | Adobe Server 4(adobeserver-4) |
| 3705 | Adobe Server 5(adobeserver-5) |
| 3706 | Real-Time Event Port(rt-event) |
| 3707 | Real-Time Event Secure Port(rt-event-s) |
| 3708 | Sun App Svr - Naming(sun-as-iiops) |
| 3709 | CA-IDMS Server(ca-idms) |
| 3710 | PortGate Authentication(portgate-auth) |
| 3711 | EBD Server 2(edb-server2) |
| 3712 | Sentinel Enterprise(sentinel-ent) |
| 3713 | TFTP over TLS(tftps) |
| 3714 | DELOS Direct Messaging(delos-dms) |
| 3715 | Anoto Rendezvous Port(anoto-rendezv) |
| 3716 | WV CSP SMS CIR Channel(wv-csp-sms-cir) |
| 3717 | WV CSP UDP/IP CIR Channel(wv-csp-udp-cir) |
| 3718 | OPUS Server Port(opus-services) |
| 3719 | iTel Server Port(itelserverport) |
| 3720 | UF Astro. Instr. Services(ufastro-instr) |
| 3721 | Xsync(xsync) |
| 3722 | Xserve RAID(xserveraid) |
| 3723 | Sychron Service Daemon(sychrond) |
| 3724 | World of Warcraft(blizwow) |
| 3725 | Netia NA-ER Port(na-er-tip) |
| 3726 | Xyratex Array Manager(array-manager) |
| 3727 | Ericsson Mobile Data Unit(e-mdu) |
| 3728 | Ericsson Web on Air(e-woa) |
| 3729 | Fireking Audit Port(fksp-audit) |
| 3730 | Client Control(client-ctrl) |
| 3731 | Service Manager(smap) |
| 3732 | Mobile Wnn(m-wnn) |
| 3733 | Multipuesto Msg Port(multip-msg) |
| 3734 | Synel Data Collection Port(synel-data) |
| 3735 | Password Distribution(pwdis) |
| 3736 | RealSpace RMI(rs-rmi) |
| 3738 | versaTalk Server Port(versatalk) |
| 3739 | Launchbird LicenseManager(launchbird-lm) |
| 3740 | Heartbeat Protocol(heartbeat) |
| 3741 | WysDM Agent(wysdma) |
| 3742 | CST - Configuration & Service Tracker(cst-port) |
| 3743 | IP Control Systems Ltd.(ipcs-command) |
| 3744 | SASG(sasg) |
| 3745 | GWRTC Call Port(gw-call-port) |
| 3746 | LXPRO.COM LinkTest(linktest) |
| 3747 | LXPRO.COM LinkTest SSL(linktest-s) |
| 3748 | webData(webdata) |
| 3749 | CimTrak(cimtrak) |
| 3750 | CBOS/IP ncapsalation port(cbos-ip-port) |
| 3751 | CommLinx GPRS Cube(gprs-cube) |
| 3752 | Vigil-IP RemoteAgent(vipremoteagent) |
| 3753 | NattyServer Port(nattyserver) |
| 3754 | TimesTen Broker Port(timestenbroker) |
| 3755 | SAS Remote Help Server(sas-remote-hlp) |
| 3756 | Canon CAPT Port(canon-capt) |
| 3757 | GRF Server Port(grf-port) |
| 3758 | apw RMI registry(apw-registry) |
| 3759 | Exapt License Manager(exapt-lmgr) |
| 3760 | adTempus Client(adtempusclient) |
| 3761 | gsakmp port(gsakmp) |
| 3762 | GBS SnapMail Protocol(gbs-smp) |
| 3763 | XO Wave Control Port(xo-wave) |
| 3764 | MNI Protected Routing(mni-prot-rout) |
| 3765 | Remote Traceroute(rtraceroute) |
| 3767 | ListMGR Port(listmgr-port) |
| 3768 | rblcheckd server daemon(rblcheckd) |
| 3769 | HAIPE Network Keying(haipe-otnk) |
| 3770 | Cinderella Collaboration(cindycollab) |
| 3771 | RTP Paging Port(paging-port) |
| 3772 | Chantry Tunnel Protocol(ctp) |
| 3773 | ctdhercules(ctdhercules) |
| 3774 | ZICOM(zicom) |
| 3775 | ISPM Manager Port(ispmmgr) |
| 3776 | Device Provisioning Port(dvcprov-port) |
| 3777 | Jibe EdgeBurst(jibe-eb) |
| 3778 | Cutler-Hammer IT Port(c-h-it-port) |
| 3779 | Cognima Replication(cognima) |
| 3780 | Nuzzler Network Protocol(nnp) |
| 3781 | ABCvoice server port(abcvoice-port) |
| 3782 | Secure ISO TP0 port(iso-tp0s) |
| 3783 | Impact Mgr./PEM Gateway(bim-pem) |
| 3784 | BFD Control Protocol(bfd-control) |
| 3785 | BFD Echo Protocol(bfd-echo) |
| 3786 | VSW Upstrigger port(upstriggervsw) |
| 3787 | Fintrx(fintrx) |
| 3788 | SPACEWAY Routing port(isrp-port) |
| 3789 | RemoteDeploy Administration Port(remotedeploy) |
| 3790 | QuickBooks RDS(quickbooksrds) |
| 3791 | TV NetworkVideo Data port(tvnetworkvideo) |
| 3792 | e-Watch Corporation SiteWatch(sitewatch) |
| 3793 | DataCore Software(dcsoftware) |
| 3794 | JAUS Robots(jaus) |
| 3795 | myBLAST Mekentosj port(myblast) |
| 3796 | Spaceway Dialer(spw-dialer) |
| 3797 | idps(idps) |
| 3798 | Minilock(minilock) |
| 3799 | RADIUS Dynamic Authorization(radius-dynauth) |
| 3800 | Print Services Interface(pwgpsi) |
| 3801 | ibm manager service(ibm-mgr) |
| 3802 | VHD(vhd) |
| 3803 | SoniqSync(soniqsync) |
| 3804 | Harman IQNet Port(iqnet-port) |
| 3805 | ThorGuard Server Port(tcpdataserver) |
| 3806 | Remote System Manager(wsmlb) |
| 3807 | SpuGNA Communication Port(spugna) |
| 3808 | Sun App Svr-IIOPClntAuth(sun-as-iiops-ca) |
| 3809 | Java Desktop System Configuration Agent(apocd) |
| 3810 | WLAN AS server(wlanauth) |
| 3811 | AMP(amp) |
| 3812 | netO WOL Server(neto-wol-server) |
| 3813 | Rhapsody Interface Protocol(rap-ip) |
| 3814 | netO DCS(neto-dcs) |
| 3815 | LANsurveyor XML(lansurveyorxml) |
| 3816 | Sun Local Patch Server(sunlps-http) |
| 3817 | Yosemite Tech Tapeware(tapeware) |
| 3818 | Crinis Heartbeat(crinis-hb) |
| 3819 | EPL Sequ Layer Protocol(epl-slp) |
| 3820 | Siemens AuD SCP(scp) |
| 3821 | ATSC PMCP Standard(pmcp) |
| 3822 | Compute Pool Discovery(acp-discovery) |
| 3823 | Compute Pool Conduit(acp-conduit) |
| 3824 | Compute Pool Policy(acp-policy) |
| 3831 | Docsvault Application Service(dvapps) |
| 3832 | xxNETserver(xxnetserver) |
| 3833 | AIPN LS Authentication(aipn-auth) |
| 3834 | Spectar Data Stream Service(spectardata) |
| 3835 | Spectar Database Rights Service(spectardb) |
| 3836 | MARKEM NEXTGEN DCP(markem-dcp) |
| 3837 | MARKEM Auto-Discovery(mkm-discovery) |
| 3838 | Scito Object Server(sos) |
| 3839 | AMX Resource Management Suite(amx-rms) |
| 3840 | www.FlirtMitMir.de(flirtmitmir) |
| 3841 | Z-Firm ShipRush v3(zfirm-shiprush3) |
| 3842 | NHCI status port(nhci) |
| 3843 | Quest Common Agent(quest-agent) |
| 3844 | RNM(rnm) |
| 3845 | V-ONE Single Port Proxy(v-one-spp) |
| 3846 | Astare Network PCP(an-pcp) |
| 3847 | MS Firewall Control(msfw-control) |
| 3848 | IT Environmental Monitor(item) |
| 3849 | SPACEWAY DNS Preload(spw-dnspreload) |
| 3850 | QTMS Bootstrap Protocol(qtms-bootstrap) |
| 3851 | SpectraTalk Port(spectraport) |
| 3852 | SSE App Configuration(sse-app-config) |
| 3853 | SONY scanning protocol(sscan) |
| 3854 | Stryker Comm Port(stryker-com) |
| 3855 | OpenTRAC(opentrac) |
| 3856 | INFORMER(informer) |
| 3857 | Trap Port(trap-port) |
| 3858 | Trap Port MOM(trap-port-mom) |
| 3859 | Navini Port(nav-port) |
| 3860 | Server/Application State Protocol (SASP)(sasp) |
| 3861 | winShadow Host Discovery(winshadow-hd) |
| 3862 | GIGA-POCKET(giga-pocket) |
| 3863 | asap tcp port(asap-tcp) |
| 3863 | /sctp asap sctp(asap-sctp) |
| 3864 | asap/tls tcp port(asap-tcp-tls) |
| 3864 | /sctp asap-sctp/tls(asap-sctp-tls) |
| 3865 | xpl automation protocol(xpl) |
| 3866 | Sun SDViz DZDAEMON Port(dzdaemon) |
| 3867 | Sun SDViz DZOGLSERVER Port(dzoglserver) |
| 3868 | DIAMETER(diameter) |
| 3868 | /sctp DIAMETER(diameter) |
| 3869 | hp OVSAM MgmtServer Disco(ovsam-mgmt) |
| 3870 | hp OVSAM HostAgent Disco(ovsam-d-agent) |
| 3871 | Avocent DS Authorization(avocent-adsap) |
| 3872 | OEM Agent(oem-agent) |
| 3873 | fagordnc(fagordnc) |
| 3874 | SixXS Configuration(sixxsconfig) |
| 3875 | PNBSCADA(pnbscada) |
| 3876 | DirectoryLockdown Agent(dl_agent) |
| 3877 | XMPCR Interface Port(xmpcr-interface) |
| 3878 | FotoG CAD interface(fotogcad) |
| 3879 | appss license manager(appss-lm) |
| 3880 | IGRS(igrs) |
| 3881 | Data Acquisition and Control(idac) |
| 3882 | DTS Service Port(msdts1) |
| 3883 | VR Peripheral Network(vrpn) |
| 3884 | SofTrack Metering(softrack-meter) |
| 3885 | TopFlow SSL(topflow-ssl) |
| 3886 | NEI management port(nei-management) |
| 3887 | Ciphire Data Transport(ciphire-data) |
| 3888 | Ciphire Services(ciphire-serv) |
| 3889 | D and V Tester Control Port(dandv-tester) |
| 3890 | Niche Data Server Connect(ndsconnect) |
| 3891 | Oracle RTC-PM port(rtc-pm-port) |
| 3892 | PCC-image-port(pcc-image-port) |
| 3893 | CGI StarAPI Server(cgi-starapi) |
| 3894 | SyAM Agent Port(syam-agent) |
| 3895 | SyAm SMC Service Port(syam-smc) |
| 3896 | Simple Distributed Objects over TLS(sdo-tls) |
| 3897 | Simple Distributed Objects over SSH(sdo-ssh) |
| 3898 | IAS, Inc. SmartEye NET Internet Protocol(senip) |
| 3899 | ITV Port(itv-control) |
| 3900 | Unidata UDT OS(udt_os) |
| 3901 | NIM Service Handler(nimsh) |
| 3902 | NIMsh Auxiliary Port(nimaux) |
| 3903 | CharsetMGR(charsetmgr) |
| 3904 | Arnet Omnilink Port(omnilink-port) |
| 3905 | Mailbox Update (MUPDATE) protocol(mupdate) |
| 3906 | TopoVista elevation data(topovista-data) |
| 3907 | Imoguia Port(imoguia-port) |
| 3908 | HP Procurve NetManagement(hppronetman) |
| 3909 | SurfControl CPA(surfcontrolcpa) |
| 3910 | Printer Request Port(prnrequest) |
| 3911 | Printer Status Port(prnstatus) |
| 3912 | Global Maintech Stars(gbmt-stars) |
| 3913 | ListCREATOR Port(listcrt-port) |
| 3914 | ListCREATOR Port 2(listcrt-port-2) |
| 3915 | Auto-Graphics Cataloging(agcat) |
| 3916 | WysDM Controller(wysdmc) |
| 3917 | AFT multiplex port(aftmux) |
| 3918 | PacketCableMultimediaCOPS(pktcablemmcops) |
| 3919 | HyperIP(hyperip) |
| 3920 | Exasoft IP Port(exasoftport1) |
| 3921 | Herodotus Net(herodotus-net) |
| 3922 | Soronti Update Port(sor-update) |
| 3923 | Symbian Service Broker(symb-sb-port) |
| 3924 | MPL_GPRS_PORT(mpl-gprs-port) |
| 3925 | Zoran Media Port(zmp) |
| 3926 | WINPort(winport) |
| 3927 | ScsTsr(natdataservice) |
| 3928 | PXE NetBoot Manager(netboot-pxe) |
| 3929 | AMS Port(smauth-port) |
| 3930 | Syam Web Server Port(syam-webserver) |
| 3931 | MSR Plugin Port(msr-plugin-port) |
| 3932 | Dynamic Site System(dyn-site) |
| 3933 | PL/B App Server User Port(plbserve-port) |
| 3934 | PL/B File Manager Port(sunfm-port) |
| 3935 | SDP Port Mapper Protocol(sdp-portmapper) |
| 3936 | Mailprox(mailprox) |
| 3937 | DVB Service Disc Port(dvbservdscport) |
| 3938 | Oracle dbControl Agent po(dbcontrol_agent) |
| 3939 | Anti-virus Application Management Port(aamp) |
| 3940 | XeCP Node Service(xecp-node) |
| 3941 | Home Portal Web Server(homeportal-web) |
| 3942 | satellite distribution(srdp) |
| 3943 | TetraNode Ip Gateway(tig) |
| 3944 | S-Ops Management(sops) |
| 3945 | EMCADS Server Port(emcads) |
| 3946 | BackupEDGE Server(backupedge) |
| 3947 | Connect and Control Protocol for Consumer, Commercial, and Industrial Electronic Devices(ccp) |
| 3948 | Anton Paar Device Administration Protocol(apdap) |
| 3949 | Dynamic Routing Information Protocol(drip) |
| 3950 | Name Munging(namemunge) |
| 3951 | PWG IPP Facsimile(pwgippfax) |
| 3952 | I3 Session Manager(i3-sessionmgr) |
| 3953 | Eydeas XMLink Connect(xmlink-connect) |
| 3954 | AD Replication RPC(adrep) |
| 3955 | p2pCommunity(p2pcommunity) |
| 3956 | GigE Vision Control(gvcp) |
| 3957 | MQEnterprise Broker(mqe-broker) |
| 3958 | MQEnterprise Agent(mqe-agent) |
| 3959 | Tree Hopper Networking(treehopper) |
| 3960 | Bess Peer Assessment(bess) |
| 3961 | ProAxess Server(proaxess) |
| 3962 | SBI Agent Protocol(sbi-agent) |
| 3963 | Teran Hybrid Routing Protocol(thrp) |
| 3964 | SASG GPRS(sasggprs) |
| 3965 | Avanti IP to NCPE API(ati-ip-to-ncpe) |
| 3966 | BuildForge Lock Manager(bflckmgr) |
| 3967 | PPS Message Service(ppsms) |
| 3968 | iAnywhere DBNS(ianywhere-dbns) |
| 3969 | Landmark Messages(landmarks) |
| 3970 | LANrev Agent(lanrevagent) |
| 3971 | LANrev Server(lanrevserver) |
| 3972 | ict-control Protocol(iconp) |
| 3973 | ConnectShip Progistics(progistics) |
| 3974 | Remote Applicant Tracking Service(citysearch) |
| 3975 | Air Shot(airshot) |
| 3976 | Opsware Agent(opswagent) |
| 3977 | Opsware Manager(opswmanager) |
| 3978 | Secured Configuration Server(secure-cfg-svr) |
| 3979 | Smith Micro Wide Area Network Service(smwan) |
| 3980 | Aircraft Cabin Management System(acms) |
| 3981 | Starfish System Admin(starfish) |
| 3982 | ESRI Image Server(eis) |
| 3983 | ESRI Image Service(eisp) |
| 3984 | MAPPER network node manager(mapper-nodemgr) |
| 3985 | MAPPER TCP/IP server(mapper-mapethd) |
| 3986 | MAPPER workstation server(mapper-ws_ethd) |
| 3987 | Centerline(centerline) |
| 3988 | DCS Configuration Port(dcs-config) |
| 3989 | BindView-Query Engine(bv-queryengine) |
| 3990 | BindView-IS(bv-is) |
| 3991 | BindView-SMCServer(bv-smcsrv) |
| 3992 | BindView-DirectoryServer(bv-ds) |
| 3993 | BindView-Agent(bv-agent) |
| 3994 | Objectika Administrator Server(objserver) |
| 3995 | ISS Management Svcs SSL(iss-mgmt-ssl) |
| 3996 | abcsoftware-01(abcsoftware) |
| 3997 | aes_db(agentsease-db) |
| 4000 | Terabase(terabase) |
| 4001 | NewOak(newoak) |
| 4002 | pxc-spvr-ft(pxc-spvr-ft) |
| 4003 | pxc-splr-ft(pxc-splr-ft) |
| 4004 | pxc-roid(pxc-roid) |
| 4005 | pxc-pin(pxc-pin) |
| 4006 | pxc-spvr(pxc-spvr) |
| 4007 | pxc-splr(pxc-splr) |
| 4008 | NetCheque accounting(netcheque) |
| 4009 | Chimera HWM(chimera-hwm) |
| 4010 | Samsung Unidex(samsung-unidex) |
| 4011 | Alternate Service Boot(altserviceboot) |
| 4012 | PDA Gate(pda-gate) |
| 4013 | ACL Manager(acl-manager) |
| 4014 | TAICLOCK(taiclock) |
| 4015 | Talarian Mcast(talarian-mcast1) |
| 4016 | Talarian Mcast(talarian-mcast2) |
| 4017 | Talarian Mcast(talarian-mcast3) |
| 4018 | Talarian Mcast(talarian-mcast4) |
| 4019 | Talarian Mcast(talarian-mcast5) |
| 4020 | TRAP Port(trap) |
| 4021 | Nexus Portal(nexus-portal) |
| 4022 | DNOX(dnox) |
| 4023 | ESNM Zoning Port(esnm-zoning) |
| 4024 | TNP1 User Port(tnp1-port) |
| 4025 | Partition Image Port(partimage) |
| 4026 | Graphical Debug Server(as-debug) |
| 4027 | bitxpress(bxp) |
| 4028 | DTServer Port(dtserver-port) |
| 4029 | IP Q signaling protocol(ip-qsig) |
| 4030 | Accell/JSP Daemon Port(jdmn-port) |
| 4031 | UUCP over SSL(suucp) |
| 4032 | VERITAS Authorization Service(vrts-auth-port) |
| 4033 | SANavigator Peer Port(sanavigator) |
| 4034 | Ubiquinox Daemon(ubxd) |
| 4035 | WAP Push OTA-HTTP port(wap-push-http) |
| 4036 | WAP Push OTA-HTTP secure(wap-push-https) |
| 4037 | RaveHD network control(ravehd) |
| 4038 | Fazzt Point-To-Point(fazzt-ptp) |
| 4039 | Fazzt Administration(fazzt-admin) |
| 4040 | Yo.net main service(yo-main) |
| 4041 | Rocketeer-Houston(houston) |
| 4042 | LDXP(ldxp) |
| 4043 | Neighbour Identity Resolution(nirp) |
| 4044 | Location Tracking Protocol(ltp) |
| 4045 | Network Paging Protocol(npp) |
| 4046 | Accounting Protocol(acp-proto) |
| 4047 | Context Transfer Protocol(ctp-state) |
| 4048 | Objectika Administrator Agent(objadmin) |
| 4049 | Wide Area File Services(wafs) |
| 4050 | Wide Area File Services(cisco-wafs) |
| 4051 | Cisco Peer to Peer Distribution Protocol(cppdp) |
| 4052 | VoiceConnect Interact(interact) |
| 4053 | CosmoCall Universe Communications Port 1(ccu-comm-1) |
| 4054 | CosmoCall Universe Communications Port 2(ccu-comm-2) |
| 4055 | CosmoCall Universe Communications Port 3(ccu-comm-3) |
| 4056 | Location Message Service(lms) |
| 4057 | Servigistics WFM server(wfm) |
| 4058 | Kingfisher protocol(kingfisher) |
| 4059 | DLMS/COSEM(dlms-cosem) |
| 4060 | DSMETER Inter-Agent Transfer Channel(dsmeter_iatc) |
| 4061 | Ice Location Service (TCP)(ice-location) |
| 4062 | Ice Location Service (SSL)(ice-slocation) |
| 4063 | Ice Firewall Traversal Service (TCP)(ice-router) |
| 4064 | Ice Firewall Traversal Service (SSL)(ice-srouter) |
| 4065 | Avanti Common Data(avanti_cdp) |
| 4066 | Performance Measurement and Analysis(pmas) |
| 4067 | Information Distribution Protocol(idp) |
| 4089 | OpenCORE Remote Control Service(opencore) |
| 4090 | OMA BCAST Service Guide(omasgport) |
| 4091 | EminentWare Installer(ewinstaller) |
| 4092 | EminentWare DGS(ewdgs) |
| 4093 | Pvx Plus CS Host(pvxpluscs) |
| 4094 | sysrq daemon(sysrqd) |
| 4095 | xtgui information service(xtgui) |
| 4096 | BRE (Bridge Relay Element)(bre) |
| 4097 | Patrol View(patrolview) |
| 4098 | drmsfsd(drmsfsd) |
| 4099 | DPCP(dpcp) |
| 4100 | IGo Incognito Data Port(igo-incognito) |
| 4101 | Braille protocol(brlp-0) |
| 4102 | Braille protocol(brlp-1) |
| 4103 | Braille protocol(brlp-2) |
| 4104 | Braille protocol(brlp-3) |
| 4105 | ShofarPlayer(shofarplayer) |
| 4106 | Synchronite(synchronite) |
| 4107 | JDL Accounting LAN Service(j-ac) |
| 4108 | ACCEL(accel) |
| 4109 | Instantiated Zero-control Messaging(izm) |
| 4110 | G2 RFID Tag Telemetry Data(g2tag) |
| 4111 | Xgrid(xgrid) |
| 4112 | Apple VPN Server Reporting Protocol(apple-vpns-rp) |
| 4113 | AIPN LS Registration(aipn-reg) |
| 4114 | JomaMQMonitor(jomamqmonitor) |
| 4115 | CDS Transfer Agent(cds) |
| 4116 | smartcard-TLS(smartcard-tls) |
| 4117 | xmLive Streaming Service(xmlivestream) |
| 4118 | Netadmin Systems NETscript service(netscript) |
| 4119 | Assuria Log Manager(assuria-slm) |
| 4121 | e-Builder Application Communication(e-builder) |
| 4122 | Fiber Patrol Alarm Service(fprams) |
| 4123 | Zensys Z-Wave Control Protocol(z-wave) |
| 4132 | NUTS Daemon(nuts_dem) |
| 4133 | NUTS Bootp Server(nuts_bootp) |
| 4134 | NIFTY-Serve HMI protocol(nifty-hmi) |
| 4135 | Classic Line Database Server Attach(cl-db-attach) |
| 4136 | Classic Line Database Server Request(cl-db-request) |
| 4137 | Classic Line Database Server Remote(cl-db-remote) |
| 4138 | nettest(nettest) |
| 4139 | Imperfect Networks Server(thrtx) |
| 4140 | Cedros Fraud Detection System(cedros_fds) |
| 4141 | Workflow Server(oirtgsvc) |
| 4142 | Document Server(oidocsvc) |
| 4143 | Document Replication(oidsr) |
| 4145 | VVR Control(vvr-control) |
| 4146 | TGCConnect Beacon(tgcconnect) |
| 4147 | Multum Service Manager(vrxpservman) |
| 4154 | atlinks device discovery(atlinks) |
| 4155 | Bazaar version control system(bzr) |
| 4159 | Network Security Service(nss) |
| 4160 | Jini Discovery(jini-discovery) |
| 4161 | OMS Contact(omscontact) |
| 4162 | OMS Topology(omstopology) |
| 4178 | StorMan(storman) |
| 4180 | HTTPX(httpx) |
| 4199 | EIMS ADMIN(eims-admin) |
| 4200 | |
| 4300 | Corel CCam(corelccam) |
| 4301 | Diagnostic Data(d-data) |
| 4302 | Diagnostic Data Control(d-data-control) |
| 4303 | Simple Railroad Command Protocol(srcp) |
| 4304 | One-Wire Filesystem Server(owserver) |
| 4309 | Exsequi Appliance Discovery(dserver) |
| 4320 | FDT Remote Categorization Protocol(fdt-rcatp) |
| 4321 | Remote Who Is(rwhois) |
| 4322 | TRIM Event Service(trim-event) |
| 4323 | TRIM ICE Service(trim-ice) |
| 4324 | Balour Game Server(balour) |
| 4325 | Cadcorp GeognoSIS Manager Service(geognosisman) |
| 4326 | Cadcorp GeognoSIS Service(geognosis) |
| 4343 | UNICALL(unicall) |
| 4344 | VinaInstall(vinainstall) |
| 4345 | Macro 4 Network AS(m4-network-as) |
| 4346 | ELAN LM(elanlm) |
| 4347 | LAN Surveyor(lansurveyor) |
| 4348 | ITOSE(itose) |
| 4349 | File System Port Map(fsportmap) |
| 4350 | Net Device(net-device) |
| 4351 | PLCY Net Services(plcy-net-svcs) |
| 4352 | Projector Link(pjlink) |
| 4353 | F5 iQuery(f5-iquery) |
| 4354 | QSNet Transmitter(qsnet-trans) |
| 4355 | QSNet Workstation(qsnet-workst) |
| 4356 | QSNet Assistant(qsnet-assist) |
| 4357 | QSNet Conductor(qsnet-cond) |
| 4358 | QSNet Nucleus(qsnet-nucl) |
| 4368 | WeatherBrief Direct(wxbrief) |
| 4369 | Erlang Port Mapper Daemon(epmd) |
| 4400 | ASIGRA Services(ds-srv) |
| 4401 | ASIGRA Televaulting DS-System Service(ds-srvr) |
| 4402 | ASIGRA Televaulting DS-Client Service(ds-clnt) |
| 4403 | ASIGRA Televaulting DS-Client Monitoring/Management(ds-user) |
| 4404 | ASIGRA Televaulting DS-System Monitoring/Management(ds-admin) |
| 4405 | ASIGRA Televaulting Message Level Restore service(ds-mail) |
| 4406 | ASIGRA Televaulting DS-Sleeper Service(ds-slp) |
| 4426 | SMARTS Beacon Port(beacon-port-2) |
| 4442 | Saris(saris) |
| 4443 | Pharos(pharos) |
| 4444 | KRB524(krb524) |
| 4444 | NV Video default(nv-video) |
| 4445 | UPNOTIFYP(upnotifyp) |
| 4446 | N1-FWP(n1-fwp) |
| 4447 | N1-RMGMT(n1-rmgmt) |
| 4448 | ASC Licence Manager(asc-slmd) |
| 4449 | PrivateWire(privatewire) |
| 4450 | Camp(camp) |
| 4451 | CTI System Msg(ctisystemmsg) |
| 4452 | CTI Program Load(ctiprogramload) |
| 4453 | NSS Alert Manager(nssalertmgr) |
| 4454 | NSS Agent Manager(nssagentmgr) |
| 4455 | PR Chat User(prchat-user) |
| 4456 | PR Chat Server(prchat-server) |
| 4457 | PR Register(prRegister) |
| 4458 | Matrix Configuration Protocol(mcp) |
| 4484 | hpssmgmt service(hpssmgmt) |
| 4500 | IPsec NAT-Traversal(ipsec-nat-t) |
| 4535 | Event Heap Server(ehs) |
| 4536 | Event Heap Server SSL(ehs-ssl) |
| 4537 | WSS Security Service(wssauthsvc) |
| 4538 | isigate(isigate) |
| 4545 | WorldScores(worldscores) |
| 4546 | SF License Manager (Sentinel)(sf-lm) |
| 4547 | Lanner License Manager(lanner-lm) |
| 4548 | Synchromesh(synchromesh) |
| 4549 | Aegate PMR Service(aegate) |
| 4550 | Perman I Interbase Server(gds-adppiw-db) |
| 4554 | MS FRS Replication(msfrs) |
| 4555 | RSIP Port(rsip) |
| 4556 | DTN Bundle TCP CL Protocol(dtn-bundle-tcp) |
| 4559 | HylaFAX(hylafax) |
| 4566 | Kids Watch Time Control Service(kwtc) |
| 4567 | TRAM(tram) |
| 4568 | BMC Reporting(bmc-reporting) |
| 4569 | Inter-Asterisk eXchange(iax) |
| 4597 | A21 (AN-1xBS)(a21-an-1xbs) |
| 4598 | A16 (AN-AN)(a16-an-an) |
| 4599 | A17 (AN-AN)(a17-an-an) |
| 4600 | Piranha1(piranha1) |
| 4601 | Piranha2(piranha2) |
| 4658 | PlayStation2 App Port(playsta2-app) |
| 4659 | PlayStation2 Lobby Port(playsta2-lob) |
| 4660 | smaclmgr(smaclmgr) |
| 4661 | Kar2ouche Peer location service(kar2ouche) |
| 4662 | OrbitNet Message Service(oms) |
| 4663 | Note It! Message Service(noteit) |
| 4664 | Rimage Messaging Server(ems) |
| 4665 | Container Client Message Service(contclientms) |
| 4666 | E-Port Message Service(eportcomm) |
| 4667 | MMA Comm Services(mmacomm) |
| 4668 | MMA EDS Service(mmaeds) |
| 4669 | E-Port Data Service(eportcommdata) |
| 4670 | Light packets transfer protocol(light) |
| 4671 | Bull RSF action server(acter) |
| 4672 | remote file access server(rfa) |
| 4673 | CXWS Operations(cxws) |
| 4674 | AppIQ Agent Management(appiq-mgmt) |
| 4675 | BIAP Device Status(dhct-status) |
| 4676 | BIAP Generic Alert(dhct-alerts) |
| 4677 | Business Continuity Servi(bcs) |
| 4678 | boundary traversal(traversal) |
| 4679 | MGE UPS Supervision(mgesupervision) |
| 4680 | MGE UPS Management(mgemanagement) |
| 4681 | Parliant Telephony System(parliant) |
| 4682 | finisar(finisar) |
| 4683 | Spike Clipboard Service(spike) |
| 4684 | RFID Reader Protocol 1.0(rfid-rp1) |
| 4685 | Autopac Protocol(autopac) |
| 4686 | Manina Service Protocol(msp-os) |
| 4687 | Network Scanner Tool FTP(nst) |
| 4688 | Mobile P2P Service(mobile-p2p) |
| 4689 | Altova DatabaseCentral(altovacentral) |
| 4690 | Prelude IDS message proto(prelude) |
| 4691 | Monotone Network Protocol(monotone) |
| 4692 | Conspiracy messaging(conspiracy) |
| 4700 | NetXMS Agent(netxms-agent) |
| 4701 | NetXMS Management(netxms-mgmt) |
| 4702 | NetXMS Server Synchronization(netxms-sync) |
| 4728 | CA Port Multiplexer(capmux) |
| 4737 | IPDR/SP(ipdr-sp) |
| 4738 | SoleraTec Locator(solera-lpn) |
| 4739 | IP Flow Info Export(ipfix) |
| 4739 | /sctp IP Flow Info Export(ipfix) |
| 4740 | ipfix protocol over TLS(ipfixs) |
| 4740 | /sctp ipfix protocol over DTLS(ipfixs) |
| 4742 | SICCT(sicct) |
| 4743 | openhpi HPI service(openhpid) |
| 4745 | Funambol Mobile Push(fmp) |
| 4749 | Profile for Mac(profilemac) |
| 4750 | Simple Service Auto Discovery(ssad) |
| 4751 | Simple Policy Control Protocol(spocp) |
| 4752 | Simple Network Audio Protocol(snap) |
| 4784 | BFD Multihop Control(bfd-multi-ctl) |
| 4800 | Icona Instant Messenging System(iims) |
| 4801 | Icona Web Embedded Chat(iwec) |
| 4802 | Icona License System Server(ilss) |
| 4827 | HTCP(htcp) |
| 4837 | Varadero-0(varadero-0) |
| 4838 | Varadero-1(varadero-1) |
| 4839 | Varadero-2(varadero-2) |
| 4840 | OPC UA TCP Protocol(opcua-tcp) |
| 4841 | QUOSA Virtual Library Service(quosa) |
| 4842 | nCode ICE-flow Library AppServer(gw-asv) |
| 4843 | OPC UA TCP Protocol over TLS/SSL(opcua-tls) |
| 4844 | nCode ICE-flow Library LogServer(gw-log) |
| 4848 | App Server - Admin HTTP(appserv-http) |
| 4849 | App Server - Admin HTTPS(appserv-https) |
| 4850 | Sun App Server - NA(sun-as-nodeagt) |
| 4867 | Unify Debugger(unify-debug) |
| 4868 | Photon Relay(phrelay) |
| 4869 | Photon Relay Debug(phrelaydbg) |
| 4870 | Citcom Tracking Service(cc-tracking) |
| 4871 | Wired(wired) |
| 4885 | ABBS(abbs) |
| 4894 | LysKOM Protocol A(lyskom) |
| 4899 | RAdmin Port(radmin-port) |
| 4900 | Hyper File Client/Server Database Engine(hfcs) |
| 4949 | Munin Graphing Framework(munin) |
| 4951 | PWG WIMS(pwgwims) |
| 4952 | SAG Directory Server(sagxtsds) |
| 4969 | CCSS QMessageMonitor(ccss-qmm) |
| 4970 | CCSS QSystemMonitor(ccss-qsm) |
| 4986 | Model Railway Interface Program(mrip) |
| 4987 | SMAR Ethernet Port 1(smar-se-port1) |
| 4988 | SMAR Ethernet Port 2(smar-se-port2) |
| 4989 | Parallel for GAUSS (tm)(parallel) |
| 4999 | Hyper File Client/Server Database Engine Manager(hfcs-manager) |
| 5000 | (commplex-main) |
| 5001 | (commplex-link) |
| 5002 | radio free ethernet(rfe) |
| 5003 | FileMaker, Inc. - Proprietary transport(fmpro-internal) |
| 5004 | avt-profile-1(avt-profile-1) |
| 5005 | avt-profile-2(avt-profile-2) |
| 5006 | wsm server(wsm-server) |
| 5007 | wsm server ssl(wsm-server-ssl) |
| 5008 | Synapsis EDGE(synapsis-edge) |
| 5009 | Microsoft Windows Filesystem(winfs) |
| 5010 | TelepathStart(telelpathstart) |
| 5011 | TelepathAttack(telelpathattack) |
| 5020 | zenginkyo-1(zenginkyo-1) |
| 5021 | zenginkyo-2(zenginkyo-2) |
| 5022 | mice server(mice) |
| 5023 | Htuil Server for PLD2(htuilsrv) |
| 5024 | SCPI-TELNET(scpi-telnet) |
| 5025 | SCPI-RAW(scpi-raw) |
| 5026 | Storix I/O daemon (data)(strexec-d) |
| 5027 | Storix I/O daemon (stat)(strexec-s) |
| 5030 | SurfPass(surfpass) |
| 5042 | asnaacceler8db(asnaacceler8db) |
| 5043 | ShopWorX Administration(swxadmin) |
| 5044 | LXI Event Service(lxi-evntsvc) |
| 5049 | iVocalize Web Conference(ivocalize) |
| 5050 | multimedia conference control tool(mmcc) |
| 5051 | ITA Agent(ita-agent) |
| 5052 | ITA Manager(ita-manager) |
| 5055 | UNOT(unot) |
| 5056 | Intecom Pointspan 1(intecom-ps1) |
| 5057 | Intecom Pointspan 2(intecom-ps2) |
| 5059 | SIP Directory Services(sds) |
| 5060 | SIP(sip) |
| 5061 | SIP-TLS(sip-tls) |
| 5064 | Channel Access 1(ca-1) |
| 5065 | Channel Access 2(ca-2) |
| 5066 | STANAG-5066-SUBNET-INTF(stanag-5066) |
| 5067 | Authentx Service(authentx) |
| 5069 | I/Net 2000-NPR(i-net-2000-npr) |
| 5070 | VersaTrans Server Agent Service(vtsas) |
| 5071 | PowerSchool(powerschool) |
| 5072 | Anything In Anything(ayiya) |
| 5073 | Advantage Group Port Mgr(tag-pm) |
| 5074 | ALES Query(alesquery) |
| 5081 | SDL - Ent Trans Server(sdl-ets) |
| 5084 | EPCglobal Low-Level Reader Protocol(llrp) |
| 5085 | EPCglobal Encrypted LLRP(encrypted-llrp) |
| 5090 | /sctp Candidate AR(car) |
| 5091 | /sctp Context Transfer Protocol(cxtp) |
| 5093 | Sentinel LM(sentinel-lm) |
| 5099 | SentLM Srv2Srv(sentlm-srv2srv) |
| 5100 | Socalia service mux(socalia) |
| 5101 | Talarian_TCP(talarian-tcp) |
| 5102 | Oracle OMS non-secure(oms-nonsecure) |
| 5112 | PeerMe Msg Cmd Service(pm-cmdsvr) |
| 5133 | Policy Commander(nbt-pc) |
| 5137 | MyCTS server port(ctsd) |
| 5145 | RMONITOR SECURE(rmonitor_secure) |
| 5150 | Ascend Tunnel Management Protocol(atmp) |
| 5151 | ESRI SDE Instance(esri_sde) |
| 5152 | ESRI SDE Instance Discovery(sde-discovery) |
| 5154 | BZFlag game server(bzflag) |
| 5155 | Oracle asControl Agent(asctrl-agent) |
| 5165 | ife_1corp(ife_icorp) |
| 5166 | WinPCS Service Connection(winpcs) |
| 5167 | SCTE104 Connection(scte104) |
| 5168 | SCTE30 Connection(scte30) |
| 5190 | America-Online(aol) |
| 5191 | AmericaOnline1(aol-1) |
| 5192 | AmericaOnline2(aol-2) |
| 5193 | AmericaOnline3(aol-3) |
| 5200 | TARGUS GetData(targus-getdata) |
| 5201 | TARGUS GetData 1(targus-getdata1) |
| 5202 | TARGUS GetData 2(targus-getdata2) |
| 5203 | TARGUS GetData 3(targus-getdata3) |
| 5222 | XMPP Client Connection(xmpp-client) |
| 5225 | HP Server(hp-server) |
| 5226 | HP Status(hp-status) |
| 5234 | EEnet communications(eenet) |
| 5236 | (padl2sim) |
| 5250 | soaGateway(soagateway) |
| 5251 | CA eTrust VM Service(caevms) |
| 5252 | Movaz SSC(movaz-ssc) |
| 5264 | 3Com Network Jack Port 1(3com-njack-1) |
| 5265 | 3Com Network Jack Port 2(3com-njack-2) |
| 5269 | XMPP Server Connection(xmpp-server) |
| 5272 | PK(pk) |
| 5282 | Marimba Transmitter Port(transmit-port) |
| 5300 | HA cluster heartbeat(hacl-hb) |
| 5301 | HA cluster general services(hacl-gs) |
| 5302 | HA cluster configuration(hacl-cfg) |
| 5303 | HA cluster probing(hacl-probe) |
| 5304 | HA Cluster Commands(hacl-local) |
| 5305 | HA Cluster Test(hacl-test) |
| 5306 | Sun MC Group(sun-mc-grp) |
| 5307 | SCO AIP(sco-aip) |
| 5308 | CFengine(cfengine) |
| 5309 | J Printer(jprinter) |
| 5310 | Outlaws(outlaws) |
| 5312 | Permabit Client-Server(permabit-cs) |
| 5313 | Real-time & Reliable Data(rrdp) |
| 5314 | opalis-rbt-ipc(opalis-rbt-ipc) |
| 5315 | HA Cluster UDP Polling(hacl-poll) |
| 5343 | Sculptor Database Server(kfserver) |
| 5344 | xkoto DRCP(xkotodrcp) |
| 5351 | NAT Port Mapping Protocol(nat-pmp) |
| 5352 | DNS Long-Lived Queries(dns-llq) |
| 5353 | Multicast DNS(mdns) |
| 5354 | Multicast DNS Responder IPC(mdnsresponder) |
| 5355 | LLMNR(llmnr) |
| 5356 | Microsoft Small Business(ms-smlbiz) |
| 5357 | Web Services for Devices(wsdapi) |
| 5358 | WS for Devices Secured(wsdapi-s) |
| 5397 | StressTester(tm) Injector(stresstester) |
| 5398 | Elektron Administration(elektron-admin) |
| 5399 | SecurityChase(securitychase) |
| 5400 | Excerpt Search(excerpt) |
| 5401 | Excerpt Search Secure(excerpts) |
| 5402 | OmniCast MFTP(mftp) |
| 5403 | HPOMS-CI-LSTN(hpoms-ci-lstn) |
| 5404 | HPOMS-DPS-LSTN(hpoms-dps-lstn) |
| 5405 | NetSupport(netsupport) |
| 5406 | Systemics Sox(systemics-sox) |
| 5407 | Foresyte-Clear(foresyte-clear) |
| 5408 | Foresyte-Sec(foresyte-sec) |
| 5409 | Salient Data Server(salient-dtasrv) |
| 5410 | Salient User Manager(salient-usrmgr) |
| 5411 | ActNet(actnet) |
| 5412 | Continuus(continuus) |
| 5413 | WWIOTALK(wwiotalk) |
| 5414 | StatusD(statusd) |
| 5415 | NS Server(ns-server) |
| 5416 | SNS Gateway(sns-gateway) |
| 5417 | SNS Agent(sns-agent) |
| 5418 | MCNTP(mcntp) |
| 5419 | DJ-ICE(dj-ice) |
| 5420 | Cylink-C(cylink-c) |
| 5421 | Net Support 2(netsupport2) |
| 5422 | Salient MUX(salient-mux) |
| 5423 | VIRTUALUSER(virtualuser) |
| 5424 | Beyond Remote(beyond-remote) |
| 5425 | Beyond Remote Command Channel(br-channel) |
| 5426 | DEVBASIC(devbasic) |
| 5427 | SCO-PEER-TTA(sco-peer-tta) |
| 5428 | TELACONSOLE(telaconsole) |
| 5429 | Billing and Accounting System Exchange(base) |
| 5430 | RADEC CORP(radec-corp) |
| 5431 | PARK AGENT(park-agent) |
| 5432 | PostgreSQL Database(postgresql) |
| 5433 | Pyrrho DBMS(pyrrho) |
| 5434 | SGI Array Services Daemon(sgi-arrayd) |
| 5435 | Data Tunneling Transceiver Linking (DTTL)(dttl) |
| 5453 | SureBox(surebox) |
| 5454 | APC 5454(apc-5454) |
| 5455 | APC 5455(apc-5455) |
| 5456 | APC 5456(apc-5456) |
| 5461 | SILKMETER(silkmeter) |
| 5462 | TTL Publisher(ttl-publisher) |
| 5463 | TTL Price Proxy(ttlpriceproxy) |
| 5464 | Quail Networks Object Broker(quailnet) |
| 5465 | NETOPS-BROKER(netops-broker) |
| 5500 | fcp-addr-srvr1(fcp-addr-srvr1) |
| 5501 | fcp-addr-srvr2(fcp-addr-srvr2) |
| 5502 | fcp-srvr-inst1(fcp-srvr-inst1) |
| 5503 | fcp-srvr-inst2(fcp-srvr-inst2) |
| 5504 | fcp-cics-gw1(fcp-cics-gw1) |
| 5553 | SGI Eventmond Port(sgi-eventmond) |
| 5554 | SGI ESP HTTP(sgi-esphttp) |
| 5555 | Personal Agent(personal-agent) |
| 5556 | Freeciv gameplay(freeciv) |
| 5566 | UDPPlus(udpplus) |
| 5567 | Multicast Object Access Protocol(m-oap) |
| 5568 | Session Data Transport Multicast(sdt) |
| 5580 | T-Mobile SMS Protocol Message 0(tmosms0) |
| 5581 | T-Mobile SMS Protocol Message 1(tmosms1) |
| 5584 | BeInSync-Web(bis-web) |
| 5585 | BeInSync-sync(bis-sync) |
| 5597 | inin secure messaging(ininmessaging) |
| 5598 | MCT Market Data Feed(mctfeed) |
| 5599 | Enterprise Security Remote Install(esinstall) |
| 5600 | Enterprise Security Manager(esmmanager) |
| 5601 | Enterprise Security Agent(esmagent) |
| 5602 | A1-MSC(a1-msc) |
| 5603 | A1-BS(a1-bs) |
| 5604 | A3-SDUNode(a3-sdunode) |
| 5605 | A4-SDUNode(a4-sdunode) |
| 5627 | Node Initiated Network Association Forma(ninaf) |
| 5629 | Symantec Storage Foundation for Database(symantec-sfdb) |
| 5630 | PreciseCommunication(precise-comm) |
| 5631 | pcANYWHEREdata(pcanywheredata) |
| 5632 | pcANYWHEREstat(pcanywherestat) |
| 5633 | BE Operations Request Listener(beorl) |
| 5672 | AMQP(amqp) |
| 5673 | JACL Message Server(jms) |
| 5674 | HyperSCSI Port(hyperscsi-port) |
| 5675 | V5UA application port(v5ua) |
| 5675 | /sctp V5UA application port(v5ua) |
| 5676 | RA Administration(raadmin) |
| 5677 | Quest Central DB2 Launchr(questdb2-lnchr) |
| 5678 | Remote Replication Agent Connection(rrac) |
| 5679 | Direct Cable Connect Manager(dccm) |
| 5680 | Auriga Router Service(auriga-router) |
| 5681 | Net-coneX Control Protocol(ncxcp) |
| 5688 | GGZ Gaming Zone(ggz) |
| 5689 | QM video network management protocol(qmvideo) |
| 5713 | proshare conf audio(proshareaudio) |
| 5714 | proshare conf video(prosharevideo) |
| 5715 | proshare conf data(prosharedata) |
| 5716 | proshare conf request(prosharerequest) |
| 5717 | proshare conf notify(prosharenotify) |
| 5718 | DPM Communication Server(dpm) |
| 5719 | DPM Agent Coordinator(dpm-agent) |
| 5720 | MS-Licensing(ms-licensing) |
| 5721 | Desktop Passthru Service(dtpt) |
| 5722 | Microsoft DFS Replication Service(msdfsr) |
| 5723 | Operations Manager - Health Service(omhs) |
| 5724 | Operations Manager - SDK Service(omsdk) |
| 5729 | Openmail User Agent Layer(openmail) |
| 5730 | Steltor's calendar access(unieng) |
| 5741 | IDA Discover Port 1(ida-discover1) |
| 5742 | IDA Discover Port 2(ida-discover2) |
| 5743 | Watchdoc NetPOD Protocol(watchdoc-pod) |
| 5744 | Watchdoc Server(watchdoc) |
| 5745 | fcopy-server(fcopy-server) |
| 5746 | fcopys-server(fcopys-server) |
| 5747 | Wildbits Tunatic(tunatic) |
| 5748 | Wildbits Tunalyzer(tunalyzer) |
| 5755 | OpenMail Desk Gateway server(openmailg) |
| 5757 | OpenMail X.500 Directory Server(x500ms) |
| 5766 | OpenMail NewMail Server(openmailns) |
| 5767 | OpenMail Suer Agent Layer (Secure)(s-openmail) |
| 5768 | OpenMail CMTS Server(openmailpxy) |
| 5769 | x509solutions Internal CA(spramsca) |
| 5770 | x509solutions Secure Data(spramsd) |
| 5771 | NetAgent(netagent) |
| 5777 | DALI Port(dali-port) |
| 5793 | XtreamX Supervised Peer message(xtreamx) |
| 5813 | ICMPD(icmpd) |
| 5814 | Support Automation(spt-automation) |
| 5859 | WHEREHOO(wherehoo) |
| 5863 | PlanetPress Suite Messeng(ppsuitemsg) |
| 5900 | VNC Server(vnc-server) |
| 5963 | Indy Application Server(indy) |
| 5968 | mppolicy-v5(mppolicy-v5) |
| 5969 | mppolicy-mgr(mppolicy-mgr) |
| 5983 | Sideband DMTF WS HTTP(dmtf-ws-http) |
| 5984 | Sideband DMTF WS HTTPS(dmtf-ws-https) |
| 5985 | WBEM WS-Management HTTP(wsman) |
| 5986 | WBEM WS-Management HTTP over TLS/SSL(wsmans) |
| 5987 | WBEM RMI(wbem-rmi) |
| 5988 | WBEM CIM-XML (HTTP)(wbem-http) |
| 5989 | WBEM CIM-XML (HTTPS)(wbem-https) |
| 5990 | WBEM Export HTTPS(wbem-exp-https) |
| 5991 | NUXSL(nuxsl) |
| 5992 | Consul InSight Security(consul-insight) |
| 5999 | CVSup(cvsup) |
| 6000 | |
| 6064 | NDL-AHP-SVC(ndl-ahp-svc) |
| 6065 | WinPharaoh(winpharaoh) |
| 6066 | EWCTSP(ewctsp) |
| 6067 | SRB(srb) |
| 6068 | GSMP(gsmp) |
| 6069 | TRIP(trip) |
| 6070 | Messageasap(messageasap) |
| 6071 | SSDTP(ssdtp) |
| 6072 | DIAGNOSE-PROC(diagnose-proc) |
| 6073 | DirectPlay8(directplay8) |
| 6074 | Microsoft Max(max) |
| 6085 | konspire2b p2p network(konspire2b) |
| 6086 | PDTP P2P(pdtp) |
| 6087 | Local Download Sharing Service(ldss) |
| 6100 | SynchroNet-db(synchronet-db) |
| 6101 | SynchroNet-rtc(synchronet-rtc) |
| 6102 | SynchroNet-upd(synchronet-upd) |
| 6103 | RETS(rets) |
| 6104 | DBDB(dbdb) |
| 6105 | Prima Server(primaserver) |
| 6106 | MPS Server(mpsserver) |
| 6107 | ETC Control(etc-control) |
| 6108 | Sercomm-SCAdmin(sercomm-scadmin) |
| 6109 | GLOBECAST-ID(globecast-id) |
| 6110 | HP SoftBench CM(softcm) |
| 6111 | HP SoftBench Sub-Process Control(spc) |
| 6112 | dtspcd(dtspcd) |
| 6122 | Backup Express Web Server(bex-webadmin) |
| 6123 | Backup Express(backup-express) |
| 6133 | New Boundary Tech WOL(nbt-wol) |
| 6141 | Meta Corporation License Manager(meta-corp) |
| 6142 | Aspen Technology License Manager(aspentec-lm) |
| 6143 | Watershed License Manager(watershed-lm) |
| 6144 | StatSci License Manager - 1(statsci1-lm) |
| 6145 | StatSci License Manager - 2(statsci2-lm) |
| 6146 | Lone Wolf Systems License Manager(lonewolf-lm) |
| 6147 | Montage License Manager(montage-lm) |
| 6148 | Ricardo North America License Manager(ricardo-lm) |
| 6149 | tal-pod(tal-pod) |
| 6161 | PATROL Internet Srv Mgr(patrol-ism) |
| 6162 | PATROL Collector(patrol-coll) |
| 6163 | Precision Scribe Cnx Port(pscribe) |
| 6200 | LM-X License Manager by X-Formation(lm-x) |
| 6222 | Radmind Access Protocol(radmind) |
| 6253 | CRIP(crip) |
| 6268 | Grid Authentication(grid) |
| 6269 | Grid Authentication Alt(grid-alt) |
| 6300 | BMC GRX(bmc-grx) |
| 6301 | BMC CONTROL-D LDAP SERVER(bmc_ctd_ldap) |
| 6320 | Double-Take Replication Service(repsvc) |
| 6321 | Empress Software Connectivity Server 1(emp-server1) |
| 6322 | Empress Software Connectivity Server 2(emp-server2) |
| 6343 | sFlow traffic monitoring(sflow) |
| 6346 | gnutella-svc(gnutella-svc) |
| 6347 | gnutella-rtr(gnutella-rtr) |
| 6382 | Metatude Dialogue Server(metatude-mds) |
| 6389 | clariion-evr01(clariion-evr01) |
| 6400 | (info-aps) |
| 6401 | (info-was) |
| 6402 | (info-eventsvr) |
| 6403 | (info-cachesvr) |
| 6404 | (info-filesvr) |
| 6405 | (info-pagesvr) |
| 6406 | (info-processvr) |
| 6407 | (reserved1) |
| 6408 | (reserved2) |
| 6409 | (reserved3) |
| 6410 | (reserved4) |
| 6417 | Faxcom Message Service(faxcomservice) |
| 6420 | NIM_VDRShell(nim-vdrshell) |
| 6421 | NIM_WAN(nim-wan) |
| 6443 | Service Registry Default HTTPS Domain(sun-sr-https) |
| 6444 | Grid Engine Qmaster Service(sge_qmaster) |
| 6445 | Grid Engine Execution Service(sge_execd) |
| 6455 | SKIP Certificate Receive(skip-cert-recv) |
| 6471 | LVision License Manager(lvision-lm) |
| 6480 | Service Registry Default HTTP Domain(sun-sr-http) |
| 6481 | Service Tags(servicetags) |
| 6484 | Service Registry Default JMS Domain(sun-sr-jms) |
| 6485 | Service Registry Default IIOP Domain(sun-sr-iiop) |
| 6486 | Service Registry Default IIOPS Domain(sun-sr-iiops) |
| 6487 | Service Registry Default IIOPAuth Domain(sun-sr-iiop-aut) |
| 6488 | Service Registry Default JMX Domain(sun-sr-jmx) |
| 6489 | Service Registry Default Admin Domain(sun-sr-admin) |
| 6500 | BoKS Master(boks) |
| 6501 | BoKS Servc(boks_servc) |
| 6502 | BoKS Servm(boks_servm) |
| 6503 | BoKS Clntd(boks_clntd) |
| 6505 | BoKS Admin Private Port(badm_priv) |
| 6506 | BoKS Admin Public Port(badm_pub) |
| 6507 | BoKS Dir Server, Private Port(bdir_priv) |
| 6508 | BoKS Dir Server, Public Port(bdir_pub) |
| 6509 | MGCS-MFP Port(mgcs-mfp-port) |
| 6510 | MCER Port(mcer-port) |
| 6543 | lds_distrib(lds-distrib) |
| 6544 | LDS Dump Service(lds-dump) |
| 6547 | APC 6547(apc-6547) |
| 6548 | APC 6548(apc-6548) |
| 6549 | APC 6549(apc-6549) |
| 6550 | fg-sysupdate(fg-sysupdate) |
| 6558 | (xdsxdm) |
| 6566 | SANE Control Port(sane-port) |
| 6567 | eSilo Storage Protocol(esp) |
| 6579 | Affiliate(affiliate) |
| 6580 | Parsec Masterserver(parsec-master) |
| 6581 | Parsec Peer-to-Peer(parsec-peer) |
| 6582 | Parsec Gameserver(parsec-game) |
| 6583 | JOA Jewel Suite(joaJewelSuite) |
| 6619 | ODETTE-FTP over TLS/SSL(odette-ftps) |
| 6620 | Kerberos V5 FTP Data(kftp-data) |
| 6621 | Kerberos V5 FTP Control(kftp) |
| 6622 | Multicast FTP(mcftp) |
| 6623 | Kerberos V5 Telnet(ktelnet) |
| 6626 | WAGO Service and Update(wago-service) |
| 6627 | Allied Electronics NeXGen(nexgen) |
| 6628 | AFE Stock Channel M/C(afesc-mc) |
| 6665 | |
| 6670 | Vocaltec Global Online Directory(vocaltec-gold) |
| 6672 | vision_server(vision_server) |
| 6673 | vision_elmd(vision_elmd) |
| 6701 | KTI/ICAD Nameserver(kti-icad-srvr) |
| 6702 | e-Design network(e-design-net) |
| 6703 | e-Design web(e-design-web) |
| 6714 | Internet Backplane Protocol(ibprotocol) |
| 6715 | Fibotrader Communications(fibotrader-com) |
| 6767 | BMC PERFORM AGENT(bmc-perf-agent) |
| 6768 | BMC PERFORM MGRD(bmc-perf-mgrd) |
| 6769 | ADInstruments GxP Server(adi-gxp-srvprt) |
| 6770 | PolyServe http(plysrv-http) |
| 6771 | PolyServe https(plysrv-https) |
| 6785 | DGPF Individual Exchange(dgpf-exchg) |
| 6786 | Sun Java Web Console JMX(smc-jmx) |
| 6787 | Sun Web Console Admin(smc-admin) |
| 6788 | SMC-HTTP(smc-http) |
| 6789 | SMC-HTTPS(smc-https) |
| 6790 | HNMP(hnmp) |
| 6791 | Halcyon Network Manager(hnm) |
| 6801 | ACNET Control System Protocol(acnet) |
| 6831 | ambit-lm(ambit-lm) |
| 6841 | Netmo Default(netmo-default) |
| 6842 | Netmo HTTP(netmo-http) |
| 6850 | ICCRUSHMORE(iccrushmore) |
| 6888 | MUSE(muse) |
| 6936 | XenSource Management Service(xsmsvc) |
| 6946 | Biometrics Server(bioserver) |
| 6951 | OTLP(otlp) |
| 6961 | JMACT3(jmact3) |
| 6962 | jmevt2(jmevt2) |
| 6963 | swismgr1(swismgr1) |
| 6964 | swismgr2(swismgr2) |
| 6965 | swistrap(swistrap) |
| 6966 | swispol(swispol) |
| 6969 | acmsoda(acmsoda) |
| 6998 | IATP-highPri(iatp-highpri) |
| 6999 | IATP-normalPri(iatp-normalpri) |
| 7000 | file server itself(afs3-fileserver) |
| 7001 | callbacks to cache managers(afs3-callback) |
| 7002 | users & groups database(afs3-prserver) |
| 7003 | volume location database(afs3-vlserver) |
| 7004 | AFS/Kerberos authentication service(afs3-kaserver) |
| 7005 | volume managment server(afs3-volser) |
| 7006 | error interpretation service(afs3-errors) |
| 7007 | basic overseer process(afs3-bos) |
| 7008 | server-to-server updater(afs3-update) |
| 7009 | remote cache manager service(afs3-rmtsys) |
| 7010 | onlinet uninterruptable power supplies(ups-onlinet) |
| 7011 | Talon Discovery Port(talon-disc) |
| 7012 | Talon Engine(talon-engine) |
| 7013 | Microtalon Discovery(microtalon-dis) |
| 7014 | Microtalon Communications(microtalon-com) |
| 7015 | Talon Webserver(talon-webserver) |
| 7020 | DP Serve(dpserve) |
| 7021 | DP Serve Admin(dpserveadmin) |
| 7022 | CT Discovery Protocol(ctdp) |
| 7023 | Comtech T2 NMCS(ct2nmcs) |
| 7024 | Vormetric service(vmsvc) |
| 7025 | Vormetric Service II(vmsvc-2) |
| 7030 | ObjectPlanet probe(op-probe) |
| 7070 | ARCP(arcp) |
| 7099 | lazy-ptop(lazy-ptop) |
| 7100 | X Font Service(font-service) |
| 7101 | Embedded Light Control Network(elcn) |
| 7121 | Virtual Prototypes License Manager(virprot-lm) |
| 7128 | intelligent data manager(scenidm) |
| 7129 | Catalog Content Search(scenccs) |
| 7161 | CA BSM Comm(cabsm-comm) |
| 7162 | CA Storage Manager(caistoragemgr) |
| 7163 | CA Connection Broker(cacsambroker) |
| 7174 | Clutild(clutild) |
| 7200 | FODMS FLIP(fodms) |
| 7201 | DLIP(dlip) |
| 7227 | Registry A & M Protocol(ramp) |
| 7272 | WatchMe Monitoring 7272(watchme-7272) |
| 7273 | OMA Roaming Location(oma-rlp) |
| 7274 | OMA Roaming Location SEC(oma-rlp-s) |
| 7275 | OMA UserPlane Location(oma-ulp) |
| 7280 | ITACTIONSERVER 1(itactionserver1) |
| 7281 | ITACTIONSERVER 2(itactionserver2) |
| 7300 | |
| 7365 | LifeKeeper Communications(lcm-server) |
| 7391 | mind-file system server(mindfilesys) |
| 7392 | mrss-rendezvous server(mrssrendezvous) |
| 7393 | nFoldMan Remote Publish(nfoldman) |
| 7394 | File system export of backup images(fse) |
| 7395 | winqedit(winqedit) |
| 7397 | Hexarc Command Language(hexarc) |
| 7400 | RTPS Discovery(rtps-discovery) |
| 7401 | RTPS Data-Distribution User-Traffic(rtps-dd-ut) |
| 7402 | RTPS Data-Distribution Meta-Traffic(rtps-dd-mt) |
| 7410 | Ionix Network Monitor(ionixnetmon) |
| 7421 | Matisse Port Monitor(mtportmon) |
| 7426 | OpenView DM Postmaster Manager(pmdmgr) |
| 7427 | OpenView DM Event Agent Manager(oveadmgr) |
| 7428 | OpenView DM Log Agent Manager(ovladmgr) |
| 7429 | OpenView DM rqt communication(opi-sock) |
| 7430 | OpenView DM xmpv7 api pipe(xmpv7) |
| 7431 | OpenView DM ovc/xmpv3 api pipe(pmd) |
| 7437 | Faximum(faximum) |
| 7443 | Oracle Application Server HTTPS(oracleas-https) |
| 7491 | telops-lmd(telops-lmd) |
| 7500 | Silhouette User(silhouette) |
| 7501 | HP OpenView Bus Daemon(ovbus) |
| 7510 | HP OpenView Application Server(ovhpas) |
| 7511 | pafec-lm(pafec-lm) |
| 7543 | atul server(atul) |
| 7544 | FlowAnalyzer DisplayServer(nta-ds) |
| 7545 | FlowAnalyzer UtilityServer(nta-us) |
| 7546 | Cisco Fabric service(cfs) |
| 7547 | DSL Forum CWMP(cwmp) |
| 7548 | Threat Information Distribution Protocol(tidp) |
| 7549 | Network Layer Signaling Transport Layer(nls-tl) |
| 7560 | Sniffer Command Protocol(sncp) |
| 7566 | VSI Omega(vsi-omega) |
| 7570 | Aries Kfinder(aries-kfinder) |
| 7588 | Sun License Manager(sun-lm) |
| 7624 | Instrument Neutral Distributed Interface(indi) |
| 7626 | SImple Middlebox COnfiguration (SIMCO) Server(simco) |
| 7626 | /sctp SImple Middlebox COnfiguration (SIMCO)(simco) |
| 7627 | SOAP Service Port(soap-http) |
| 7628 | Primary Agent Work Notification(zen-pawn) |
| 7629 | OpenXDAS Wire Protocol(xdas) |
| 7633 | PMDF Management(pmdfmgt) |
| 7648 | bonjour-cuseeme(cuseeme) |
| 7674 | iMQ SSL tunnel(imqtunnels) |
| 7675 | iMQ Tunnel(imqtunnel) |
| 7676 | iMQ Broker Rendezvous(imqbrokerd) |
| 7677 | Sun App Server - HTTPS(sun-user-https) |
| 7689 | Collaber Network Service(collaber) |
| 7697 | KLIO communications(klio) |
| 7707 | EM7 Dynamic Updates(sync-em7) |
| 7708 | scientia.net(scinet) |
| 7720 | MedImage Portal(medimageportal) |
| 7725 | Nitrogen Service(nitrogen) |
| 7726 | FreezeX Console Service(freezexservice) |
| 7727 | Trident Systems Data(trident-data) |
| 7738 | HP Enterprise Discovery Agent(aiagent) |
| 7743 | Sakura Script Transfer Protocol(sstp-1) |
| 7744 | RAQMON PDU(raqmon-pdu) |
| 7777 | cbt(cbt) |
| 7778 | Interwise(interwise) |
| 7779 | VSTAT(vstat) |
| 7781 | accu-lmgr(accu-lmgr) |
| 7786 | MINIVEND(minivend) |
| 7787 | Popup Reminders Receive(popup-reminders) |
| 7789 | Office Tools Pro Receive(office-tools) |
| 7794 | Q3ADE Cluster Service(q3ade) |
| 7797 | Propel Connector port(pnet-conn) |
| 7798 | Propel Encoder port(pnet-enc) |
| 7800 | Apple Software Restore(asr) |
| 7801 | Secure Server Protocol - client(ssp-client) |
| 7845 | APC 7845(apc-7845) |
| 7846 | APC 7846(apc-7846) |
| 7887 | Universal Broker(ubroker) |
| 7900 | Multicast Event(mevent) |
| 7901 | TNOS Service Protocol(tnos-sp) |
| 7902 | TNOS DiaguardProtocol(tnos-dp) |
| 7903 | TNOS Secure DiaguardProtocol(tnos-dps) |
| 7913 | QuickObjects secure port(qo-secure) |
| 7932 | Tier 2 Data Resource Manager(t2-drm) |
| 7933 | Tier 2 Business Rules Manager(t2-brm) |
| 7967 | Supercell(supercell) |
| 7979 | Micromuse-ncps(micromuse-ncps) |
| 7980 | Quest Vista(quest-vista) |
| 7999 | iRDMI2(irdmi2) |
| 8000 | iRDMI(irdmi) |
| 8001 | VCOM Tunnel(vcom-tunnel) |
| 8002 | Teradata ORDBMS(teradataordbms) |
| 8008 | HTTP Alternate(http-alt) |
| 8020 | Intuit Entitlement Service and Discovery(intu-ec-svcdisc) |
| 8021 | Intuit Entitlement Client(intu-ec-client) |
| 8022 | oa-system(oa-system) |
| 8025 | CA Audit Distribution Agent(ca-audit-da) |
| 8026 | CA Audit Distribution Server(ca-audit-ds) |
| 8032 | ProEd(pro-ed) |
| 8033 | MindPrint(mindprint) |
| 8052 | Senomix Timesheets Server(senomix01) |
| 8053 | Senomix Timesheets Client [1 year assignment](senomix02) |
| 8054 | Senomix Timesheets Server [1 year assignment](senomix03) |
| 8055 | Senomix Timesheets Server [1 year assignment](senomix04) |
| 8056 | Senomix Timesheets Server [1 year assignment](senomix05) |
| 8057 | Senomix Timesheets Client [1 year assignment](senomix06) |
| 8058 | Senomix Timesheets Client [1 year assignment](senomix07) |
| 8059 | Senomix Timesheets Client [1 year assignment](senomix08) |
| 8074 | Gadu-Gadu(gadugadu) |
| 8080 | HTTP Alternate (see port 80)(http-alt) |
| 8081 | Sun Proxy Admin Service(sunproxyadmin) |
| 8082 | Utilistor (Client)(us-cli) |
| 8083 | Utilistor (Server)(us-srv) |
| 8088 | Radan HTTP(radan-http) |
| 8097 | SAC Port Id(sac) |
| 8100 | Xprint Server(xprint-server) |
| 8115 | MTL8000 Matrix(mtl8000-matrix) |
| 8116 | Check Point Clustering(cp-cluster) |
| 8118 | Privoxy HTTP proxy(privoxy) |
| 8121 | Apollo Data Port(apollo-data) |
| 8122 | Apollo Admin Port(apollo-admin) |
| 8128 | PayCash Online Protocol(paycash-online) |
| 8129 | PayCash Wallet-Browser(paycash-wbp) |
| 8130 | INDIGO-VRMI(indigo-vrmi) |
| 8131 | INDIGO-VBCP(indigo-vbcp) |
| 8132 | dbabble(dbabble) |
| 8148 | i-SDD file transfer(isdd) |
| 8160 | Patrol(patrol) |
| 8161 | Patrol SNMP(patrol-snmp) |
| 8192 | SpyTech Phone Service(spytechphone) |
| 8194 | Bloomberg data API(blp1) |
| 8195 | Bloomberg feed(blp2) |
| 8199 | VVR DATA(vvr-data) |
| 8200 | TRIVNET(trivnet1) |
| 8201 | TRIVNET(trivnet2) |
| 8204 | LM Perfworks(lm-perfworks) |
| 8205 | LM Instmgr(lm-instmgr) |
| 8206 | LM Dta(lm-dta) |
| 8207 | LM SServer(lm-sserver) |
| 8208 | LM Webwatcher(lm-webwatcher) |
| 8230 | RexecJ Server(rexecj) |
| 8292 | Bloomberg professional(blp3) |
| 8294 | Bloomberg intelligent client(blp4) |
| 8300 | Transport Management Interface(tmi) |
| 8301 | Amberon PPC/PPS(amberon) |
| 8351 | Server Find(server-find) |
| 8376 | Cruise ENUM(cruise-enum) |
| 8377 | Cruise SWROUTE(cruise-swroute) |
| 8378 | Cruise CONFIG(cruise-config) |
| 8379 | Cruise DIAGS(cruise-diags) |
| 8380 | Cruise UPDATE(cruise-update) |
| 8383 | M2m Services(m2mservices) |
| 8400 | cvd(cvd) |
| 8401 | sabarsd(sabarsd) |
| 8402 | abarsd(abarsd) |
| 8403 | admind(admind) |
| 8416 | eSpeech Session Protocol(espeech) |
| 8417 | eSpeech RTP Protocol(espeech-rtp) |
| 8443 | PCsync HTTPS(pcsync-https) |
| 8444 | PCsync HTTP(pcsync-http) |
| 8450 | npmp(npmp) |
| 8473 | Virtual Point to Point(vp2p) |
| 8474 | AquaMinds NoteShare(noteshare) |
| 8500 | Flight Message Transfer Protocol(fmtp) |
| 8554 | RTSP Alternate (see port 554)(rtsp-alt) |
| 8555 | SYMAX D-FENCE(d-fence) |
| 8567 | Object Access Protocol Administration(oap-admin) |
| 8600 | Surveillance Data(asterix) |
| 8611 | Canon BJNP Port 1(canon-bjnp1) |
| 8612 | Canon BJNP Port 2(canon-bjnp2) |
| 8613 | Canon BJNP Port 3(canon-bjnp3) |
| 8614 | Canon BJNP Port 4(canon-bjnp4) |
| 8686 | Sun App Server - JMX/RMI(sun-as-jmxrmi) |
| 8699 | VNYX Primary Port(vnyx) |
| 8733 | iBus(ibus) |
| 8763 | MC-APPSERVER(mc-appserver) |
| 8764 | OPENQUEUE(openqueue) |
| 8765 | Ultraseek HTTP(ultraseek-http) |
| 8770 | Digital Photo Access Protocol(dpap) |
| 8786 | Message Client(msgclnt) |
| 8787 | Message Server(msgsrvr) |
| 8800 | Sun Web Server Admin Service(sunwebadmin) |
| 8804 | truecm(truecm) |
| 8873 | dxspider linking protocol(dxspider) |
| 8880 | CDDBP(cddbp-alt) |
| 8888 | NewsEDGE server TCP (TCP 1)(ddi-tcp-1) |
| 8889 | Desktop Data TCP 1(ddi-tcp-2) |
| 8890 | Desktop Data TCP 2(ddi-tcp-3) |
| 8891 | Desktop Data TCP 3: NESS application(ddi-tcp-4) |
| 8892 | Desktop Data TCP 4: FARM product(ddi-tcp-5) |
| 8893 | Desktop Data TCP 5: NewsEDGE/Web application(ddi-tcp-6) |
| 8894 | Desktop Data TCP 6: COAL application(ddi-tcp-7) |
| 8900 | JMB-CDS 1(jmb-cds1) |
| 8901 | JMB-CDS 2(jmb-cds2) |
| 8910 | manyone-http(manyone-http) |
| 8911 | manyone-xml(manyone-xml) |
| 8912 | Windows Client Backup(wcbackup) |
| 8913 | Dragonfly System Service(dragonfly) |
| 8954 | Cumulus Admin Port(cumulus-admin) |
| 8989 | Sun Web Server SSL Admin Service(sunwebadmins) |
| 8999 | Brodos Crypto Trade Protocol(bctp) |
| 9000 | CSlistener(cslistener) |
| 9001 | ETL Service Manager(etlservicemgr) |
| 9002 | DynamID authentication(dynamid) |
| 9009 | Pichat Server(pichat) |
| 9020 | TAMBORA(tambora) |
| 9021 | Pangolin Identification(panagolin-ident) |
| 9022 | PrivateArk Remote Agent(paragent) |
| 9023 | Secure Web Access - 1(swa-1) |
| 9024 | Secure Web Access - 2(swa-2) |
| 9025 | Secure Web Access - 3(swa-3) |
| 9026 | Secure Web Access - 4(swa-4) |
| 9080 | Groove GLRPC(glrpc) |
| 9087 | Classic Data Server(classic) |
| 9088 | IBM Informix SQL Interface(sqlexec) |
| 9089 | IBM Informix SQL Interface - Encrypted(sqlexec-ssl) |
| 9090 | WebSM(websm) |
| 9091 | xmltec-xmlmail(xmltec-xmlmail) |
| 9092 | Xml-Ipc Server Reg(XmlIpcRegSvc) |
| 9100 | PDL Data Streaming Port(hp-pdl-datastr) |
| 9100 | Printer PDL Data Stream(pdl-datastream) |
| 9101 | Bacula Director(bacula-dir) |
| 9102 | Bacula File Daemon(bacula-fd) |
| 9103 | Bacula Storage Daemon(bacula-sd) |
| 9104 | PeerWire(peerwire) |
| 9119 | MXit Instant Messaging(mxit) |
| 9131 | Dynamic Device Discovery(dddp) |
| 9160 | NetLOCK1(netlock1) |
| 9161 | NetLOCK2(netlock2) |
| 9162 | NetLOCK3(netlock3) |
| 9163 | NetLOCK4(netlock4) |
| 9164 | NetLOCK5(netlock5) |
| 9191 | Sun AppSvr JPDA(sun-as-jpda) |
| 9200 | WAP connectionless session service(wap-wsp) |
| 9201 | WAP session service(wap-wsp-wtp) |
| 9202 | WAP secure connectionless session service(wap-wsp-s) |
| 9203 | WAP secure session service(wap-wsp-wtp-s) |
| 9204 | WAP vCard(wap-vcard) |
| 9205 | WAP vCal(wap-vcal) |
| 9206 | WAP vCard Secure(wap-vcard-s) |
| 9207 | WAP vCal Secure(wap-vcal-s) |
| 9208 | rjcdb vCard(rjcdb-vcards) |
| 9209 | ALMobile System Service(almobile-system) |
| 9210 | OMA Mobile Location Protocol(oma-mlp) |
| 9211 | OMA Mobile Location Protocol Secure(oma-mlp-s) |
| 9212 | Server View dbms access(serverviewdbms) |
| 9213 | ServerStart RemoteControl(serverstart) |
| 9214 | IPDC ESG BootstrapService(ipdcesgbs) |
| 9215 | Integrated Setup and Install Service(insis) |
| 9216 | Aionex Communication Management Engine(acme) |
| 9217 | FSC Communication Port(fsc-port) |
| 9222 | QSC Team Coherence(teamcoherence) |
| 9281 | SofaWare transport port 1(swtp-port1) |
| 9282 | SofaWare transport port 2(swtp-port2) |
| 9283 | CallWaveIAM(callwaveiam) |
| 9284 | VERITAS Information Serve(visd) |
| 9285 | N2H2 Filter Service Port(n2h2server) |
| 9287 | Cumulus(cumulus) |
| 9292 | ArmTech Daemon(armtechdaemon) |
| 9293 | StorView Client(storview) |
| 9294 | ARMCenter http Service(armcenterhttp) |
| 9295 | ARMCenter https Service(armcenterhttps) |
| 9300 | Virtual Racing Service(vrace) |
| 9318 | PKIX TimeStamp over TLS(secure-ts) |
| 9321 | guibase(guibase) |
| 9343 | MpIdcMgr(mpidcmgr) |
| 9344 | Mphlpdmc(mphlpdmc) |
| 9346 | C Tech Licensing(ctechlicensing) |
| 9374 | fjdmimgr(fjdmimgr) |
| 9396 | fjinvmgr(fjinvmgr) |
| 9397 | MpIdcAgt(mpidcagt) |
| 9400 | Samsung Twain for Network Server(sec-t4net-srv) |
| 9401 | Samsung Twain for Network Client(sec-t4net-clt) |
| 9418 | git pack transfer service(git) |
| 9443 | WSO2 Tungsten HTTPS(tungsten-https) |
| 9500 | ismserver(ismserver) |
| 9535 | Management Suite Remote Control(mngsuite) |
| 9555 | Trispen Secure Remote Access(trispen-sra) |
| 9592 | LANDesk Gateway(ldgateway) |
| 9593 | LANDesk Management Agent(cba8) |
| 9594 | Message System(msgsys) |
| 9595 | Ping Discovery Service(pds) |
| 9596 | Mercury Discovery(mercury-disc) |
| 9597 | PD Administration(pd-admin) |
| 9598 | Very Simple Ctrl Protocol(vscp) |
| 9599 | Robix(robix) |
| 9600 | MICROMUSE-NCPW(micromuse-ncpw) |
| 9612 | StreamComm User Directory(streamcomm-ds) |
| 9700 | Board M.I.T. Service(board-roar) |
| 9747 | L5NAS Parallel Channel(l5nas-parchan) |
| 9750 | Board M.I.T. Synchronous Collaboration(board-voip) |
| 9753 | rasadv(rasadv) |
| 9762 | WSO2 Tungsten HTTP(tungsten-http) |
| 9800 | WebDav Source Port(davsrc) |
| 9801 | Sakura Script Transfer Protocol-2(sstp-2) |
| 9802 | WebDAV Source TLS/SSL(davsrcs) |
| 9875 | Session Announcement v1(sapv1) |
| 9876 | Session Director(sd) |
| 9888 | CYBORG Systems(cyborg-systems) |
| 9898 | MonkeyCom(monkeycom) |
| 9899 | SCTP TUNNELING(sctp-tunneling) |
| 9900 | IUA(iua) |
| 9900 | /sctp IUA(iua) |
| 9901 | /sctp enrp server channel(enrp-sctp) |
| 9902 | /sctp enrp/tls server channel(enrp-sctp-tls) |
| 9909 | domaintime(domaintime) |
| 9911 | SYPECom Transport Protocol(sype-transport) |
| 9950 | APC 9950(apc-9950) |
| 9951 | APC 9951(apc-9951) |
| 9952 | APC 9952(apc-9952) |
| 9953 | 9953(acis) |
| 9966 | OKI Data Network Setting Protocol(odnsp) |
| 9987 | DSM/SCM Target Interface(dsm-scm-target) |
| 9990 | OSM Applet Server(osm-appsrvr) |
| 9991 | OSM Event Server(osm-oev) |
| 9992 | OnLive-1(palace-1) |
| 9993 | OnLive-2(palace-2) |
| 9994 | OnLive-3(palace-3) |
| 9995 | Palace-4(palace-4) |
| 9996 | Palace-5(palace-5) |
| 9997 | Palace-6(palace-6) |
| 9998 | Distinct32(distinct32) |
| 9999 | distinct(distinct) |
| 10000 | Network Data Management Protocol(ndmp) |
| 10001 | SCP Configuration Port(scp-config) |
| 10007 | MVS Capacity(mvs-capacity) |
| 10008 | Octopus Multiplexer(octopus) |
| 10009 | Systemwalker Desktop Patrol(swdtp-sv) |
| 10050 | Zabbix Agent(zabbix-agent) |
| 10051 | Zabbix Trapper(zabbix-trapper) |
| 10080 | Amanda(amanda) |
| 10081 | FAM Archive Server(famdc) |
| 10100 | VERITAS ITAP DDTP(itap-ddtp) |
| 10101 | eZmeeting(ezmeeting-2) |
| 10102 | eZproxy(ezproxy-2) |
| 10103 | eZrelay(ezrelay) |
| 10104 | Systemwalker Desktop Patrol(swdtp) |
| 10107 | VERITAS BCTP, server(bctp-server) |
| 10113 | NetIQ Endpoint(netiq-endpoint) |
| 10114 | NetIQ Qcheck(netiq-qcheck) |
| 10115 | NetIQ Endpoint(netiq-endpt) |
| 10116 | NetIQ VoIP Assessor(netiq-voipa) |
| 10128 | BMC-PERFORM-SERVICE DAEMON(bmc-perf-sd) |
| 10160 | QB Database Server(qb-db-server) |
| 10200 | Trigence AE Soap Service(trisoap) |
| 10252 | Apollo Relay Port(apollo-relay) |
| 10260 | Axis WIMP Port(axis-wimp-port) |
| 10288 | Blocks(blocks) |
| 10800 | Gestor de Acaparamiento para Pocket PCs(gap) |
| 10805 | LUCIA Pareja Data Group(lpdg) |
| 10990 | Auxiliary RMI Port(rmiaux) |
| 11000 | IRISA(irisa) |
| 11001 | Metasys(metasys) |
| 11111 | Viral Computing Environment (VCE)(vce) |
| 11112 | DICOM(dicom) |
| 11161 | sun cacao snmp access point(suncacao-snmp) |
| 11162 | sun cacao JMX-remoting access point(suncacao-jmxmp) |
| 11163 | sun cacao rmi registry access point(suncacao-rmi) |
| 11164 | sun cacao command-streaming access point(suncacao-csa) |
| 11165 | sun cacao web service access point(suncacao-websvc) |
| 11201 | smsqp(smsqp) |
| 11208 | WiFree Service(wifree) |
| 11319 | IMIP(imip) |
| 11320 | IMIP Channels Port(imip-channels) |
| 11321 | Arena Server Listen(arena-server) |
| 11367 | ATM UHAS(atm-uhas) |
| 11371 | OpenPGP HTTP Keyserver(hkp) |
| 11600 | Tempest Protocol Port(tempest-port) |
| 11720 | h323 Call Signal Alternate(h323callsigalt) |
| 11751 | Intrepid SSL(intrepid-ssl) |
| 11967 | SysInfo Service Protocol(sysinfo-sp) |
| 11997 | /sctp WorldMailExpress(wmereceiving) |
| 11998 | /sctp WorldMailExpress(wmedistribution) |
| 11999 | /sctp WorldMailExpress(wmereporting) |
| 12000 | IBM Enterprise Extender SNA XID Exchange(entextxid) |
| 12001 | IBM Enterprise Extender SNA COS Network Priority(entextnetwk) |
| 12002 | IBM Enterprise Extender SNA COS High Priority(entexthigh) |
| 12003 | IBM Enterprise Extender SNA COS Medium Priority(entextmed) |
| 12004 | IBM Enterprise Extender SNA COS Low Priority(entextlow) |
| 12005 | DBISAM Database Server - Regular(dbisamserver1) |
| 12006 | DBISAM Database Server - Admin(dbisamserver2) |
| 12007 | Accuracer Database System ñ Server(accuracer) |
| 12008 | Accuracer Database System ñ Admin(accuracer-dbms) |
| 12012 | Vipera Messaging Service(vipera) |
| 12109 | RETS over SSL(rets-ssl) |
| 12121 | NuPaper Session Service(nupaper-ss) |
| 12168 | CA Web Access Service(cawas) |
| 12172 | HiveP(hivep) |
| 12300 | LinoGrid Engine(linogridengine) |
| 12321 | Warehouse Monitoring Syst SSS(warehouse-sss) |
| 12322 | Warehouse Monitoring Syst(warehouse) |
| 12345 | Italk Chat System(italk) |
| 12753 | tsaf port(tsaf) |
| 13160 | I-ZIPQD(i-zipqd) |
| 13223 | PowWow Client(powwow-client) |
| 13224 | PowWow Server(powwow-server) |
| 13720 | BPRD Protocol (VERITAS NetBackup)(bprd) |
| 13721 | BPDBM Protocol (VERITAS NetBackup)(bpdbm) |
| 13722 | BP Java MSVC Protocol(bpjava-msvc) |
| 13724 | Veritas Network Utility(vnetd) |
| 13782 | VERITAS NetBackup(bpcd) |
| 13783 | VOPIED Protocol(vopied) |
| 13785 | NetBackup Database(nbdb) |
| 13786 | Veritas-nomdb(nomdb) |
| 13818 | DSMCC Config(dsmcc-config) |
| 13819 | DSMCC Session Messages(dsmcc-session) |
| 13820 | DSMCC Pass-Thru Messages(dsmcc-passthru) |
| 13821 | DSMCC Download Protocol(dsmcc-download) |
| 13822 | DSMCC Channel Change Protocol(dsmcc-ccp) |
| 14001 | SUA(sua) |
| 14001 | /sctp SUA(sua) |
| 14033 | sage Best! Config Server 1(sage-best-com1) |
| 14034 | sage Best! Config Server 2(sage-best-com2) |
| 14141 | VCS Application(vcs-app) |
| 14142 | IceWall Cert Protocol(icpp) |
| 14145 | GCM Application(gcm-app) |
| 14149 | Veritas Traffic Director(vrts-tdd) |
| 14154 | Veritas Application Director(vad) |
| 14414 | CA eTrust Web Update Service(ca-web-update) |
| 14936 | hde-lcesrvr-1(hde-lcesrvr-1) |
| 14937 | hde-lcesrvr-2(hde-lcesrvr-2) |
| 15000 | Hypack Data Aquisition(hydap) |
| 15345 | XPilot Contact Port(xpilot) |
| 15363 | 3Link Negotiation(3link) |
| 15555 | Cisco Stateful NAT(cisco-snat) |
| 15740 | Picture Transfer Protocol(ptp) |
| 16161 | Solaris SEA Port(sun-sea-port) |
| 16309 | etb4j(etb4j) |
| 16310 | Policy Distribute, Update Notification(pduncs) |
| 16360 | netserialext1(netserialext1) |
| 16361 | netserialext2(netserialext2) |
| 16367 | netserialext3(netserialext3) |
| 16368 | netserialext4(netserialext4) |
| 16384 | Connected Corp(connected) |
| 16950 | Simple Generic Client Interface Protocol(sgcip) |
| 16991 | INTEL-RCI-MP(intel-rci-mp) |
| 16992 | Intel(R) AMT SOAP/HTTP(amt-soap-http) |
| 16993 | Intel(R) AMT SOAP/HTTPS(amt-soap-https) |
| 16994 | Intel(R) AMT Redirection(amt-redir-tcp) |
| 16995 | Intel(R) AMT Redirection/TLS(amt-redir-tls) |
| 17007 | (isode-dua) |
| 17185 | Sounds Virtual(soundsvirtual) |
| 17219 | Chipper(chipper) |
| 17235 | SSH Tectia Manager(ssh-mgmt) |
| 17729 | Eclipse Aviation(ea) |
| 17754 | Encap. ZigBee Packets(zep) |
| 17755 | ZigBee IP Transport Service(zigbee-ip) |
| 17756 | ZigBee IP Transport Secure Service(zigbee-ips) |
| 18000 | Beckman Instruments, Inc.(biimenu) |
| 18181 | OPSEC CVP(opsec-cvp) |
| 18182 | OPSEC UFP(opsec-ufp) |
| 18183 | OPSEC SAM(opsec-sam) |
| 18184 | OPSEC LEA(opsec-lea) |
| 18185 | OPSEC OMI(opsec-omi) |
| 18186 | Occupational Health SC(ohsc) |
| 18187 | OPSEC ELA(opsec-ela) |
| 18241 | Check Point RTM(checkpoint-rtm) |
| 18463 | AC Cluster(ac-cluster) |
| 18769 | IQue Protocol(ique) |
| 18881 | Infotos(infotos) |
| 18888 | APCNECMP(apc-necmp) |
| 19000 | iGrid Server(igrid) |
| 19191 | OPSEC UAA(opsec-uaa) |
| 19194 | UserAuthority SecureAgent(ua-secureagent) |
| 19283 | Key Server for SASSAFRAS(keysrvr) |
| 19315 | Key Shadow for SASSAFRAS(keyshadow) |
| 19398 | mtrgtrans(mtrgtrans) |
| 19410 | hp-sco(hp-sco) |
| 19411 | hp-sca(hp-sca) |
| 19412 | HP-SESSMON(hp-sessmon) |
| 19539 | FXUPTP(fxuptp) |
| 19540 | SXUPTP(sxuptp) |
| 19541 | JCP Client(jcp) |
| 20000 | DNP(dnp) |
| 20001 | MicroSAN(microsan) |
| 20002 | Commtact HTTP(commtact-http) |
| 20003 | Commtact HTTPS(commtact-https) |
| 20014 | OpenDeploy Listener(opendeploy) |
| 20034 | NetBurner ID Port(nburn_id) |
| 20167 | TOLfab Data Change(tolfab) |
| 20202 | IPD Tunneling Port(ipdtp-port) |
| 20222 | iPulse-ICS(ipulse-ics) |
| 20670 | Track(track) |
| 20999 | At Hand MMP(athand-mmp) |
| 21000 | IRTrans Control(irtrans) |
| 21554 | MineScape Design File Server(dfserver) |
| 21590 | VoFR Gateway(vofr-gateway) |
| 21800 | TVNC Pro Multiplexing(tvpm) |
| 21845 | webphone(webphone) |
| 21846 | NetSpeak Corp. Directory Services(netspeak-is) |
| 21847 | NetSpeak Corp. Connection Services(netspeak-cs) |
| 21848 | NetSpeak Corp. Automatic Call Distribution(netspeak-acd) |
| 21849 | NetSpeak Corp. Credit Processing System(netspeak-cps) |
| 22000 | SNAPenetIO(snapenetio) |
| 22001 | OptoControl(optocontrol) |
| 22002 | Opto Host Port 2(optohost002) |
| 22003 | Opto Host Port 3(optohost003) |
| 22004 | Opto Host Port 4(optohost004) |
| 22005 | Opto Host Port 5(optohost004) |
| 22273 | wnn6(wnn6) |
| 22555 | Vocaltec Web Conference(vocaltec-wconf) |
| 22763 | Talika Main Server(talikaserver) |
| 22800 | Telerate Information Platform LAN(aws-brf) |
| 22951 | Telerate Information Platform WAN(brf-gw) |
| 23000 | Inova LightLink Server Type 1(inovaport1) |
| 23001 | Inova LightLink Server Type 2(inovaport2) |
| 23002 | Inova LightLink Server Type 3(inovaport3) |
| 23003 | Inova LightLink Server Type 4(inovaport4) |
| 23004 | Inova LightLink Server Type 5(inovaport5) |
| 23005 | Inova LightLink Server Type 6(inovaport6) |
| 23400 | Novar Data(novar-dbase) |
| 23401 | Novar Alarm(novar-alarm) |
| 23402 | Novar Global(novar-global) |
| 24000 | med-ltp(med-ltp) |
| 24001 | med-fsp-rx(med-fsp-rx) |
| 24002 | med-fsp-tx(med-fsp-tx) |
| 24003 | med-supp(med-supp) |
| 24004 | med-ovw(med-ovw) |
| 24005 | med-ci(med-ci) |
| 24006 | med-net-svc(med-net-svc) |
| 24242 | fileSphere(filesphere) |
| 24321 | Isolv Local Directory(ild) |
| 24249 | Vista 4GL(vista-4gl) |
| 24386 | Intel RCI(intel_rci) |
| 24554 | BINKP(binkp) |
| 24677 | FlashFiler(flashfiler) |
| 24678 | Turbopower Proactivate(proactivate) |
| 24680 | TCC User HTTP Service(tcc-http) |
| 24922 | Find Identification of Network Devices(find) |
| 25000 | icl-twobase1(icl-twobase1) |
| 25001 | icl-twobase2(icl-twobase2) |
| 25002 | icl-twobase3(icl-twobase3) |
| 25003 | icl-twobase4(icl-twobase4) |
| 25004 | icl-twobase5(icl-twobase5) |
| 25005 | icl-twobase6(icl-twobase6) |
| 25006 | icl-twobase7(icl-twobase7) |
| 25007 | icl-twobase8(icl-twobase8) |
| 25008 | icl-twobase9(icl-twobase9) |
| 25009 | icl-twobase10(icl-twobase10) |
| 25793 | Vocaltec Address Server(vocaltec-hos) |
| 25900 | TASP Network Comm(tasp-net) |
| 25901 | NIObserver(niobserver) |
| 25903 | NIProbe(niprobe) |
| 26000 | quake(quake) |
| 26208 | wnn6-ds(wnn6-ds) |
| 26260 | eZproxy(ezproxy) |
| 26261 | eZmeeting(ezmeeting) |
| 26262 | K3 Software-Server(k3software-svr) |
| 26263 | K3 Software-Client(k3software-cli) |
| 26486 | EXOline-TCP(exoline-tcp) |
| 26487 | EXOconfig(exoconfig) |
| 26489 | EXOnet(exonet) |
| 27000 | |
| 27345 | ImagePump(imagepump) |
| 27442 | Job controller service(jesmsjc) |
| 27504 | Kopek HTTP Head Port(kopek-httphead) |
| 27782 | ARS VISTA Application(ars-vista) |
| 27999 | TW Authentication/Key Distribution and(tw-auth-key) |
| 28000 | NX License Manager(nxlmd) |
| 28240 | Siemens GSM(siemensgsm) |
| 29167 | ObTools Message Protocol(otmp) |
| 30001 | Pago Services 1(pago-services1) |
| 30002 | Pago Services 2(pago-services2) |
| 30999 | OpenView Service Desk Client(ovobs) |
| 31416 | XQoS network monitor(xqosd) |
| 31457 | TetriNET Protocol(tetrinet) |
| 31620 | lm mon(lm-mon) |
| 31765 | GameSmith Port(gamesmith-port) |
| 31948 | Embedded Device Configuration Protocol TX(iceedcp_tx) |
| 31949 | Embedded Device Configuration Protocol RX(iceedcp_rx) |
| 32249 | T1 Distributed Processor(t1distproc60) |
| 32483 | Access Point Manager Link(apm-link) |
| 32635 | SecureNotebook-CLNT(sec-ntb-clnt) |
| 32767 | FileNet BPM WS-ReliableMessaging Client(filenet-powsrm) |
| 32768 | Filenet TMS(filenet-tms) |
| 32769 | Filenet RPC(filenet-rpc) |
| 32770 | Filenet NCH(filenet-nch) |
| 32771 | FileNET RMI(filenet-rmi) |
| 32772 | FileNET Process Analyzer(filenet-pa) |
| 32773 | FileNET Component Manager(filenet-cm) |
| 32774 | FileNET Rules Engine(filenet-re) |
| 32775 | Performance Clearinghouse(filenet-pch) |
| 32776 | FileNET BPM IOR(filenet-peior) |
| 32777 | FileNet BPM CORBA(filenet-obrok) |
| 32896 | Attachmate ID Manager(idmgratm) |
| 33331 | DiamondCentral Interface(diamondport) |
| 33434 | traceroute use(traceroute) |
| 33656 | SNIP Slave(snip-slave) |
| 34249 | TurboNote Relay Server Default Port(turbonote-2) |
| 34378 | P-Net on IP local(p-net-local) |
| 34379 | P-Net on IP remote(p-net-remote) |
| 34962 | PROFInet RT Unicast(profinet-rt) |
| 34963 | PROFInet RT Multicast(profinet-rtm) |
| 34964 | PROFInet Context Manager(profinet-cm) |
| 34980 | EtherCAT Port(ethercat) |
| 36865 | KastenX Pipe(kastenxpipe) |
| 37475 | science + computing's Venus Administration Port(neckar) |
| 37654 | Unisys ClearPath ePortal(unisys-eportal) |
| 38201 | Galaxy7 Data Tunnel(galaxy7-data) |
| 38202 | Fairview Message Service(fairview) |
| 38203 | AppGate Policy Server(agpolicy) |
| 39681 | TurboNote Default Port(turbonote-1) |
| 40000 | SafetyNET p(safetynetp) |
| 40841 | CSCP(cscp) |
| 40842 | CSCCREDIR(csccredir) |
| 40843 | CSCCFIREWALL(csccfirewall) |
| 41111 | Foursticks QoS Protocol(fs-qos) |
| 41794 | Crestron Control Port(crestron-cip) |
| 41795 | Crestron Terminal Port(crestron-ctp) |
| 42508 | Computer Associates network discovery protocol(candp) |
| 42509 | CA discovery response(candrp) |
| 42510 | CA eTrust RPC(caerpc) |
| 43188 | REACHOUT(reachout) |
| 43189 | NDM-AGENT-PORT(ndm-agent-port) |
| 43190 | IP-PROVISION(ip-provision) |
| 43441 | Cisco NetMgmt DB Ports(ciscocsdb) |
| 44321 | PCP server (pmcd)(pmcd) |
| 44322 | PCP server (pmcd) proxy(pmcdproxy) |
| 44553 | REALbasic Remote Debug(rbr-debug) |
| 44818 | Rockwell Encapsulation(rockwell-encap) |
| 45054 | InVision AG(invision-ag) |
| 45678 | EBA PRISE(eba) |
| 45966 | SSRServerMgr(ssr-servermgr) |
| 46999 | MediaBox Server(mediabox) |
| 47000 | Message Bus(mbus) |
| 47557 | Databeam Corporation(dbbrowse) |
| 47624 | Direct Play Server(directplaysrvr) |
| 47806 | ALC Protocol(ap) |
| 47808 | Building Automation and Control Networks(bacnet) |
| 48000 | Nimbus Controller(nimcontroller) |
| 48001 | Nimbus Spooler(nimspooler) |
| 48002 | Nimbus Hub(nimhub) |
| 48003 | Nimbus Gateway(nimgtw) |
| 48128 | Image Systems Network Services(isnetserv) |
| 48129 | Bloomberg locator(blp5) |
| 48556 | com-bardac-dw(com-bardac-dw) |
| 48619 | iqobject(iqobject) |
